Greasy Fork is available in English.

🔥🔥网易,酷我,酷狗支持歌词和歌曲下载(包含大部分VIP歌曲)🔥🔥

网易,酷我,酷狗支持当前页歌词下载,同时支持歌曲mp3下载(包含大部分VIP歌曲)。

このスクリプトの質問や評価の投稿はこちら通報はこちらへお寄せください。
// ==UserScript==
// @name         🔥🔥网易,酷我,酷狗支持歌词和歌曲下载(包含大部分VIP歌曲)🔥🔥
// @namespace    https://www.softrr.cn/
// @version      1.3.1
// @author       hackhase
// @description  网易,酷我,酷狗支持当前页歌词下载,同时支持歌曲mp3下载(包含大部分VIP歌曲)。
// @license      MIT
// @icon         http://s1.music.126.net/style/favicon.ico?v20180823
// @match        *://music.163.com/*
// @match        *://*.kuwo.cn/play_detail/*
// @match        *://*.kugou.com/mixsong/*
// @match        *://*.kugou.com/song/*
// @require      https://cdn.jsdelivr.net/npm/vue@3.3.11/dist/vue.global.prod.js
// @require      data:application/javascript,%3Bwindow.Vue%3DVue%3B
// @require      https://cdn.jsdelivr.net/npm/element-plus@2.5.5/dist/index.full.min.js
// @resource     element-plus/dist/index.css  https://cdn.jsdelivr.net/npm/element-plus@2.5.5/dist/index.css
// @connect      www.softrr.cn
// @connect      music.163.com
// @connect      music.163.com
// @connect      m.kuwo.cn
// @connect      wwwapi.kugou.com
// @connect      www.xmwav.com
// @grant        GM_addStyle
// @grant        GM_download
// @grant        GM_getResourceText
// @grant        GM_xmlhttpRequest
// @grant        unsafeWindow
// @noframes
// ==/UserScript==

(o=>{if(typeof GM_addStyle=="function"){GM_addStyle(o);return}const e=document.createElement("style");e.textContent=o,document.head.append(e)})(' @charset "UTF-8";:root{font-family:Inter,Avenir,Helvetica,Arial,sans-serif;font-size:16px;line-height:24px;font-weight:400;color-scheme:light dark;color:#ffffffde;background-color:#242424;font-synthesis:none;text-rendering:optimizeLegibility;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale;-webkit-text-size-adjust:100%}a{font-weight:500;color:#646cff;text-decoration:inherit}a:hover{color:#535bf2}body{margin:0;place-items:center;min-width:320px;min-height:100vh}h1{font-size:3.2em;line-height:1.1}button{border-radius:8px;border:1px solid transparent;padding:.6em 1.2em;font-size:1em;font-weight:500;font-family:inherit;background-color:#1a1a1a;cursor:pointer;transition:border-color .25s}button:hover{border-color:#646cff}button:focus,button:focus-visible{outline:4px auto -webkit-focus-ring-color}.card{padding:2em}@media (prefers-color-scheme: light){:root{color:#213547;background-color:#fff}a:hover{color:#747bff}button{background-color:#f9f9f9}}:root{--el-color-white:#ffffff;--el-color-black:#000000;--el-color-primary-rgb:64,158,255;--el-color-success-rgb:103,194,58;--el-color-warning-rgb:230,162,60;--el-color-danger-rgb:245,108,108;--el-color-error-rgb:245,108,108;--el-color-info-rgb:144,147,153;--el-font-size-extra-large:20px;--el-font-size-large:18px;--el-font-size-medium:16px;--el-font-size-base:14px;--el-font-size-small:13px;--el-font-size-extra-small:12px;--el-font-family:"Helvetica Neue",Helvetica,"PingFang SC","Hiragino Sans GB","Microsoft YaHei","\u5FAE\u8F6F\u96C5\u9ED1",Arial,sans-serif;--el-font-weight-primary:500;--el-font-line-height-primary:24px;--el-index-normal:1;--el-index-top:1000;--el-index-popper:2000;--el-border-radius-base:4px;--el-border-radius-small:2px;--el-border-radius-round:20px;--el-border-radius-circle:100%;--el-transition-duration:.3s;--el-transition-duration-fast:.2s;--el-transition-function-ease-in-out-bezier:cubic-bezier(.645, .045, .355, 1);--el-transition-function-fast-bezier:cubic-bezier(.23, 1, .32, 1);--el-transition-all:all var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier);--el-transition-fade:opacity var(--el-transition-duration) var(--el-transition-function-fast-bezier);--el-transition-md-fade:transform var(--el-transition-duration) var(--el-transition-function-fast-bezier),opacity var(--el-transition-duration) var(--el-transition-function-fast-bezier);--el-transition-fade-linear:opacity var(--el-transition-duration-fast) linear;--el-transition-border:border-color var(--el-transition-duration-fast) var(--el-transition-function-ease-in-out-bezier);--el-transition-box-shadow:box-shadow var(--el-transition-duration-fast) var(--el-transition-function-ease-in-out-bezier);--el-transition-color:color var(--el-transition-duration-fast) var(--el-transition-function-ease-in-out-bezier);--el-component-size-large:40px;--el-component-size:32px;--el-component-size-small:24px}:root{color-scheme:light;--el-color-white:#ffffff;--el-color-black:#000000;--el-color-primary:#409eff;--el-color-primary-light-3:#79bbff;--el-color-primary-light-5:#a0cfff;--el-color-primary-light-7:#c6e2ff;--el-color-primary-light-8:#d9ecff;--el-color-primary-light-9:#ecf5ff;--el-color-primary-dark-2:#337ecc;--el-color-success:#67c23a;--el-color-success-light-3:#95d475;--el-color-success-light-5:#b3e19d;--el-color-success-light-7:#d1edc4;--el-color-success-light-8:#e1f3d8;--el-color-success-light-9:#f0f9eb;--el-color-success-dark-2:#529b2e;--el-color-warning:#e6a23c;--el-color-warning-light-3:#eebe77;--el-color-warning-light-5:#f3d19e;--el-color-warning-light-7:#f8e3c5;--el-color-warning-light-8:#faecd8;--el-color-warning-light-9:#fdf6ec;--el-color-warning-dark-2:#b88230;--el-color-danger:#f56c6c;--el-color-danger-light-3:#f89898;--el-color-danger-light-5:#fab6b6;--el-color-danger-light-7:#fcd3d3;--el-color-danger-light-8:#fde2e2;--el-color-danger-light-9:#fef0f0;--el-color-danger-dark-2:#c45656;--el-color-error:#f56c6c;--el-color-error-light-3:#f89898;--el-color-error-light-5:#fab6b6;--el-color-error-light-7:#fcd3d3;--el-color-error-light-8:#fde2e2;--el-color-error-light-9:#fef0f0;--el-color-error-dark-2:#c45656;--el-color-info:#909399;--el-color-info-light-3:#b1b3b8;--el-color-info-light-5:#c8c9cc;--el-color-info-light-7:#dedfe0;--el-color-info-light-8:#e9e9eb;--el-color-info-light-9:#f4f4f5;--el-color-info-dark-2:#73767a;--el-bg-color:#ffffff;--el-bg-color-page:#f2f3f5;--el-bg-color-overlay:#ffffff;--el-text-color-primary:#303133;--el-text-color-regular:#606266;--el-text-color-secondary:#909399;--el-text-color-placeholder:#a8abb2;--el-text-color-disabled:#c0c4cc;--el-border-color:#dcdfe6;--el-border-color-light:#e4e7ed;--el-border-color-lighter:#ebeef5;--el-border-color-extra-light:#f2f6fc;--el-border-color-dark:#d4d7de;--el-border-color-darker:#cdd0d6;--el-fill-color:#f0f2f5;--el-fill-color-light:#f5f7fa;--el-fill-color-lighter:#fafafa;--el-fill-color-extra-light:#fafcff;--el-fill-color-dark:#ebedf0;--el-fill-color-darker:#e6e8eb;--el-fill-color-blank:#ffffff;--el-box-shadow:0px 12px 32px 4px rgba(0, 0, 0, .04),0px 8px 20px rgba(0, 0, 0, .08);--el-box-shadow-light:0px 0px 12px rgba(0, 0, 0, .12);--el-box-shadow-lighter:0px 0px 6px rgba(0, 0, 0, .12);--el-box-shadow-dark:0px 16px 48px 16px rgba(0, 0, 0, .08),0px 12px 32px rgba(0, 0, 0, .12),0px 8px 16px -8px rgba(0, 0, 0, .16);--el-disabled-bg-color:var(--el-fill-color-light);--el-disabled-text-color:var(--el-text-color-placeholder);--el-disabled-border-color:var(--el-border-color-light);--el-overlay-color:rgba(0, 0, 0, .8);--el-overlay-color-light:rgba(0, 0, 0, .7);--el-overlay-color-lighter:rgba(0, 0, 0, .5);--el-mask-color:rgba(255, 255, 255, .9);--el-mask-color-extra-light:rgba(255, 255, 255, .3);--el-border-width:1px;--el-border-style:solid;--el-border-color-hover:var(--el-text-color-disabled);--el-border:var(--el-border-width) var(--el-border-style) var(--el-border-color);--el-svg-monochrome-grey:var(--el-border-color)}.fade-in-linear-enter-active,.fade-in-linear-leave-active{transition:var(--el-transition-fade-linear)}.fade-in-linear-enter-from,.fade-in-linear-leave-to{opacity:0}.el-fade-in-linear-enter-active,.el-fade-in-linear-leave-active{transition:var(--el-transition-fade-linear)}.el-fade-in-linear-enter-from,.el-fade-in-linear-leave-to{opacity:0}.el-fade-in-enter-active,.el-fade-in-leave-active{transition:all var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-fade-in-enter-from,.el-fade-in-leave-active{opacity:0}.el-zoom-in-center-enter-active,.el-zoom-in-center-leave-active{transition:all var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-zoom-in-center-enter-from,.el-zoom-in-center-leave-active{opacity:0;transform:scaleX(0)}.el-zoom-in-top-enter-active,.el-zoom-in-top-leave-active{opacity:1;transform:scaleY(1);transition:var(--el-transition-md-fade);transform-origin:center top}.el-zoom-in-top-enter-active[data-popper-placement^=top],.el-zoom-in-top-leave-active[data-popper-placement^=top]{transform-origin:center bottom}.el-zoom-in-top-enter-from,.el-zoom-in-top-leave-active{opacity:0;transform:scaleY(0)}.el-zoom-in-bottom-enter-active,.el-zoom-in-bottom-leave-active{opacity:1;transform:scaleY(1);transition:var(--el-transition-md-fade);transform-origin:center bottom}.el-zoom-in-bottom-enter-from,.el-zoom-in-bottom-leave-active{opacity:0;transform:scaleY(0)}.el-zoom-in-left-enter-active,.el-zoom-in-left-leave-active{opacity:1;transform:scale(1);transition:var(--el-transition-md-fade);transform-origin:top left}.el-zoom-in-left-enter-from,.el-zoom-in-left-leave-active{opacity:0;transform:scale(.45)}.collapse-transition{transition:var(--el-transition-duration) height ease-in-out,var(--el-transition-duration) padding-top ease-in-out,var(--el-transition-duration) padding-bottom ease-in-out}.el-collapse-transition-enter-active,.el-collapse-transition-leave-active{transition:var(--el-transition-duration) max-height ease-in-out,var(--el-transition-duration) padding-top ease-in-out,var(--el-transition-duration) padding-bottom ease-in-out}.horizontal-collapse-transition{transition:var(--el-transition-duration) width ease-in-out,var(--el-transition-duration) padding-left ease-in-out,var(--el-transition-duration) padding-right ease-in-out}.el-list-enter-active,.el-list-leave-active{transition:all 1s}.el-list-enter-from,.el-list-leave-to{opacity:0;transform:translateY(-30px)}.el-list-leave-active{position:absolute!important}.el-opacity-transition{transition:opacity var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-icon-loading{-webkit-animation:rotating 2s linear infinite;animation:rotating 2s linear infinite}.el-icon--right{margin-left:5px}.el-icon--left{margin-right:5px}@-webkit-keyframes rotating{0%{transform:rotate(0)}to{transform:rotate(360deg)}}@keyframes rotating{0%{transform:rotate(0)}to{transform:rotate(360deg)}}.el-icon{--color:inherit;height:1em;width:1em;line-height:1em;display:inline-flex;justify-content:center;align-items:center;position:relative;fill:currentColor;color:var(--color);font-size:inherit}.el-icon.is-loading{-webkit-animation:rotating 2s linear infinite;animation:rotating 2s linear infinite}.el-icon svg{height:1em;width:1em}:root{--el-popup-modal-bg-color:var(--el-color-black);--el-popup-modal-opacity:.5}.v-modal-enter{-webkit-animation:v-modal-in var(--el-transition-duration-fast) ease;animation:v-modal-in var(--el-transition-duration-fast) ease}.v-modal-leave{-webkit-animation:v-modal-out var(--el-transition-duration-fast) ease forwards;animation:v-modal-out var(--el-transition-duration-fast) ease forwards}@-webkit-keyframes v-modal-in{0%{opacity:0}}@keyframes v-modal-in{0%{opacity:0}}@-webkit-keyframes v-modal-out{to{opacity:0}}@keyframes v-modal-out{to{opacity:0}}.v-modal{position:fixed;left:0;top:0;width:100%;height:100%;opacity:var(--el-popup-modal-opacity);background:var(--el-popup-modal-bg-color)}.el-popup-parent--hidden{overflow:hidden}.el-dialog{--el-dialog-width:50%;--el-dialog-margin-top:15vh;--el-dialog-bg-color:var(--el-bg-color);--el-dialog-box-shadow:var(--el-box-shadow);--el-dialog-title-font-size:var(--el-font-size-large);--el-dialog-content-font-size:14px;--el-dialog-font-line-height:var(--el-font-line-height-primary);--el-dialog-padding-primary:16px;--el-dialog-border-radius:var(--el-border-radius-small);position:relative;margin:var(--el-dialog-margin-top,15vh) auto 50px;background:var(--el-dialog-bg-color);border-radius:var(--el-dialog-border-radius);box-shadow:var(--el-dialog-box-shadow);box-sizing:border-box;padding:var(--el-dialog-padding-primary);width:var(--el-dialog-width,50%);overflow-wrap:break-word}.el-dialog:focus{outline:0!important}.el-dialog.is-align-center{margin:auto}.el-dialog.is-fullscreen{--el-dialog-width:100%;--el-dialog-margin-top:0;margin-bottom:0;height:100%;overflow:auto}.el-dialog__wrapper{position:fixed;top:0;right:0;bottom:0;left:0;overflow:auto;margin:0}.el-dialog.is-draggable .el-dialog__header{cursor:move;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.el-dialog__header{padding-bottom:var(--el-dialog-padding-primary)}.el-dialog__header.show-close{padding-right:calc(var(--el-dialog-padding-primary) + var(--el-message-close-size,16px))}.el-dialog__headerbtn{position:absolute;top:0;right:0;padding:0;width:48px;height:48px;background:0 0;border:none;outline:0;cursor:pointer;font-size:var(--el-message-close-size,16px)}.el-dialog__headerbtn .el-dialog__close{color:var(--el-color-info);font-size:inherit}.el-dialog__headerbtn:focus .el-dialog__close,.el-dialog__headerbtn:hover .el-dialog__close{color:var(--el-color-primary)}.el-dialog__title{line-height:var(--el-dialog-font-line-height);font-size:var(--el-dialog-title-font-size);color:var(--el-text-color-primary)}.el-dialog__body{color:var(--el-text-color-regular);font-size:var(--el-dialog-content-font-size)}.el-dialog__footer{padding-top:var(--el-dialog-padding-primary);text-align:right;box-sizing:border-box}.el-dialog--center{text-align:center}.el-dialog--center .el-dialog__body{text-align:initial}.el-dialog--center .el-dialog__footer{text-align:inherit}.el-overlay-dialog{position:fixed;top:0;right:0;bottom:0;left:0;overflow:auto}.dialog-fade-enter-active{-webkit-animation:modal-fade-in var(--el-transition-duration);animation:modal-fade-in var(--el-transition-duration)}.dialog-fade-enter-active .el-overlay-dialog{-webkit-animation:dialog-fade-in var(--el-transition-duration);animation:dialog-fade-in var(--el-transition-duration)}.dialog-fade-leave-active{-webkit-animation:modal-fade-out var(--el-transition-duration);animation:modal-fade-out var(--el-transition-duration)}.dialog-fade-leave-active .el-overlay-dialog{-webkit-animation:dialog-fade-out var(--el-transition-duration);animation:dialog-fade-out var(--el-transition-duration)}@-webkit-keyframes dialog-fade-in{0%{transform:translate3d(0,-20px,0);opacity:0}to{transform:translateZ(0);opacity:1}}@keyframes dialog-fade-in{0%{transform:translate3d(0,-20px,0);opacity:0}to{transform:translateZ(0);opacity:1}}@-webkit-keyframes dialog-fade-out{0%{transform:translateZ(0);opacity:1}to{transform:translate3d(0,-20px,0);opacity:0}}@keyframes dialog-fade-out{0%{transform:translateZ(0);opacity:1}to{transform:translate3d(0,-20px,0);opacity:0}}@-webkit-keyframes modal-fade-in{0%{opacity:0}to{opacity:1}}@keyframes modal-fade-in{0%{opacity:0}to{opacity:1}}@-webkit-keyframes modal-fade-out{0%{opacity:1}to{opacity:0}}@keyframes modal-fade-out{0%{opacity:1}to{opacity:0}}.el-overlay{position:fixed;top:0;right:0;bottom:0;left:0;z-index:2000;height:100%;background-color:var(--el-overlay-color-lighter);overflow:auto}.el-overlay .el-overlay-root{height:0}.el-button{--el-button-font-weight:var(--el-font-weight-primary);--el-button-border-color:var(--el-border-color);--el-button-bg-color:var(--el-fill-color-blank);--el-button-text-color:var(--el-text-color-regular);--el-button-disabled-text-color:var(--el-disabled-text-color);--el-button-disabled-bg-color:var(--el-fill-color-blank);--el-button-disabled-border-color:var(--el-border-color-light);--el-button-divide-border-color:rgba(255, 255, 255, .5);--el-button-hover-text-color:var(--el-color-primary);--el-button-hover-bg-color:var(--el-color-primary-light-9);--el-button-hover-border-color:var(--el-color-primary-light-7);--el-button-active-text-color:var(--el-button-hover-text-color);--el-button-active-border-color:var(--el-color-primary);--el-button-active-bg-color:var(--el-button-hover-bg-color);--el-button-outline-color:var(--el-color-primary-light-5);--el-button-hover-link-text-color:var(--el-color-info);--el-button-active-color:var(--el-text-color-primary)}.el-button{display:inline-flex;justify-content:center;align-items:center;line-height:1;height:32px;white-space:nowrap;cursor:pointer;color:var(--el-button-text-color);text-align:center;box-sizing:border-box;outline:0;transition:.1s;font-weight:var(--el-button-font-weight);-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;vertical-align:middle;-webkit-appearance:none;background-color:var(--el-button-bg-color);border:var(--el-border);border-color:var(--el-button-border-color);padding:8px 15px;font-size:var(--el-font-size-base);border-radius:var(--el-border-radius-base)}.el-button:focus,.el-button:hover{color:var(--el-button-hover-text-color);border-color:var(--el-button-hover-border-color);background-color:var(--el-button-hover-bg-color);outline:0}.el-button:active{color:var(--el-button-active-text-color);border-color:var(--el-button-active-border-color);background-color:var(--el-button-active-bg-color);outline:0}.el-button:focus-visible{outline:2px solid var(--el-button-outline-color);outline-offset:1px}.el-button>span{display:inline-flex;align-items:center}.el-button+.el-button{margin-left:12px}.el-button.is-round{padding:8px 15px}.el-button::-moz-focus-inner{border:0}.el-button [class*=el-icon]+span{margin-left:6px}.el-button [class*=el-icon] svg{vertical-align:bottom}.el-button.is-plain{--el-button-hover-text-color:var(--el-color-primary);--el-button-hover-bg-color:var(--el-fill-color-blank);--el-button-hover-border-color:var(--el-color-primary)}.el-button.is-active{color:var(--el-button-active-text-color);border-color:var(--el-button-active-border-color);background-color:var(--el-button-active-bg-color);outline:0}.el-button.is-disabled,.el-button.is-disabled:focus,.el-button.is-disabled:hover{color:var(--el-button-disabled-text-color);cursor:not-allowed;background-image:none;background-color:var(--el-button-disabled-bg-color);border-color:var(--el-button-disabled-border-color)}.el-button.is-loading{position:relative;pointer-events:none}.el-button.is-loading:before{z-index:1;pointer-events:none;content:"";position:absolute;left:-1px;top:-1px;right:-1px;bottom:-1px;border-radius:inherit;background-color:var(--el-mask-color-extra-light)}.el-button.is-round{border-radius:var(--el-border-radius-round)}.el-button.is-circle{width:32px;border-radius:50%;padding:8px}.el-button.is-text{color:var(--el-button-text-color);border:0 solid transparent;background-color:transparent}.el-button.is-text.is-disabled{color:var(--el-button-disabled-text-color);background-color:transparent!important}.el-button.is-text:not(.is-disabled):focus,.el-button.is-text:not(.is-disabled):hover{background-color:var(--el-fill-color-light)}.el-button.is-text:not(.is-disabled):focus-visible{outline:2px solid var(--el-button-outline-color);outline-offset:1px}.el-button.is-text:not(.is-disabled):active{background-color:var(--el-fill-color)}.el-button.is-text:not(.is-disabled).is-has-bg{background-color:var(--el-fill-color-light)}.el-button.is-text:not(.is-disabled).is-has-bg:focus,.el-button.is-text:not(.is-disabled).is-has-bg:hover{background-color:var(--el-fill-color)}.el-button.is-text:not(.is-disabled).is-has-bg:active{background-color:var(--el-fill-color-dark)}.el-button__text--expand{letter-spacing:.3em;margin-right:-.3em}.el-button.is-link{border-color:transparent;color:var(--el-button-text-color);background:0 0;padding:2px;height:auto}.el-button.is-link:focus,.el-button.is-link:hover{color:var(--el-button-hover-link-text-color)}.el-button.is-link.is-disabled{color:var(--el-button-disabled-text-color);background-color:transparent!important;border-color:transparent!important}.el-button.is-link:not(.is-disabled):focus,.el-button.is-link:not(.is-disabled):hover{border-color:transparent;background-color:transparent}.el-button.is-link:not(.is-disabled):active{color:var(--el-button-active-color);border-color:transparent;background-color:transparent}.el-button--text{border-color:transparent;background:0 0;color:var(--el-color-primary);padding-left:0;padding-right:0}.el-button--text.is-disabled{color:var(--el-button-disabled-text-color);background-color:transparent!important;border-color:transparent!important}.el-button--text:not(.is-disabled):focus,.el-button--text:not(.is-disabled):hover{color:var(--el-color-primary-light-3);border-color:transparent;background-color:transparent}.el-button--text:not(.is-disabled):active{color:var(--el-color-primary-dark-2);border-color:transparent;background-color:transparent}.el-button__link--expand{letter-spacing:.3em;margin-right:-.3em}.el-button--primary{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-primary);--el-button-border-color:var(--el-color-primary);--el-button-outline-color:var(--el-color-primary-light-5);--el-button-active-color:var(--el-color-primary-dark-2);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-primary-light-5);--el-button-hover-bg-color:var(--el-color-primary-light-3);--el-button-hover-border-color:var(--el-color-primary-light-3);--el-button-active-bg-color:var(--el-color-primary-dark-2);--el-button-active-border-color:var(--el-color-primary-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-primary-light-5);--el-button-disabled-border-color:var(--el-color-primary-light-5)}.el-button--primary.is-link,.el-button--primary.is-plain,.el-button--primary.is-text{--el-button-text-color:var(--el-color-primary);--el-button-bg-color:var(--el-color-primary-light-9);--el-button-border-color:var(--el-color-primary-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-primary);--el-button-hover-border-color:var(--el-color-primary);--el-button-active-text-color:var(--el-color-white)}.el-button--primary.is-link.is-disabled,.el-button--primary.is-link.is-disabled:active,.el-button--primary.is-link.is-disabled:focus,.el-button--primary.is-link.is-disabled:hover,.el-button--primary.is-plain.is-disabled,.el-button--primary.is-plain.is-disabled:active,.el-button--primary.is-plain.is-disabled:focus,.el-button--primary.is-plain.is-disabled:hover,.el-button--primary.is-text.is-disabled,.el-button--primary.is-text.is-disabled:active,.el-button--primary.is-text.is-disabled:focus,.el-button--primary.is-text.is-disabled:hover{color:var(--el-color-primary-light-5);background-color:var(--el-color-primary-light-9);border-color:var(--el-color-primary-light-8)}.el-button--success{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-success);--el-button-border-color:var(--el-color-success);--el-button-outline-color:var(--el-color-success-light-5);--el-button-active-color:var(--el-color-success-dark-2);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-success-light-5);--el-button-hover-bg-color:var(--el-color-success-light-3);--el-button-hover-border-color:var(--el-color-success-light-3);--el-button-active-bg-color:var(--el-color-success-dark-2);--el-button-active-border-color:var(--el-color-success-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-success-light-5);--el-button-disabled-border-color:var(--el-color-success-light-5)}.el-button--success.is-link,.el-button--success.is-plain,.el-button--success.is-text{--el-button-text-color:var(--el-color-success);--el-button-bg-color:var(--el-color-success-light-9);--el-button-border-color:var(--el-color-success-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-success);--el-button-hover-border-color:var(--el-color-success);--el-button-active-text-color:var(--el-color-white)}.el-button--success.is-link.is-disabled,.el-button--success.is-link.is-disabled:active,.el-button--success.is-link.is-disabled:focus,.el-button--success.is-link.is-disabled:hover,.el-button--success.is-plain.is-disabled,.el-button--success.is-plain.is-disabled:active,.el-button--success.is-plain.is-disabled:focus,.el-button--success.is-plain.is-disabled:hover,.el-button--success.is-text.is-disabled,.el-button--success.is-text.is-disabled:active,.el-button--success.is-text.is-disabled:focus,.el-button--success.is-text.is-disabled:hover{color:var(--el-color-success-light-5);background-color:var(--el-color-success-light-9);border-color:var(--el-color-success-light-8)}.el-button--warning{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-warning);--el-button-border-color:var(--el-color-warning);--el-button-outline-color:var(--el-color-warning-light-5);--el-button-active-color:var(--el-color-warning-dark-2);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-warning-light-5);--el-button-hover-bg-color:var(--el-color-warning-light-3);--el-button-hover-border-color:var(--el-color-warning-light-3);--el-button-active-bg-color:var(--el-color-warning-dark-2);--el-button-active-border-color:var(--el-color-warning-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-warning-light-5);--el-button-disabled-border-color:var(--el-color-warning-light-5)}.el-button--warning.is-link,.el-button--warning.is-plain,.el-button--warning.is-text{--el-button-text-color:var(--el-color-warning);--el-button-bg-color:var(--el-color-warning-light-9);--el-button-border-color:var(--el-color-warning-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-warning);--el-button-hover-border-color:var(--el-color-warning);--el-button-active-text-color:var(--el-color-white)}.el-button--warning.is-link.is-disabled,.el-button--warning.is-link.is-disabled:active,.el-button--warning.is-link.is-disabled:focus,.el-button--warning.is-link.is-disabled:hover,.el-button--warning.is-plain.is-disabled,.el-button--warning.is-plain.is-disabled:active,.el-button--warning.is-plain.is-disabled:focus,.el-button--warning.is-plain.is-disabled:hover,.el-button--warning.is-text.is-disabled,.el-button--warning.is-text.is-disabled:active,.el-button--warning.is-text.is-disabled:focus,.el-button--warning.is-text.is-disabled:hover{color:var(--el-color-warning-light-5);background-color:var(--el-color-warning-light-9);border-color:var(--el-color-warning-light-8)}.el-button--danger{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-danger);--el-button-border-color:var(--el-color-danger);--el-button-outline-color:var(--el-color-danger-light-5);--el-button-active-color:var(--el-color-danger-dark-2);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-danger-light-5);--el-button-hover-bg-color:var(--el-color-danger-light-3);--el-button-hover-border-color:var(--el-color-danger-light-3);--el-button-active-bg-color:var(--el-color-danger-dark-2);--el-button-active-border-color:var(--el-color-danger-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-danger-light-5);--el-button-disabled-border-color:var(--el-color-danger-light-5)}.el-button--danger.is-link,.el-button--danger.is-plain,.el-button--danger.is-text{--el-button-text-color:var(--el-color-danger);--el-button-bg-color:var(--el-color-danger-light-9);--el-button-border-color:var(--el-color-danger-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-danger);--el-button-hover-border-color:var(--el-color-danger);--el-button-active-text-color:var(--el-color-white)}.el-button--danger.is-link.is-disabled,.el-button--danger.is-link.is-disabled:active,.el-button--danger.is-link.is-disabled:focus,.el-button--danger.is-link.is-disabled:hover,.el-button--danger.is-plain.is-disabled,.el-button--danger.is-plain.is-disabled:active,.el-button--danger.is-plain.is-disabled:focus,.el-button--danger.is-plain.is-disabled:hover,.el-button--danger.is-text.is-disabled,.el-button--danger.is-text.is-disabled:active,.el-button--danger.is-text.is-disabled:focus,.el-button--danger.is-text.is-disabled:hover{color:var(--el-color-danger-light-5);background-color:var(--el-color-danger-light-9);border-color:var(--el-color-danger-light-8)}.el-button--info{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-info);--el-button-border-color:var(--el-color-info);--el-button-outline-color:var(--el-color-info-light-5);--el-button-active-color:var(--el-color-info-dark-2);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-info-light-5);--el-button-hover-bg-color:var(--el-color-info-light-3);--el-button-hover-border-color:var(--el-color-info-light-3);--el-button-active-bg-color:var(--el-color-info-dark-2);--el-button-active-border-color:var(--el-color-info-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-info-light-5);--el-button-disabled-border-color:var(--el-color-info-light-5)}.el-button--info.is-link,.el-button--info.is-plain,.el-button--info.is-text{--el-button-text-color:var(--el-color-info);--el-button-bg-color:var(--el-color-info-light-9);--el-button-border-color:var(--el-color-info-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-info);--el-button-hover-border-color:var(--el-color-info);--el-button-active-text-color:var(--el-color-white)}.el-button--info.is-link.is-disabled,.el-button--info.is-link.is-disabled:active,.el-button--info.is-link.is-disabled:focus,.el-button--info.is-link.is-disabled:hover,.el-button--info.is-plain.is-disabled,.el-button--info.is-plain.is-disabled:active,.el-button--info.is-plain.is-disabled:focus,.el-button--info.is-plain.is-disabled:hover,.el-button--info.is-text.is-disabled,.el-button--info.is-text.is-disabled:active,.el-button--info.is-text.is-disabled:focus,.el-button--info.is-text.is-disabled:hover{color:var(--el-color-info-light-5);background-color:var(--el-color-info-light-9);border-color:var(--el-color-info-light-8)}.el-button--large{--el-button-size:40px;height:var(--el-button-size);padding:12px 19px;font-size:var(--el-font-size-base);border-radius:var(--el-border-radius-base)}.el-button--large [class*=el-icon]+span{margin-left:8px}.el-button--large.is-round{padding:12px 19px}.el-button--large.is-circle{width:var(--el-button-size);padding:12px}.el-button--small{--el-button-size:24px;height:var(--el-button-size);padding:5px 11px;font-size:12px;border-radius:calc(var(--el-border-radius-base) - 1px)}.el-button--small [class*=el-icon]+span{margin-left:4px}.el-button--small.is-round{padding:5px 11px}.el-button--small.is-circle{width:var(--el-button-size);padding:5px}.modal-wrapper[data-v-2d09cfa9]{position:fixed;top:0;left:0;width:100%;height:100%;background-color:#00000080;margin-top:0;display:flex;justify-content:center;align-items:center;z-index:999}.modal[data-v-2d09cfa9]{background-color:#fff;padding:20px;border-radius:5px}.header[data-v-2d09cfa9]{display:flex;justify-content:space-between;align-items:center;margin-bottom:10px}.header h2[data-v-2d09cfa9]{margin:0;font-size:20px;font-weight:700}.header button[data-v-2d09cfa9]{border:none;background-color:transparent;font-size:20px;cursor:pointer}.contentBox[data-v-2d09cfa9]{max-height:400px;overflow:auto;font-size:16px;display:flex;justify-content:space-between}.contentBox .produce[data-v-2d09cfa9]{flex:60%}.contentBox .produce p[data-v-2d09cfa9]{margin-top:15px}.contentBox .produce .ipt[data-v-2d09cfa9]{margin-top:15px;height:30px;border-radius:5px;padding-left:10px}.contentBox .img[data-v-2d09cfa9]{flex:35%;height:180px;display:flex;align-items:center;justify-content:center}.contentBox .img img[data-v-2d09cfa9]{width:180px}input[data-v-2d09cfa9]::-webkit-input-placeholder{color:#aab2bd;font-size:14px;padding-left:5px}.el-badge{--el-badge-bg-color:var(--el-color-danger);--el-badge-radius:10px;--el-badge-font-size:12px;--el-badge-padding:6px;--el-badge-size:18px;position:relative;vertical-align:middle;display:inline-block;width:-webkit-fit-content;width:-moz-fit-content;width:fit-content}.el-badge__content{background-color:var(--el-badge-bg-color);border-radius:var(--el-badge-radius);color:var(--el-color-white);display:inline-flex;justify-content:center;align-items:center;font-size:var(--el-badge-font-size);height:var(--el-badge-size);padding:0 var(--el-badge-padding);white-space:nowrap;border:1px solid var(--el-bg-color)}.el-badge__content.is-fixed{position:absolute;top:0;right:calc(1px + var(--el-badge-size)/ 2);transform:translateY(-50%) translate(100%);z-index:var(--el-index-normal)}.el-badge__content.is-fixed.is-dot{right:5px}.el-badge__content.is-dot{height:8px;width:8px;padding:0;right:0;border-radius:50%}.el-badge__content--primary{background-color:var(--el-color-primary)}.el-badge__content--success{background-color:var(--el-color-success)}.el-badge__content--warning{background-color:var(--el-color-warning)}.el-badge__content--info{background-color:var(--el-color-info)}.el-badge__content--danger{background-color:var(--el-color-danger)}.el-message{--el-message-bg-color:var(--el-color-info-light-9);--el-message-border-color:var(--el-border-color-lighter);--el-message-padding:15px 19px;--el-message-close-size:16px;--el-message-close-icon-color:var(--el-text-color-placeholder);--el-message-close-hover-color:var(--el-text-color-secondary)}.el-message{width:-webkit-fit-content;width:-moz-fit-content;width:fit-content;max-width:calc(100% - 32px);box-sizing:border-box;border-radius:var(--el-border-radius-base);border-width:var(--el-border-width);border-style:var(--el-border-style);border-color:var(--el-message-border-color);position:fixed;left:50%;top:20px;transform:translate(-50%);background-color:var(--el-message-bg-color);transition:opacity var(--el-transition-duration),transform .4s,top .4s;padding:var(--el-message-padding);display:flex;align-items:center}.el-message.is-center{justify-content:center}.el-message.is-closable .el-message__content{padding-right:31px}.el-message p{margin:0}.el-message--success{--el-message-bg-color:var(--el-color-success-light-9);--el-message-border-color:var(--el-color-success-light-8);--el-message-text-color:var(--el-color-success)}.el-message--success .el-message__content{color:var(--el-message-text-color);overflow-wrap:break-word}.el-message .el-message-icon--success{color:var(--el-message-text-color)}.el-message--info{--el-message-bg-color:var(--el-color-info-light-9);--el-message-border-color:var(--el-color-info-light-8);--el-message-text-color:var(--el-color-info)}.el-message--info .el-message__content{color:var(--el-message-text-color);overflow-wrap:break-word}.el-message .el-message-icon--info{color:var(--el-message-text-color)}.el-message--warning{--el-message-bg-color:var(--el-color-warning-light-9);--el-message-border-color:var(--el-color-warning-light-8);--el-message-text-color:var(--el-color-warning)}.el-message--warning .el-message__content{color:var(--el-message-text-color);overflow-wrap:break-word}.el-message .el-message-icon--warning{color:var(--el-message-text-color)}.el-message--error{--el-message-bg-color:var(--el-color-error-light-9);--el-message-border-color:var(--el-color-error-light-8);--el-message-text-color:var(--el-color-error)}.el-message--error .el-message__content{color:var(--el-message-text-color);overflow-wrap:break-word}.el-message .el-message-icon--error{color:var(--el-message-text-color)}.el-message__icon{margin-right:10px}.el-message .el-message__badge{position:absolute;top:-8px;right:-8px}.el-message__content{padding:0;font-size:14px;line-height:1}.el-message__content:focus{outline-width:0}.el-message .el-message__closeBtn{position:absolute;top:50%;right:19px;transform:translateY(-50%);cursor:pointer;color:var(--el-message-close-icon-color);font-size:var(--el-message-close-size)}.el-message .el-message__closeBtn:focus{outline-width:0}.el-message .el-message__closeBtn:hover{color:var(--el-message-close-hover-color)}.el-message-fade-enter-from,.el-message-fade-leave-to{opacity:0;transform:translate(-50%,-100%)}.copy[data-v-92e86882]{width:200px;height:200px;position:fixed;right:10px;top:120px}.copy .btngroup[data-v-92e86882]{display:flex;flex-direction:column;justify-content:center;align-items:center}.copy .btngroup .lyric[data-v-92e86882]{display:flex;align-items:center;justify-content:center;flex-wrap:wrap;width:80px;height:40px;border-radius:10%;font-size:14px;color:#e4cf0e;background-color:#07031c;cursor:pointer;margin-bottom:10px}.copy .btngroup .down[data-v-92e86882]{display:flex;align-items:center;justify-content:center;width:80px;height:40px;border-radius:10%;font-size:14px;color:#fff;background-color:red;cursor:pointer}.copy .btngroup .down[data-v-92e86882]:hover{background-color:#00ff48}.copy .btngroup .lyric[data-v-92e86882]:hover{background-color:#933814!important}.dialogList[data-v-92e86882]{display:flex;justify-content:space-between;align-items:start}.dialogList .downContainer[data-v-92e86882]{display:flex;flex-direction:column;justify-content:center;align-items:start}.dialogList .downContainer .down_list[data-v-92e86882]{cursor:pointer;margin-top:10px}.dialogList .downContainer .down_list[data-v-92e86882]:hover{color:#0ff}.dialogList .buttonContainer[data-v-92e86882]{display:flex;flex-direction:column;justify-content:center;align-items:start}.dialogList .buttonContainer .btnClass[data-v-92e86882]{margin-top:10px;margin-left:0} ');

(function (vue, elementPlus) {
  'use strict';

  var _a;
  const isClient = typeof window !== "undefined";
  const isString$1 = (val) => typeof val === "string";
  const noop = () => {
  };
  isClient && ((_a = window == null ? void 0 : window.navigator) == null ? void 0 : _a.userAgent) && /iP(ad|hone|od)/.test(window.navigator.userAgent);
  function resolveUnref(r) {
    return typeof r === "function" ? r() : vue.unref(r);
  }
  function identity(arg) {
    return arg;
  }
  function tryOnScopeDispose(fn) {
    if (vue.getCurrentScope()) {
      vue.onScopeDispose(fn);
      return true;
    }
    return false;
  }
  function tryOnMounted(fn, sync = true) {
    if (vue.getCurrentInstance())
      vue.onMounted(fn);
    else if (sync)
      fn();
    else
      vue.nextTick(fn);
  }
  function useTimeoutFn(cb, interval, options = {}) {
    const {
      immediate = true
    } = options;
    const isPending = vue.ref(false);
    let timer = null;
    function clear() {
      if (timer) {
        clearTimeout(timer);
        timer = null;
      }
    }
    function stop() {
      isPending.value = false;
      clear();
    }
    function start(...args) {
      clear();
      isPending.value = true;
      timer = setTimeout(() => {
        isPending.value = false;
        timer = null;
        cb(...args);
      }, resolveUnref(interval));
    }
    if (immediate) {
      isPending.value = true;
      if (isClient)
        start();
    }
    tryOnScopeDispose(stop);
    return {
      isPending: vue.readonly(isPending),
      start,
      stop
    };
  }
  function unrefElement(elRef) {
    var _a2;
    const plain = resolveUnref(elRef);
    return (_a2 = plain == null ? void 0 : plain.$el) != null ? _a2 : plain;
  }
  const defaultWindow = isClient ? window : void 0;
  function useEventListener(...args) {
    let target;
    let events;
    let listeners;
    let options;
    if (isString$1(args[0]) || Array.isArray(args[0])) {
      [events, listeners, options] = args;
      target = defaultWindow;
    } else {
      [target, events, listeners, options] = args;
    }
    if (!target)
      return noop;
    if (!Array.isArray(events))
      events = [events];
    if (!Array.isArray(listeners))
      listeners = [listeners];
    const cleanups = [];
    const cleanup = () => {
      cleanups.forEach((fn) => fn());
      cleanups.length = 0;
    };
    const register = (el, event, listener, options2) => {
      el.addEventListener(event, listener, options2);
      return () => el.removeEventListener(event, listener, options2);
    };
    const stopWatch = vue.watch(() => [unrefElement(target), resolveUnref(options)], ([el, options2]) => {
      cleanup();
      if (!el)
        return;
      cleanups.push(...events.flatMap((event) => {
        return listeners.map((listener) => register(el, event, listener, options2));
      }));
    }, { immediate: true, flush: "post" });
    const stop = () => {
      stopWatch();
      cleanup();
    };
    tryOnScopeDispose(stop);
    return stop;
  }
  function useSupported(callback, sync = false) {
    const isSupported = vue.ref();
    const update = () => isSupported.value = Boolean(callback());
    update();
    tryOnMounted(update, sync);
    return isSupported;
  }
  const _global = typeof globalThis !== "undefined" ? globalThis : typeof window !== "undefined" ? window : typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : {};
  const globalKey = "__vueuse_ssr_handlers__";
  _global[globalKey] = _global[globalKey] || {};
  var __getOwnPropSymbols$g = Object.getOwnPropertySymbols;
  var __hasOwnProp$g = Object.prototype.hasOwnProperty;
  var __propIsEnum$g = Object.prototype.propertyIsEnumerable;
  var __objRest$2 = (source, exclude) => {
    var target = {};
    for (var prop in source)
      if (__hasOwnProp$g.call(source, prop) && exclude.indexOf(prop) < 0)
        target[prop] = source[prop];
    if (source != null && __getOwnPropSymbols$g)
      for (var prop of __getOwnPropSymbols$g(source)) {
        if (exclude.indexOf(prop) < 0 && __propIsEnum$g.call(source, prop))
          target[prop] = source[prop];
      }
    return target;
  };
  function useResizeObserver(target, callback, options = {}) {
    const _a2 = options, { window: window2 = defaultWindow } = _a2, observerOptions = __objRest$2(_a2, ["window"]);
    let observer;
    const isSupported = useSupported(() => window2 && "ResizeObserver" in window2);
    const cleanup = () => {
      if (observer) {
        observer.disconnect();
        observer = void 0;
      }
    };
    const stopWatch = vue.watch(() => unrefElement(target), (el) => {
      cleanup();
      if (isSupported.value && window2 && el) {
        observer = new ResizeObserver(callback);
        observer.observe(el, observerOptions);
      }
    }, { immediate: true, flush: "post" });
    const stop = () => {
      cleanup();
      stopWatch();
    };
    tryOnScopeDispose(stop);
    return {
      isSupported,
      stop
    };
  }
  var SwipeDirection;
  (function(SwipeDirection2) {
    SwipeDirection2["UP"] = "UP";
    SwipeDirection2["RIGHT"] = "RIGHT";
    SwipeDirection2["DOWN"] = "DOWN";
    SwipeDirection2["LEFT"] = "LEFT";
    SwipeDirection2["NONE"] = "NONE";
  })(SwipeDirection || (SwipeDirection = {}));
  var __defProp = Object.defineProperty;
  var __getOwnPropSymbols = Object.getOwnPropertySymbols;
  var __hasOwnProp = Object.prototype.hasOwnProperty;
  var __propIsEnum = Object.prototype.propertyIsEnumerable;
  var __defNormalProp = (obj, key, value) => key in obj ? __defProp(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
  var __spreadValues = (a, b) => {
    for (var prop in b || (b = {}))
      if (__hasOwnProp.call(b, prop))
        __defNormalProp(a, prop, b[prop]);
    if (__getOwnPropSymbols)
      for (var prop of __getOwnPropSymbols(b)) {
        if (__propIsEnum.call(b, prop))
          __defNormalProp(a, prop, b[prop]);
      }
    return a;
  };
  const _TransitionPresets = {
    easeInSine: [0.12, 0, 0.39, 0],
    easeOutSine: [0.61, 1, 0.88, 1],
    easeInOutSine: [0.37, 0, 0.63, 1],
    easeInQuad: [0.11, 0, 0.5, 0],
    easeOutQuad: [0.5, 1, 0.89, 1],
    easeInOutQuad: [0.45, 0, 0.55, 1],
    easeInCubic: [0.32, 0, 0.67, 0],
    easeOutCubic: [0.33, 1, 0.68, 1],
    easeInOutCubic: [0.65, 0, 0.35, 1],
    easeInQuart: [0.5, 0, 0.75, 0],
    easeOutQuart: [0.25, 1, 0.5, 1],
    easeInOutQuart: [0.76, 0, 0.24, 1],
    easeInQuint: [0.64, 0, 0.78, 0],
    easeOutQuint: [0.22, 1, 0.36, 1],
    easeInOutQuint: [0.83, 0, 0.17, 1],
    easeInExpo: [0.7, 0, 0.84, 0],
    easeOutExpo: [0.16, 1, 0.3, 1],
    easeInOutExpo: [0.87, 0, 0.13, 1],
    easeInCirc: [0.55, 0, 1, 0.45],
    easeOutCirc: [0, 0.55, 0.45, 1],
    easeInOutCirc: [0.85, 0, 0.15, 1],
    easeInBack: [0.36, 0, 0.66, -0.56],
    easeOutBack: [0.34, 1.56, 0.64, 1],
    easeInOutBack: [0.68, -0.6, 0.32, 1.6]
  };
  __spreadValues({
    linear: identity
  }, _TransitionPresets);
  const NOOP = () => {
  };
  const hasOwnProperty$4 = Object.prototype.hasOwnProperty;
  const hasOwn = (val, key) => hasOwnProperty$4.call(val, key);
  const isArray$2 = Array.isArray;
  const isFunction$1 = (val) => typeof val === "function";
  const isString = (val) => typeof val === "string";
  const isSymbol$1 = (val) => typeof val === "symbol";
  const isObject$1 = (val) => val !== null && typeof val === "object";
  const cacheStringFunction = (fn) => {
    const cache = /* @__PURE__ */ Object.create(null);
    return (str) => {
      const hit = cache[str];
      return hit || (cache[str] = fn(str));
    };
  };
  const camelizeRE = /-(\w)/g;
  const camelize = cacheStringFunction((str) => {
    return str.replace(camelizeRE, (_, c) => c ? c.toUpperCase() : "");
  });
  var freeGlobal = typeof global == "object" && global && global.Object === Object && global;
  const freeGlobal$1 = freeGlobal;
  var freeSelf = typeof self == "object" && self && self.Object === Object && self;
  var root = freeGlobal$1 || freeSelf || Function("return this")();
  const root$1 = root;
  var Symbol$1 = root$1.Symbol;
  const Symbol$2 = Symbol$1;
  var objectProto$4 = Object.prototype;
  var hasOwnProperty$3 = objectProto$4.hasOwnProperty;
  var nativeObjectToString$1 = objectProto$4.toString;
  var symToStringTag$1 = Symbol$2 ? Symbol$2.toStringTag : void 0;
  function getRawTag(value) {
    var isOwn = hasOwnProperty$3.call(value, symToStringTag$1), tag = value[symToStringTag$1];
    try {
      value[symToStringTag$1] = void 0;
      var unmasked = true;
    } catch (e) {
    }
    var result = nativeObjectToString$1.call(value);
    if (unmasked) {
      if (isOwn) {
        value[symToStringTag$1] = tag;
      } else {
        delete value[symToStringTag$1];
      }
    }
    return result;
  }
  var objectProto$3 = Object.prototype;
  var nativeObjectToString = objectProto$3.toString;
  function objectToString(value) {
    return nativeObjectToString.call(value);
  }
  var nullTag = "[object Null]", undefinedTag = "[object Undefined]";
  var symToStringTag = Symbol$2 ? Symbol$2.toStringTag : void 0;
  function baseGetTag(value) {
    if (value == null) {
      return value === void 0 ? undefinedTag : nullTag;
    }
    return symToStringTag && symToStringTag in Object(value) ? getRawTag(value) : objectToString(value);
  }
  function isObjectLike(value) {
    return value != null && typeof value == "object";
  }
  var symbolTag = "[object Symbol]";
  function isSymbol(value) {
    return typeof value == "symbol" || isObjectLike(value) && baseGetTag(value) == symbolTag;
  }
  function arrayMap(array, iteratee) {
    var index = -1, length = array == null ? 0 : array.length, result = Array(length);
    while (++index < length) {
      result[index] = iteratee(array[index], index, array);
    }
    return result;
  }
  var isArray = Array.isArray;
  const isArray$1 = isArray;
  var INFINITY$1 = 1 / 0;
  var symbolProto = Symbol$2 ? Symbol$2.prototype : void 0, symbolToString = symbolProto ? symbolProto.toString : void 0;
  function baseToString(value) {
    if (typeof value == "string") {
      return value;
    }
    if (isArray$1(value)) {
      return arrayMap(value, baseToString) + "";
    }
    if (isSymbol(value)) {
      return symbolToString ? symbolToString.call(value) : "";
    }
    var result = value + "";
    return result == "0" && 1 / value == -INFINITY$1 ? "-0" : result;
  }
  function isObject(value) {
    var type = typeof value;
    return value != null && (type == "object" || type == "function");
  }
  var asyncTag = "[object AsyncFunction]", funcTag = "[object Function]", genTag = "[object GeneratorFunction]", proxyTag = "[object Proxy]";
  function isFunction(value) {
    if (!isObject(value)) {
      return false;
    }
    var tag = baseGetTag(value);
    return tag == funcTag || tag == genTag || tag == asyncTag || tag == proxyTag;
  }
  var coreJsData = root$1["__core-js_shared__"];
  const coreJsData$1 = coreJsData;
  var maskSrcKey = function() {
    var uid = /[^.]+$/.exec(coreJsData$1 && coreJsData$1.keys && coreJsData$1.keys.IE_PROTO || "");
    return uid ? "Symbol(src)_1." + uid : "";
  }();
  function isMasked(func) {
    return !!maskSrcKey && maskSrcKey in func;
  }
  var funcProto$1 = Function.prototype;
  var funcToString$1 = funcProto$1.toString;
  function toSource(func) {
    if (func != null) {
      try {
        return funcToString$1.call(func);
      } catch (e) {
      }
      try {
        return func + "";
      } catch (e) {
      }
    }
    return "";
  }
  var reRegExpChar = /[\\^$.*+?()[\]{}|]/g;
  var reIsHostCtor = /^\[object .+?Constructor\]$/;
  var funcProto = Function.prototype, objectProto$2 = Object.prototype;
  var funcToString = funcProto.toString;
  var hasOwnProperty$2 = objectProto$2.hasOwnProperty;
  var reIsNative = RegExp(
    "^" + funcToString.call(hasOwnProperty$2).replace(reRegExpChar, "\\$&").replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, "$1.*?") + "$"
  );
  function baseIsNative(value) {
    if (!isObject(value) || isMasked(value)) {
      return false;
    }
    var pattern = isFunction(value) ? reIsNative : reIsHostCtor;
    return pattern.test(toSource(value));
  }
  function getValue(object, key) {
    return object == null ? void 0 : object[key];
  }
  function getNative(object, key) {
    var value = getValue(object, key);
    return baseIsNative(value) ? value : void 0;
  }
  function eq(value, other) {
    return value === other || value !== value && other !== other;
  }
  var reIsDeepProp = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/, reIsPlainProp = /^\w*$/;
  function isKey(value, object) {
    if (isArray$1(value)) {
      return false;
    }
    var type = typeof value;
    if (type == "number" || type == "symbol" || type == "boolean" || value == null || isSymbol(value)) {
      return true;
    }
    return reIsPlainProp.test(value) || !reIsDeepProp.test(value) || object != null && value in Object(object);
  }
  var nativeCreate = getNative(Object, "create");
  const nativeCreate$1 = nativeCreate;
  function hashClear() {
    this.__data__ = nativeCreate$1 ? nativeCreate$1(null) : {};
    this.size = 0;
  }
  function hashDelete(key) {
    var result = this.has(key) && delete this.__data__[key];
    this.size -= result ? 1 : 0;
    return result;
  }
  var HASH_UNDEFINED$1 = "__lodash_hash_undefined__";
  var objectProto$1 = Object.prototype;
  var hasOwnProperty$1 = objectProto$1.hasOwnProperty;
  function hashGet(key) {
    var data = this.__data__;
    if (nativeCreate$1) {
      var result = data[key];
      return result === HASH_UNDEFINED$1 ? void 0 : result;
    }
    return hasOwnProperty$1.call(data, key) ? data[key] : void 0;
  }
  var objectProto = Object.prototype;
  var hasOwnProperty = objectProto.hasOwnProperty;
  function hashHas(key) {
    var data = this.__data__;
    return nativeCreate$1 ? data[key] !== void 0 : hasOwnProperty.call(data, key);
  }
  var HASH_UNDEFINED = "__lodash_hash_undefined__";
  function hashSet(key, value) {
    var data = this.__data__;
    this.size += this.has(key) ? 0 : 1;
    data[key] = nativeCreate$1 && value === void 0 ? HASH_UNDEFINED : value;
    return this;
  }
  function Hash(entries) {
    var index = -1, length = entries == null ? 0 : entries.length;
    this.clear();
    while (++index < length) {
      var entry = entries[index];
      this.set(entry[0], entry[1]);
    }
  }
  Hash.prototype.clear = hashClear;
  Hash.prototype["delete"] = hashDelete;
  Hash.prototype.get = hashGet;
  Hash.prototype.has = hashHas;
  Hash.prototype.set = hashSet;
  function listCacheClear() {
    this.__data__ = [];
    this.size = 0;
  }
  function assocIndexOf(array, key) {
    var length = array.length;
    while (length--) {
      if (eq(array[length][0], key)) {
        return length;
      }
    }
    return -1;
  }
  var arrayProto = Array.prototype;
  var splice = arrayProto.splice;
  function listCacheDelete(key) {
    var data = this.__data__, index = assocIndexOf(data, key);
    if (index < 0) {
      return false;
    }
    var lastIndex = data.length - 1;
    if (index == lastIndex) {
      data.pop();
    } else {
      splice.call(data, index, 1);
    }
    --this.size;
    return true;
  }
  function listCacheGet(key) {
    var data = this.__data__, index = assocIndexOf(data, key);
    return index < 0 ? void 0 : data[index][1];
  }
  function listCacheHas(key) {
    return assocIndexOf(this.__data__, key) > -1;
  }
  function listCacheSet(key, value) {
    var data = this.__data__, index = assocIndexOf(data, key);
    if (index < 0) {
      ++this.size;
      data.push([key, value]);
    } else {
      data[index][1] = value;
    }
    return this;
  }
  function ListCache(entries) {
    var index = -1, length = entries == null ? 0 : entries.length;
    this.clear();
    while (++index < length) {
      var entry = entries[index];
      this.set(entry[0], entry[1]);
    }
  }
  ListCache.prototype.clear = listCacheClear;
  ListCache.prototype["delete"] = listCacheDelete;
  ListCache.prototype.get = listCacheGet;
  ListCache.prototype.has = listCacheHas;
  ListCache.prototype.set = listCacheSet;
  var Map = getNative(root$1, "Map");
  const Map$1 = Map;
  function mapCacheClear() {
    this.size = 0;
    this.__data__ = {
      "hash": new Hash(),
      "map": new (Map$1 || ListCache)(),
      "string": new Hash()
    };
  }
  function isKeyable(value) {
    var type = typeof value;
    return type == "string" || type == "number" || type == "symbol" || type == "boolean" ? value !== "__proto__" : value === null;
  }
  function getMapData(map, key) {
    var data = map.__data__;
    return isKeyable(key) ? data[typeof key == "string" ? "string" : "hash"] : data.map;
  }
  function mapCacheDelete(key) {
    var result = getMapData(this, key)["delete"](key);
    this.size -= result ? 1 : 0;
    return result;
  }
  function mapCacheGet(key) {
    return getMapData(this, key).get(key);
  }
  function mapCacheHas(key) {
    return getMapData(this, key).has(key);
  }
  function mapCacheSet(key, value) {
    var data = getMapData(this, key), size = data.size;
    data.set(key, value);
    this.size += data.size == size ? 0 : 1;
    return this;
  }
  function MapCache(entries) {
    var index = -1, length = entries == null ? 0 : entries.length;
    this.clear();
    while (++index < length) {
      var entry = entries[index];
      this.set(entry[0], entry[1]);
    }
  }
  MapCache.prototype.clear = mapCacheClear;
  MapCache.prototype["delete"] = mapCacheDelete;
  MapCache.prototype.get = mapCacheGet;
  MapCache.prototype.has = mapCacheHas;
  MapCache.prototype.set = mapCacheSet;
  var FUNC_ERROR_TEXT = "Expected a function";
  function memoize(func, resolver) {
    if (typeof func != "function" || resolver != null && typeof resolver != "function") {
      throw new TypeError(FUNC_ERROR_TEXT);
    }
    var memoized = function() {
      var args = arguments, key = resolver ? resolver.apply(this, args) : args[0], cache = memoized.cache;
      if (cache.has(key)) {
        return cache.get(key);
      }
      var result = func.apply(this, args);
      memoized.cache = cache.set(key, result) || cache;
      return result;
    };
    memoized.cache = new (memoize.Cache || MapCache)();
    return memoized;
  }
  memoize.Cache = MapCache;
  var MAX_MEMOIZE_SIZE = 500;
  function memoizeCapped(func) {
    var result = memoize(func, function(key) {
      if (cache.size === MAX_MEMOIZE_SIZE) {
        cache.clear();
      }
      return key;
    });
    var cache = result.cache;
    return result;
  }
  var rePropName = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g;
  var reEscapeChar = /\\(\\)?/g;
  var stringToPath = memoizeCapped(function(string) {
    var result = [];
    if (string.charCodeAt(0) === 46) {
      result.push("");
    }
    string.replace(rePropName, function(match, number, quote, subString) {
      result.push(quote ? subString.replace(reEscapeChar, "$1") : number || match);
    });
    return result;
  });
  const stringToPath$1 = stringToPath;
  function toString(value) {
    return value == null ? "" : baseToString(value);
  }
  function castPath(value, object) {
    if (isArray$1(value)) {
      return value;
    }
    return isKey(value, object) ? [value] : stringToPath$1(toString(value));
  }
  var INFINITY = 1 / 0;
  function toKey(value) {
    if (typeof value == "string" || isSymbol(value)) {
      return value;
    }
    var result = value + "";
    return result == "0" && 1 / value == -INFINITY ? "-0" : result;
  }
  function baseGet(object, path) {
    path = castPath(path, object);
    var index = 0, length = path.length;
    while (object != null && index < length) {
      object = object[toKey(path[index++])];
    }
    return index && index == length ? object : void 0;
  }
  function get(object, path, defaultValue) {
    var result = object == null ? void 0 : baseGet(object, path);
    return result === void 0 ? defaultValue : result;
  }
  function fromPairs(pairs) {
    var index = -1, length = pairs == null ? 0 : pairs.length, result = {};
    while (++index < length) {
      var pair = pairs[index];
      result[pair[0]] = pair[1];
    }
    return result;
  }
  function isNil(value) {
    return value == null;
  }
  function isUndefined$1(value) {
    return value === void 0;
  }
  const isUndefined = (val) => val === void 0;
  const isBoolean = (val) => typeof val === "boolean";
  const isNumber = (val) => typeof val === "number";
  const isElement = (e) => {
    if (typeof Element === "undefined")
      return false;
    return e instanceof Element;
  };
  const isStringNumber = (val) => {
    if (!isString(val)) {
      return false;
    }
    return !Number.isNaN(Number(val));
  };
  const keysOf = (arr) => Object.keys(arr);
  class ElementPlusError extends Error {
    constructor(m) {
      super(m);
      this.name = "ElementPlusError";
    }
  }
  function throwError(scope, m) {
    throw new ElementPlusError(`[${scope}] ${m}`);
  }
  const classNameToArray = (cls = "") => cls.split(" ").filter((item) => !!item.trim());
  const hasClass = (el, cls) => {
    if (!el || !cls)
      return false;
    if (cls.includes(" "))
      throw new Error("className should not contain space.");
    return el.classList.contains(cls);
  };
  const addClass = (el, cls) => {
    if (!el || !cls.trim())
      return;
    el.classList.add(...classNameToArray(cls));
  };
  const removeClass = (el, cls) => {
    if (!el || !cls.trim())
      return;
    el.classList.remove(...classNameToArray(cls));
  };
  const getStyle = (element, styleName) => {
    var _a2;
    if (!isClient || !element || !styleName)
      return "";
    let key = camelize(styleName);
    if (key === "float")
      key = "cssFloat";
    try {
      const style2 = element.style[key];
      if (style2)
        return style2;
      const computed2 = (_a2 = document.defaultView) == null ? void 0 : _a2.getComputedStyle(element, "");
      return computed2 ? computed2[key] : "";
    } catch (e) {
      return element.style[key];
    }
  };
  function addUnit(value, defaultUnit = "px") {
    if (!value)
      return "";
    if (isNumber(value) || isStringNumber(value)) {
      return `${value}${defaultUnit}`;
    } else if (isString(value)) {
      return value;
    }
  }
  let scrollBarWidth;
  const getScrollBarWidth = (namespace) => {
    var _a2;
    if (!isClient)
      return 0;
    if (scrollBarWidth !== void 0)
      return scrollBarWidth;
    const outer = document.createElement("div");
    outer.className = `${namespace}-scrollbar__wrap`;
    outer.style.visibility = "hidden";
    outer.style.width = "100px";
    outer.style.position = "absolute";
    outer.style.top = "-9999px";
    document.body.appendChild(outer);
    const widthNoScroll = outer.offsetWidth;
    outer.style.overflow = "scroll";
    const inner = document.createElement("div");
    inner.style.width = "100%";
    outer.appendChild(inner);
    const widthWithScroll = inner.offsetWidth;
    (_a2 = outer.parentNode) == null ? void 0 : _a2.removeChild(outer);
    scrollBarWidth = widthNoScroll - widthWithScroll;
    return scrollBarWidth;
  };
  /*! Element Plus Icons Vue v2.3.1 */
  var circle_close_filled_vue_vue_type_script_setup_true_lang_default = /* @__PURE__ */ vue.defineComponent({
    name: "CircleCloseFilled",
    __name: "circle-close-filled",
    setup(__props) {
      return (_ctx, _cache) => (vue.openBlock(), vue.createElementBlock("svg", {
        xmlns: "http://www.w3.org/2000/svg",
        viewBox: "0 0 1024 1024"
      }, [
        vue.createElementVNode("path", {
          fill: "currentColor",
          d: "M512 64a448 448 0 1 1 0 896 448 448 0 0 1 0-896m0 393.664L407.936 353.6a38.4 38.4 0 1 0-54.336 54.336L457.664 512 353.6 616.064a38.4 38.4 0 1 0 54.336 54.336L512 566.336 616.064 670.4a38.4 38.4 0 1 0 54.336-54.336L566.336 512 670.4 407.936a38.4 38.4 0 1 0-54.336-54.336z"
        })
      ]));
    }
  });
  var circle_close_filled_default = circle_close_filled_vue_vue_type_script_setup_true_lang_default;
  var close_vue_vue_type_script_setup_true_lang_default = /* @__PURE__ */ vue.defineComponent({
    name: "Close",
    __name: "close",
    setup(__props) {
      return (_ctx, _cache) => (vue.openBlock(), vue.createElementBlock("svg", {
        xmlns: "http://www.w3.org/2000/svg",
        viewBox: "0 0 1024 1024"
      }, [
        vue.createElementVNode("path", {
          fill: "currentColor",
          d: "M764.288 214.592 512 466.88 259.712 214.592a31.936 31.936 0 0 0-45.12 45.12L466.752 512 214.528 764.224a31.936 31.936 0 1 0 45.12 45.184L512 557.184l252.288 252.288a31.936 31.936 0 0 0 45.12-45.12L557.12 512.064l252.288-252.352a31.936 31.936 0 1 0-45.12-45.184z"
        })
      ]));
    }
  });
  var close_default = close_vue_vue_type_script_setup_true_lang_default;
  var info_filled_vue_vue_type_script_setup_true_lang_default = /* @__PURE__ */ vue.defineComponent({
    name: "InfoFilled",
    __name: "info-filled",
    setup(__props) {
      return (_ctx, _cache) => (vue.openBlock(), vue.createElementBlock("svg", {
        xmlns: "http://www.w3.org/2000/svg",
        viewBox: "0 0 1024 1024"
      }, [
        vue.createElementVNode("path", {
          fill: "currentColor",
          d: "M512 64a448 448 0 1 1 0 896.064A448 448 0 0 1 512 64m67.2 275.072c33.28 0 60.288-23.104 60.288-57.344s-27.072-57.344-60.288-57.344c-33.28 0-60.16 23.104-60.16 57.344s26.88 57.344 60.16 57.344M590.912 699.2c0-6.848 2.368-24.64 1.024-34.752l-52.608 60.544c-10.88 11.456-24.512 19.392-30.912 17.28a12.992 12.992 0 0 1-8.256-14.72l87.68-276.992c7.168-35.136-12.544-67.2-54.336-71.296-44.096 0-108.992 44.736-148.48 101.504 0 6.784-1.28 23.68.064 33.792l52.544-60.608c10.88-11.328 23.552-19.328 29.952-17.152a12.8 12.8 0 0 1 7.808 16.128L388.48 728.576c-10.048 32.256 8.96 63.872 55.04 71.04 67.84 0 107.904-43.648 147.456-100.416z"
        })
      ]));
    }
  });
  var info_filled_default = info_filled_vue_vue_type_script_setup_true_lang_default;
  var loading_vue_vue_type_script_setup_true_lang_default = /* @__PURE__ */ vue.defineComponent({
    name: "Loading",
    __name: "loading",
    setup(__props) {
      return (_ctx, _cache) => (vue.openBlock(), vue.createElementBlock("svg", {
        xmlns: "http://www.w3.org/2000/svg",
        viewBox: "0 0 1024 1024"
      }, [
        vue.createElementVNode("path", {
          fill: "currentColor",
          d: "M512 64a32 32 0 0 1 32 32v192a32 32 0 0 1-64 0V96a32 32 0 0 1 32-32m0 640a32 32 0 0 1 32 32v192a32 32 0 1 1-64 0V736a32 32 0 0 1 32-32m448-192a32 32 0 0 1-32 32H736a32 32 0 1 1 0-64h192a32 32 0 0 1 32 32m-640 0a32 32 0 0 1-32 32H96a32 32 0 0 1 0-64h192a32 32 0 0 1 32 32M195.2 195.2a32 32 0 0 1 45.248 0L376.32 331.008a32 32 0 0 1-45.248 45.248L195.2 240.448a32 32 0 0 1 0-45.248zm452.544 452.544a32 32 0 0 1 45.248 0L828.8 783.552a32 32 0 0 1-45.248 45.248L647.744 692.992a32 32 0 0 1 0-45.248zM828.8 195.264a32 32 0 0 1 0 45.184L692.992 376.32a32 32 0 0 1-45.248-45.248l135.808-135.808a32 32 0 0 1 45.248 0m-452.544 452.48a32 32 0 0 1 0 45.248L240.448 828.8a32 32 0 0 1-45.248-45.248l135.808-135.808a32 32 0 0 1 45.248 0z"
        })
      ]));
    }
  });
  var loading_default = loading_vue_vue_type_script_setup_true_lang_default;
  var success_filled_vue_vue_type_script_setup_true_lang_default = /* @__PURE__ */ vue.defineComponent({
    name: "SuccessFilled",
    __name: "success-filled",
    setup(__props) {
      return (_ctx, _cache) => (vue.openBlock(), vue.createElementBlock("svg", {
        xmlns: "http://www.w3.org/2000/svg",
        viewBox: "0 0 1024 1024"
      }, [
        vue.createElementVNode("path", {
          fill: "currentColor",
          d: "M512 64a448 448 0 1 1 0 896 448 448 0 0 1 0-896m-55.808 536.384-99.52-99.584a38.4 38.4 0 1 0-54.336 54.336l126.72 126.72a38.272 38.272 0 0 0 54.336 0l262.4-262.464a38.4 38.4 0 1 0-54.272-54.336z"
        })
      ]));
    }
  });
  var success_filled_default = success_filled_vue_vue_type_script_setup_true_lang_default;
  var warning_filled_vue_vue_type_script_setup_true_lang_default = /* @__PURE__ */ vue.defineComponent({
    name: "WarningFilled",
    __name: "warning-filled",
    setup(__props) {
      return (_ctx, _cache) => (vue.openBlock(), vue.createElementBlock("svg", {
        xmlns: "http://www.w3.org/2000/svg",
        viewBox: "0 0 1024 1024"
      }, [
        vue.createElementVNode("path", {
          fill: "currentColor",
          d: "M512 64a448 448 0 1 1 0 896 448 448 0 0 1 0-896m0 192a58.432 58.432 0 0 0-58.24 63.744l23.36 256.384a35.072 35.072 0 0 0 69.76 0l23.296-256.384A58.432 58.432 0 0 0 512 256m0 512a51.2 51.2 0 1 0 0-102.4 51.2 51.2 0 0 0 0 102.4"
        })
      ]));
    }
  });
  var warning_filled_default = warning_filled_vue_vue_type_script_setup_true_lang_default;
  const epPropKey = "__epPropKey";
  const definePropType = (val) => val;
  const isEpProp = (val) => isObject$1(val) && !!val[epPropKey];
  const buildProp = (prop, key) => {
    if (!isObject$1(prop) || isEpProp(prop))
      return prop;
    const { values, required, default: defaultValue, type, validator } = prop;
    const _validator = values || validator ? (val) => {
      let valid = false;
      let allowedValues = [];
      if (values) {
        allowedValues = Array.from(values);
        if (hasOwn(prop, "default")) {
          allowedValues.push(defaultValue);
        }
        valid || (valid = allowedValues.includes(val));
      }
      if (validator)
        valid || (valid = validator(val));
      if (!valid && allowedValues.length > 0) {
        const allowValuesText = [...new Set(allowedValues)].map((value) => JSON.stringify(value)).join(", ");
        vue.warn(`Invalid prop: validation failed${key ? ` for prop "${key}"` : ""}. Expected one of [${allowValuesText}], got value ${JSON.stringify(val)}.`);
      }
      return valid;
    } : void 0;
    const epProp = {
      type,
      required: !!required,
      validator: _validator,
      [epPropKey]: true
    };
    if (hasOwn(prop, "default"))
      epProp.default = defaultValue;
    return epProp;
  };
  const buildProps = (props) => fromPairs(Object.entries(props).map(([key, option]) => [
    key,
    buildProp(option, key)
  ]));
  const iconPropType = definePropType([
    String,
    Object,
    Function
  ]);
  const CloseComponents = {
    Close: close_default
  };
  const TypeComponents = {
    Close: close_default,
    SuccessFilled: success_filled_default,
    InfoFilled: info_filled_default,
    WarningFilled: warning_filled_default,
    CircleCloseFilled: circle_close_filled_default
  };
  const TypeComponentsMap = {
    success: success_filled_default,
    warning: warning_filled_default,
    error: circle_close_filled_default,
    info: info_filled_default
  };
  const withInstall = (main2, extra) => {
    main2.install = (app) => {
      for (const comp of [main2, ...Object.values(extra != null ? extra : {})]) {
        app.component(comp.name, comp);
      }
    };
    if (extra) {
      for (const [key, comp] of Object.entries(extra)) {
        main2[key] = comp;
      }
    }
    return main2;
  };
  const withInstallFunction = (fn, name) => {
    fn.install = (app) => {
      fn._context = app._context;
      app.config.globalProperties[name] = fn;
    };
    return fn;
  };
  const withNoopInstall = (component) => {
    component.install = NOOP;
    return component;
  };
  const composeRefs = (...refs) => {
    return (el) => {
      refs.forEach((ref2) => {
        if (isFunction$1(ref2)) {
          ref2(el);
        } else {
          ref2.value = el;
        }
      });
    };
  };
  const EVENT_CODE = {
    tab: "Tab",
    enter: "Enter",
    space: "Space",
    left: "ArrowLeft",
    up: "ArrowUp",
    right: "ArrowRight",
    down: "ArrowDown",
    esc: "Escape",
    delete: "Delete",
    backspace: "Backspace",
    numpadEnter: "NumpadEnter",
    pageUp: "PageUp",
    pageDown: "PageDown",
    home: "Home",
    end: "End"
  };
  const UPDATE_MODEL_EVENT = "update:modelValue";
  const componentSizes = ["", "default", "small", "large"];
  var PatchFlags = /* @__PURE__ */ ((PatchFlags2) => {
    PatchFlags2[PatchFlags2["TEXT"] = 1] = "TEXT";
    PatchFlags2[PatchFlags2["CLASS"] = 2] = "CLASS";
    PatchFlags2[PatchFlags2["STYLE"] = 4] = "STYLE";
    PatchFlags2[PatchFlags2["PROPS"] = 8] = "PROPS";
    PatchFlags2[PatchFlags2["FULL_PROPS"] = 16] = "FULL_PROPS";
    PatchFlags2[PatchFlags2["HYDRATE_EVENTS"] = 32] = "HYDRATE_EVENTS";
    PatchFlags2[PatchFlags2["STABLE_FRAGMENT"] = 64] = "STABLE_FRAGMENT";
    PatchFlags2[PatchFlags2["KEYED_FRAGMENT"] = 128] = "KEYED_FRAGMENT";
    PatchFlags2[PatchFlags2["UNKEYED_FRAGMENT"] = 256] = "UNKEYED_FRAGMENT";
    PatchFlags2[PatchFlags2["NEED_PATCH"] = 512] = "NEED_PATCH";
    PatchFlags2[PatchFlags2["DYNAMIC_SLOTS"] = 1024] = "DYNAMIC_SLOTS";
    PatchFlags2[PatchFlags2["HOISTED"] = -1] = "HOISTED";
    PatchFlags2[PatchFlags2["BAIL"] = -2] = "BAIL";
    return PatchFlags2;
  })(PatchFlags || {});
  const mutable = (val) => val;
  const useDeprecated = ({ from, replacement, scope, version, ref: ref2, type = "API" }, condition) => {
    vue.watch(() => vue.unref(condition), (val) => {
    }, {
      immediate: true
    });
  };
  const useDraggable = (targetRef, dragRef, draggable, overflow) => {
    let transform = {
      offsetX: 0,
      offsetY: 0
    };
    const onMousedown = (e) => {
      const downX = e.clientX;
      const downY = e.clientY;
      const { offsetX, offsetY } = transform;
      const targetRect = targetRef.value.getBoundingClientRect();
      const targetLeft = targetRect.left;
      const targetTop = targetRect.top;
      const targetWidth = targetRect.width;
      const targetHeight = targetRect.height;
      const clientWidth = document.documentElement.clientWidth;
      const clientHeight = document.documentElement.clientHeight;
      const minLeft = -targetLeft + offsetX;
      const minTop = -targetTop + offsetY;
      const maxLeft = clientWidth - targetLeft - targetWidth + offsetX;
      const maxTop = clientHeight - targetTop - targetHeight + offsetY;
      const onMousemove = (e2) => {
        let moveX = offsetX + e2.clientX - downX;
        let moveY = offsetY + e2.clientY - downY;
        if (!(overflow == null ? void 0 : overflow.value)) {
          moveX = Math.min(Math.max(moveX, minLeft), maxLeft);
          moveY = Math.min(Math.max(moveY, minTop), maxTop);
        }
        transform = {
          offsetX: moveX,
          offsetY: moveY
        };
        if (targetRef.value) {
          targetRef.value.style.transform = `translate(${addUnit(moveX)}, ${addUnit(moveY)})`;
        }
      };
      const onMouseup = () => {
        document.removeEventListener("mousemove", onMousemove);
        document.removeEventListener("mouseup", onMouseup);
      };
      document.addEventListener("mousemove", onMousemove);
      document.addEventListener("mouseup", onMouseup);
    };
    const onDraggable = () => {
      if (dragRef.value && targetRef.value) {
        dragRef.value.addEventListener("mousedown", onMousedown);
      }
    };
    const offDraggable = () => {
      if (dragRef.value && targetRef.value) {
        dragRef.value.removeEventListener("mousedown", onMousedown);
      }
    };
    vue.onMounted(() => {
      vue.watchEffect(() => {
        if (draggable.value) {
          onDraggable();
        } else {
          offDraggable();
        }
      });
    });
    vue.onBeforeUnmount(() => {
      offDraggable();
    });
  };
  var English = {
    name: "en",
    el: {
      colorpicker: {
        confirm: "OK",
        clear: "Clear",
        defaultLabel: "color picker",
        description: "current color is {color}. press enter to select a new color."
      },
      datepicker: {
        now: "Now",
        today: "Today",
        cancel: "Cancel",
        clear: "Clear",
        confirm: "OK",
        dateTablePrompt: "Use the arrow keys and enter to select the day of the month",
        monthTablePrompt: "Use the arrow keys and enter to select the month",
        yearTablePrompt: "Use the arrow keys and enter to select the year",
        selectedDate: "Selected date",
        selectDate: "Select date",
        selectTime: "Select time",
        startDate: "Start Date",
        startTime: "Start Time",
        endDate: "End Date",
        endTime: "End Time",
        prevYear: "Previous Year",
        nextYear: "Next Year",
        prevMonth: "Previous Month",
        nextMonth: "Next Month",
        year: "",
        month1: "January",
        month2: "February",
        month3: "March",
        month4: "April",
        month5: "May",
        month6: "June",
        month7: "July",
        month8: "August",
        month9: "September",
        month10: "October",
        month11: "November",
        month12: "December",
        week: "week",
        weeks: {
          sun: "Sun",
          mon: "Mon",
          tue: "Tue",
          wed: "Wed",
          thu: "Thu",
          fri: "Fri",
          sat: "Sat"
        },
        weeksFull: {
          sun: "Sunday",
          mon: "Monday",
          tue: "Tuesday",
          wed: "Wednesday",
          thu: "Thursday",
          fri: "Friday",
          sat: "Saturday"
        },
        months: {
          jan: "Jan",
          feb: "Feb",
          mar: "Mar",
          apr: "Apr",
          may: "May",
          jun: "Jun",
          jul: "Jul",
          aug: "Aug",
          sep: "Sep",
          oct: "Oct",
          nov: "Nov",
          dec: "Dec"
        }
      },
      inputNumber: {
        decrease: "decrease number",
        increase: "increase number"
      },
      select: {
        loading: "Loading",
        noMatch: "No matching data",
        noData: "No data",
        placeholder: "Select"
      },
      dropdown: {
        toggleDropdown: "Toggle Dropdown"
      },
      cascader: {
        noMatch: "No matching data",
        loading: "Loading",
        placeholder: "Select",
        noData: "No data"
      },
      pagination: {
        goto: "Go to",
        pagesize: "/page",
        total: "Total {total}",
        pageClassifier: "",
        page: "Page",
        prev: "Go to previous page",
        next: "Go to next page",
        currentPage: "page {pager}",
        prevPages: "Previous {pager} pages",
        nextPages: "Next {pager} pages",
        deprecationWarning: "Deprecated usages detected, please refer to the el-pagination documentation for more details"
      },
      dialog: {
        close: "Close this dialog"
      },
      drawer: {
        close: "Close this dialog"
      },
      messagebox: {
        title: "Message",
        confirm: "OK",
        cancel: "Cancel",
        error: "Illegal input",
        close: "Close this dialog"
      },
      upload: {
        deleteTip: "press delete to remove",
        delete: "Delete",
        preview: "Preview",
        continue: "Continue"
      },
      slider: {
        defaultLabel: "slider between {min} and {max}",
        defaultRangeStartLabel: "pick start value",
        defaultRangeEndLabel: "pick end value"
      },
      table: {
        emptyText: "No Data",
        confirmFilter: "Confirm",
        resetFilter: "Reset",
        clearFilter: "All",
        sumText: "Sum"
      },
      tour: {
        next: "Next",
        previous: "Previous",
        finish: "Finish"
      },
      tree: {
        emptyText: "No Data"
      },
      transfer: {
        noMatch: "No matching data",
        noData: "No data",
        titles: ["List 1", "List 2"],
        filterPlaceholder: "Enter keyword",
        noCheckedFormat: "{total} items",
        hasCheckedFormat: "{checked}/{total} checked"
      },
      image: {
        error: "FAILED"
      },
      pageHeader: {
        title: "Back"
      },
      popconfirm: {
        confirmButtonText: "Yes",
        cancelButtonText: "No"
      }
    }
  };
  const buildTranslator = (locale) => (path, option) => translate(path, option, vue.unref(locale));
  const translate = (path, option, locale) => get(locale, path, path).replace(/\{(\w+)\}/g, (_, key) => {
    var _a2;
    return `${(_a2 = option == null ? void 0 : option[key]) != null ? _a2 : `{${key}}`}`;
  });
  const buildLocaleContext = (locale) => {
    const lang = vue.computed(() => vue.unref(locale).name);
    const localeRef = vue.isRef(locale) ? locale : vue.ref(locale);
    return {
      lang,
      locale: localeRef,
      t: buildTranslator(locale)
    };
  };
  const localeContextKey = Symbol("localeContextKey");
  const useLocale = (localeOverrides) => {
    const locale = localeOverrides || vue.inject(localeContextKey, vue.ref());
    return buildLocaleContext(vue.computed(() => locale.value || English));
  };
  let activeEffectScope;
  function recordEffectScope(effect, scope = activeEffectScope) {
    if (scope && scope.active) {
      scope.effects.push(effect);
    }
  }
  const createDep = (effects) => {
    const dep = new Set(effects);
    dep.w = 0;
    dep.n = 0;
    return dep;
  };
  const wasTracked = (dep) => (dep.w & trackOpBit) > 0;
  const newTracked = (dep) => (dep.n & trackOpBit) > 0;
  const initDepMarkers = ({ deps }) => {
    if (deps.length) {
      for (let i = 0; i < deps.length; i++) {
        deps[i].w |= trackOpBit;
      }
    }
  };
  const finalizeDepMarkers = (effect) => {
    const { deps } = effect;
    if (deps.length) {
      let ptr = 0;
      for (let i = 0; i < deps.length; i++) {
        const dep = deps[i];
        if (wasTracked(dep) && !newTracked(dep)) {
          dep.delete(effect);
        } else {
          deps[ptr++] = dep;
        }
        dep.w &= ~trackOpBit;
        dep.n &= ~trackOpBit;
      }
      deps.length = ptr;
    }
  };
  let effectTrackDepth = 0;
  let trackOpBit = 1;
  const maxMarkerBits = 30;
  let activeEffect;
  class ReactiveEffect {
    constructor(fn, scheduler = null, scope) {
      this.fn = fn;
      this.scheduler = scheduler;
      this.active = true;
      this.deps = [];
      this.parent = void 0;
      recordEffectScope(this, scope);
    }
    run() {
      if (!this.active) {
        return this.fn();
      }
      let parent = activeEffect;
      let lastShouldTrack = shouldTrack;
      while (parent) {
        if (parent === this) {
          return;
        }
        parent = parent.parent;
      }
      try {
        this.parent = activeEffect;
        activeEffect = this;
        shouldTrack = true;
        trackOpBit = 1 << ++effectTrackDepth;
        if (effectTrackDepth <= maxMarkerBits) {
          initDepMarkers(this);
        } else {
          cleanupEffect(this);
        }
        return this.fn();
      } finally {
        if (effectTrackDepth <= maxMarkerBits) {
          finalizeDepMarkers(this);
        }
        trackOpBit = 1 << --effectTrackDepth;
        activeEffect = this.parent;
        shouldTrack = lastShouldTrack;
        this.parent = void 0;
        if (this.deferStop) {
          this.stop();
        }
      }
    }
    stop() {
      if (activeEffect === this) {
        this.deferStop = true;
      } else if (this.active) {
        cleanupEffect(this);
        if (this.onStop) {
          this.onStop();
        }
        this.active = false;
      }
    }
  }
  function cleanupEffect(effect2) {
    const { deps } = effect2;
    if (deps.length) {
      for (let i = 0; i < deps.length; i++) {
        deps[i].delete(effect2);
      }
      deps.length = 0;
    }
  }
  let shouldTrack = true;
  function trackEffects(dep, debuggerEventExtraInfo) {
    let shouldTrack2 = false;
    if (effectTrackDepth <= maxMarkerBits) {
      if (!newTracked(dep)) {
        dep.n |= trackOpBit;
        shouldTrack2 = !wasTracked(dep);
      }
    } else {
      shouldTrack2 = !dep.has(activeEffect);
    }
    if (shouldTrack2) {
      dep.add(activeEffect);
      activeEffect.deps.push(dep);
    }
  }
  function triggerEffects(dep, debuggerEventExtraInfo) {
    const effects = isArray$2(dep) ? dep : [...dep];
    for (const effect2 of effects) {
      if (effect2.computed) {
        triggerEffect(effect2);
      }
    }
    for (const effect2 of effects) {
      if (!effect2.computed) {
        triggerEffect(effect2);
      }
    }
  }
  function triggerEffect(effect2, debuggerEventExtraInfo) {
    if (effect2 !== activeEffect || effect2.allowRecurse) {
      if (effect2.scheduler) {
        effect2.scheduler();
      } else {
        effect2.run();
      }
    }
  }
  new Set(
    /* @__PURE__ */ Object.getOwnPropertyNames(Symbol).filter((key) => key !== "arguments" && key !== "caller").map((key) => Symbol[key]).filter(isSymbol$1)
  );
  function toRaw(observed) {
    const raw = observed && observed["__v_raw"];
    return raw ? toRaw(raw) : observed;
  }
  function trackRefValue(ref2) {
    if (shouldTrack && activeEffect) {
      ref2 = toRaw(ref2);
      {
        trackEffects(ref2.dep || (ref2.dep = createDep()));
      }
    }
  }
  function triggerRefValue(ref2, newVal) {
    ref2 = toRaw(ref2);
    const dep = ref2.dep;
    if (dep) {
      {
        triggerEffects(dep);
      }
    }
  }
  class ComputedRefImpl {
    constructor(getter, _setter, isReadonly, isSSR) {
      this._setter = _setter;
      this.dep = void 0;
      this.__v_isRef = true;
      this["__v_isReadonly"] = false;
      this._dirty = true;
      this.effect = new ReactiveEffect(getter, () => {
        if (!this._dirty) {
          this._dirty = true;
          triggerRefValue(this);
        }
      });
      this.effect.computed = this;
      this.effect.active = this._cacheable = !isSSR;
      this["__v_isReadonly"] = isReadonly;
    }
    get value() {
      const self2 = toRaw(this);
      trackRefValue(self2);
      if (self2._dirty || !self2._cacheable) {
        self2._dirty = false;
        self2._value = self2.effect.run();
      }
      return self2._value;
    }
    set value(newValue) {
      this._setter(newValue);
    }
  }
  function computed(getterOrOptions, debugOptions, isSSR = false) {
    let getter;
    let setter;
    const onlyGetter = isFunction$1(getterOrOptions);
    if (onlyGetter) {
      getter = getterOrOptions;
      setter = NOOP;
    } else {
      getter = getterOrOptions.get;
      setter = getterOrOptions.set;
    }
    const cRef = new ComputedRefImpl(getter, setter, onlyGetter || !setter, isSSR);
    return cRef;
  }
  const defaultNamespace = "el";
  const statePrefix = "is-";
  const _bem = (namespace, block, blockSuffix, element, modifier) => {
    let cls = `${namespace}-${block}`;
    if (blockSuffix) {
      cls += `-${blockSuffix}`;
    }
    if (element) {
      cls += `__${element}`;
    }
    if (modifier) {
      cls += `--${modifier}`;
    }
    return cls;
  };
  const namespaceContextKey = Symbol("namespaceContextKey");
  const useGetDerivedNamespace = (namespaceOverrides) => {
    const derivedNamespace = namespaceOverrides || (vue.getCurrentInstance() ? vue.inject(namespaceContextKey, vue.ref(defaultNamespace)) : vue.ref(defaultNamespace));
    const namespace = vue.computed(() => {
      return vue.unref(derivedNamespace) || defaultNamespace;
    });
    return namespace;
  };
  const useNamespace = (block, namespaceOverrides) => {
    const namespace = useGetDerivedNamespace(namespaceOverrides);
    const b = (blockSuffix = "") => _bem(namespace.value, block, blockSuffix, "", "");
    const e = (element) => element ? _bem(namespace.value, block, "", element, "") : "";
    const m = (modifier) => modifier ? _bem(namespace.value, block, "", "", modifier) : "";
    const be = (blockSuffix, element) => blockSuffix && element ? _bem(namespace.value, block, blockSuffix, element, "") : "";
    const em = (element, modifier) => element && modifier ? _bem(namespace.value, block, "", element, modifier) : "";
    const bm = (blockSuffix, modifier) => blockSuffix && modifier ? _bem(namespace.value, block, blockSuffix, "", modifier) : "";
    const bem = (blockSuffix, element, modifier) => blockSuffix && element && modifier ? _bem(namespace.value, block, blockSuffix, element, modifier) : "";
    const is = (name, ...args) => {
      const state = args.length >= 1 ? args[0] : true;
      return name && state ? `${statePrefix}${name}` : "";
    };
    const cssVar = (object) => {
      const styles = {};
      for (const key in object) {
        if (object[key]) {
          styles[`--${namespace.value}-${key}`] = object[key];
        }
      }
      return styles;
    };
    const cssVarBlock = (object) => {
      const styles = {};
      for (const key in object) {
        if (object[key]) {
          styles[`--${namespace.value}-${block}-${key}`] = object[key];
        }
      }
      return styles;
    };
    const cssVarName = (name) => `--${namespace.value}-${name}`;
    const cssVarBlockName = (name) => `--${namespace.value}-${block}-${name}`;
    return {
      namespace,
      b,
      e,
      m,
      be,
      em,
      bm,
      bem,
      is,
      cssVar,
      cssVarName,
      cssVarBlock,
      cssVarBlockName
    };
  };
  const useLockscreen = (trigger, options = {}) => {
    if (!vue.isRef(trigger)) {
      throwError("[useLockscreen]", "You need to pass a ref param to this function");
    }
    const ns = options.ns || useNamespace("popup");
    const hiddenCls = computed(() => ns.bm("parent", "hidden"));
    if (!isClient || hasClass(document.body, hiddenCls.value)) {
      return;
    }
    let scrollBarWidth2 = 0;
    let withoutHiddenClass = false;
    let bodyWidth = "0";
    const cleanup = () => {
      setTimeout(() => {
        removeClass(document == null ? void 0 : document.body, hiddenCls.value);
        if (withoutHiddenClass && document) {
          document.body.style.width = bodyWidth;
        }
      }, 200);
    };
    vue.watch(trigger, (val) => {
      if (!val) {
        cleanup();
        return;
      }
      withoutHiddenClass = !hasClass(document.body, hiddenCls.value);
      if (withoutHiddenClass) {
        bodyWidth = document.body.style.width;
      }
      scrollBarWidth2 = getScrollBarWidth(ns.namespace.value);
      const bodyHasOverflow = document.documentElement.clientHeight < document.body.scrollHeight;
      const bodyOverflowY = getStyle(document.body, "overflowY");
      if (scrollBarWidth2 > 0 && (bodyHasOverflow || bodyOverflowY === "scroll") && withoutHiddenClass) {
        document.body.style.width = `calc(100% - ${scrollBarWidth2}px)`;
      }
      addClass(document.body, hiddenCls.value);
    });
    vue.onScopeDispose(() => cleanup());
  };
  const useProp = (name) => {
    const vm = vue.getCurrentInstance();
    return vue.computed(() => {
      var _a2, _b;
      return (_b = (_a2 = vm == null ? void 0 : vm.proxy) == null ? void 0 : _a2.$props) == null ? void 0 : _b[name];
    });
  };
  const useSameTarget = (handleClick) => {
    if (!handleClick) {
      return { onClick: NOOP, onMousedown: NOOP, onMouseup: NOOP };
    }
    let mousedownTarget = false;
    let mouseupTarget = false;
    const onClick = (e) => {
      if (mousedownTarget && mouseupTarget) {
        handleClick(e);
      }
      mousedownTarget = mouseupTarget = false;
    };
    const onMousedown = (e) => {
      mousedownTarget = e.target === e.currentTarget;
    };
    const onMouseup = (e) => {
      mouseupTarget = e.target === e.currentTarget;
    };
    return { onClick, onMousedown, onMouseup };
  };
  const defaultIdInjection = {
    prefix: Math.floor(Math.random() * 1e4),
    current: 0
  };
  const ID_INJECTION_KEY = Symbol("elIdInjection");
  const useIdInjection = () => {
    return vue.getCurrentInstance() ? vue.inject(ID_INJECTION_KEY, defaultIdInjection) : defaultIdInjection;
  };
  const useId = (deterministicId) => {
    const idInjection = useIdInjection();
    const namespace = useGetDerivedNamespace();
    const idRef = vue.computed(() => vue.unref(deterministicId) || `${namespace.value}-id-${idInjection.prefix}-${idInjection.current++}`);
    return idRef;
  };
  let registeredEscapeHandlers = [];
  const cachedHandler = (e) => {
    const event = e;
    if (event.key === EVENT_CODE.esc) {
      registeredEscapeHandlers.forEach((registeredHandler) => registeredHandler(event));
    }
  };
  const useEscapeKeydown = (handler) => {
    vue.onMounted(() => {
      if (registeredEscapeHandlers.length === 0) {
        document.addEventListener("keydown", cachedHandler);
      }
      if (isClient)
        registeredEscapeHandlers.push(handler);
    });
    vue.onBeforeUnmount(() => {
      registeredEscapeHandlers = registeredEscapeHandlers.filter((registeredHandler) => registeredHandler !== handler);
      if (registeredEscapeHandlers.length === 0) {
        if (isClient)
          document.removeEventListener("keydown", cachedHandler);
      }
    });
  };
  const zIndex = vue.ref(0);
  const defaultInitialZIndex = 2e3;
  const zIndexContextKey = Symbol("zIndexContextKey");
  const useZIndex = (zIndexOverrides) => {
    const zIndexInjection = zIndexOverrides || (vue.getCurrentInstance() ? vue.inject(zIndexContextKey, void 0) : void 0);
    const initialZIndex = vue.computed(() => {
      const zIndexFromInjection = vue.unref(zIndexInjection);
      return isNumber(zIndexFromInjection) ? zIndexFromInjection : defaultInitialZIndex;
    });
    const currentZIndex = vue.computed(() => initialZIndex.value + zIndex.value);
    const nextZIndex = () => {
      zIndex.value++;
      return currentZIndex.value;
    };
    return {
      initialZIndex,
      currentZIndex,
      nextZIndex
    };
  };
  const useSizeProp = buildProp({
    type: String,
    values: componentSizes,
    required: false
  });
  const SIZE_INJECTION_KEY = Symbol("size");
  const useGlobalSize = () => {
    const injectedSize = vue.inject(SIZE_INJECTION_KEY, {});
    return vue.computed(() => {
      return vue.unref(injectedSize.size) || "";
    });
  };
  const configProviderContextKey = Symbol();
  const globalConfig = vue.ref();
  function useGlobalConfig(key, defaultValue = void 0) {
    const config = vue.getCurrentInstance() ? vue.inject(configProviderContextKey, globalConfig) : globalConfig;
    if (key) {
      return vue.computed(() => {
        var _a2, _b;
        return (_b = (_a2 = config.value) == null ? void 0 : _a2[key]) != null ? _b : defaultValue;
      });
    } else {
      return config;
    }
  }
  function useGlobalComponentSettings(block, sizeFallback) {
    const config = useGlobalConfig();
    const ns = useNamespace(block, vue.computed(() => {
      var _a2;
      return ((_a2 = config.value) == null ? void 0 : _a2.namespace) || defaultNamespace;
    }));
    const locale = useLocale(vue.computed(() => {
      var _a2;
      return (_a2 = config.value) == null ? void 0 : _a2.locale;
    }));
    const zIndex2 = useZIndex(vue.computed(() => {
      var _a2;
      return ((_a2 = config.value) == null ? void 0 : _a2.zIndex) || defaultInitialZIndex;
    }));
    const size = vue.computed(() => {
      var _a2;
      return vue.unref(sizeFallback) || ((_a2 = config.value) == null ? void 0 : _a2.size) || "";
    });
    provideGlobalConfig(vue.computed(() => vue.unref(config) || {}));
    return {
      ns,
      locale,
      zIndex: zIndex2,
      size
    };
  }
  const provideGlobalConfig = (config, app, global2 = false) => {
    var _a2;
    const inSetup = !!vue.getCurrentInstance();
    const oldConfig = inSetup ? useGlobalConfig() : void 0;
    const provideFn = (_a2 = app == null ? void 0 : app.provide) != null ? _a2 : inSetup ? vue.provide : void 0;
    if (!provideFn) {
      return;
    }
    const context = vue.computed(() => {
      const cfg = vue.unref(config);
      if (!(oldConfig == null ? void 0 : oldConfig.value))
        return cfg;
      return mergeConfig(oldConfig.value, cfg);
    });
    provideFn(configProviderContextKey, context);
    provideFn(localeContextKey, vue.computed(() => context.value.locale));
    provideFn(namespaceContextKey, vue.computed(() => context.value.namespace));
    provideFn(zIndexContextKey, vue.computed(() => context.value.zIndex));
    provideFn(SIZE_INJECTION_KEY, {
      size: vue.computed(() => context.value.size || "")
    });
    if (global2 || !globalConfig.value) {
      globalConfig.value = context.value;
    }
    return context;
  };
  const mergeConfig = (a, b) => {
    var _a2;
    const keys = [.../* @__PURE__ */ new Set([...keysOf(a), ...keysOf(b)])];
    const obj = {};
    for (const key of keys) {
      obj[key] = (_a2 = b[key]) != null ? _a2 : a[key];
    }
    return obj;
  };
  const configProviderProps = buildProps({
    a11y: {
      type: Boolean,
      default: true
    },
    locale: {
      type: definePropType(Object)
    },
    size: useSizeProp,
    button: {
      type: definePropType(Object)
    },
    experimentalFeatures: {
      type: definePropType(Object)
    },
    keyboardNavigation: {
      type: Boolean,
      default: true
    },
    message: {
      type: definePropType(Object)
    },
    zIndex: Number,
    namespace: {
      type: String,
      default: "el"
    }
  });
  const messageConfig = {};
  vue.defineComponent({
    name: "ElConfigProvider",
    props: configProviderProps,
    setup(props, { slots }) {
      vue.watch(() => props.message, (val) => {
        Object.assign(messageConfig, val != null ? val : {});
      }, { immediate: true, deep: true });
      const config = provideGlobalConfig(props);
      return () => vue.renderSlot(slots, "default", { config: config == null ? void 0 : config.value });
    }
  });
  var _export_sfc$1 = (sfc, props) => {
    const target = sfc.__vccOpts || sfc;
    for (const [key, val] of props) {
      target[key] = val;
    }
    return target;
  };
  const iconProps = buildProps({
    size: {
      type: definePropType([Number, String])
    },
    color: {
      type: String
    }
  });
  const __default__$6 = vue.defineComponent({
    name: "ElIcon",
    inheritAttrs: false
  });
  const _sfc_main$9 = /* @__PURE__ */ vue.defineComponent({
    ...__default__$6,
    props: iconProps,
    setup(__props) {
      const props = __props;
      const ns = useNamespace("icon");
      const style2 = vue.computed(() => {
        const { size, color } = props;
        if (!size && !color)
          return {};
        return {
          fontSize: isUndefined(size) ? void 0 : addUnit(size),
          "--color": color
        };
      });
      return (_ctx, _cache) => {
        return vue.openBlock(), vue.createElementBlock("i", vue.mergeProps({
          class: vue.unref(ns).b(),
          style: vue.unref(style2)
        }, _ctx.$attrs), [
          vue.renderSlot(_ctx.$slots, "default")
        ], 16);
      };
    }
  });
  var Icon = /* @__PURE__ */ _export_sfc$1(_sfc_main$9, [["__file", "icon.vue"]]);
  const ElIcon = withInstall(Icon);
  const formContextKey = Symbol("formContextKey");
  const formItemContextKey = Symbol("formItemContextKey");
  const useFormSize = (fallback, ignore = {}) => {
    const emptyRef = vue.ref(void 0);
    const size = ignore.prop ? emptyRef : useProp("size");
    const globalConfig2 = ignore.global ? emptyRef : useGlobalSize();
    const form = ignore.form ? { size: void 0 } : vue.inject(formContextKey, void 0);
    const formItem = ignore.formItem ? { size: void 0 } : vue.inject(formItemContextKey, void 0);
    return vue.computed(() => size.value || vue.unref(fallback) || (formItem == null ? void 0 : formItem.size) || (form == null ? void 0 : form.size) || globalConfig2.value || "");
  };
  const useFormDisabled = (fallback) => {
    const disabled = useProp("disabled");
    const form = vue.inject(formContextKey, void 0);
    return vue.computed(() => disabled.value || vue.unref(fallback) || (form == null ? void 0 : form.disabled) || false);
  };
  const useFormItem = () => {
    const form = vue.inject(formContextKey, void 0);
    const formItem = vue.inject(formItemContextKey, void 0);
    return {
      form,
      formItem
    };
  };
  const FOCUS_AFTER_TRAPPED = "focus-trap.focus-after-trapped";
  const FOCUS_AFTER_RELEASED = "focus-trap.focus-after-released";
  const FOCUSOUT_PREVENTED = "focus-trap.focusout-prevented";
  const FOCUS_AFTER_TRAPPED_OPTS = {
    cancelable: true,
    bubbles: false
  };
  const FOCUSOUT_PREVENTED_OPTS = {
    cancelable: true,
    bubbles: false
  };
  const ON_TRAP_FOCUS_EVT = "focusAfterTrapped";
  const ON_RELEASE_FOCUS_EVT = "focusAfterReleased";
  const FOCUS_TRAP_INJECTION_KEY = Symbol("elFocusTrap");
  const focusReason = vue.ref();
  const lastUserFocusTimestamp = vue.ref(0);
  const lastAutomatedFocusTimestamp = vue.ref(0);
  let focusReasonUserCount = 0;
  const obtainAllFocusableElements = (element) => {
    const nodes = [];
    const walker = document.createTreeWalker(element, NodeFilter.SHOW_ELEMENT, {
      acceptNode: (node) => {
        const isHiddenInput = node.tagName === "INPUT" && node.type === "hidden";
        if (node.disabled || node.hidden || isHiddenInput)
          return NodeFilter.FILTER_SKIP;
        return node.tabIndex >= 0 || node === document.activeElement ? NodeFilter.FILTER_ACCEPT : NodeFilter.FILTER_SKIP;
      }
    });
    while (walker.nextNode())
      nodes.push(walker.currentNode);
    return nodes;
  };
  const getVisibleElement = (elements, container) => {
    for (const element of elements) {
      if (!isHidden(element, container))
        return element;
    }
  };
  const isHidden = (element, container) => {
    if (getComputedStyle(element).visibility === "hidden")
      return true;
    while (element) {
      if (container && element === container)
        return false;
      if (getComputedStyle(element).display === "none")
        return true;
      element = element.parentElement;
    }
    return false;
  };
  const getEdges = (container) => {
    const focusable = obtainAllFocusableElements(container);
    const first = getVisibleElement(focusable, container);
    const last = getVisibleElement(focusable.reverse(), container);
    return [first, last];
  };
  const isSelectable = (element) => {
    return element instanceof HTMLInputElement && "select" in element;
  };
  const tryFocus = (element, shouldSelect) => {
    if (element && element.focus) {
      const prevFocusedElement = document.activeElement;
      element.focus({ preventScroll: true });
      lastAutomatedFocusTimestamp.value = window.performance.now();
      if (element !== prevFocusedElement && isSelectable(element) && shouldSelect) {
        element.select();
      }
    }
  };
  function removeFromStack(list, item) {
    const copy = [...list];
    const idx = list.indexOf(item);
    if (idx !== -1) {
      copy.splice(idx, 1);
    }
    return copy;
  }
  const createFocusableStack = () => {
    let stack = [];
    const push = (layer) => {
      const currentLayer = stack[0];
      if (currentLayer && layer !== currentLayer) {
        currentLayer.pause();
      }
      stack = removeFromStack(stack, layer);
      stack.unshift(layer);
    };
    const remove = (layer) => {
      var _a2, _b;
      stack = removeFromStack(stack, layer);
      (_b = (_a2 = stack[0]) == null ? void 0 : _a2.resume) == null ? void 0 : _b.call(_a2);
    };
    return {
      push,
      remove
    };
  };
  const focusFirstDescendant = (elements, shouldSelect = false) => {
    const prevFocusedElement = document.activeElement;
    for (const element of elements) {
      tryFocus(element, shouldSelect);
      if (document.activeElement !== prevFocusedElement)
        return;
    }
  };
  const focusableStack = createFocusableStack();
  const isFocusCausedByUserEvent = () => {
    return lastUserFocusTimestamp.value > lastAutomatedFocusTimestamp.value;
  };
  const notifyFocusReasonPointer = () => {
    focusReason.value = "pointer";
    lastUserFocusTimestamp.value = window.performance.now();
  };
  const notifyFocusReasonKeydown = () => {
    focusReason.value = "keyboard";
    lastUserFocusTimestamp.value = window.performance.now();
  };
  const useFocusReason = () => {
    vue.onMounted(() => {
      if (focusReasonUserCount === 0) {
        document.addEventListener("mousedown", notifyFocusReasonPointer);
        document.addEventListener("touchstart", notifyFocusReasonPointer);
        document.addEventListener("keydown", notifyFocusReasonKeydown);
      }
      focusReasonUserCount++;
    });
    vue.onBeforeUnmount(() => {
      focusReasonUserCount--;
      if (focusReasonUserCount <= 0) {
        document.removeEventListener("mousedown", notifyFocusReasonPointer);
        document.removeEventListener("touchstart", notifyFocusReasonPointer);
        document.removeEventListener("keydown", notifyFocusReasonKeydown);
      }
    });
    return {
      focusReason,
      lastUserFocusTimestamp,
      lastAutomatedFocusTimestamp
    };
  };
  const createFocusOutPreventedEvent = (detail) => {
    return new CustomEvent(FOCUSOUT_PREVENTED, {
      ...FOCUSOUT_PREVENTED_OPTS,
      detail
    });
  };
  const _sfc_main$8 = vue.defineComponent({
    name: "ElFocusTrap",
    inheritAttrs: false,
    props: {
      loop: Boolean,
      trapped: Boolean,
      focusTrapEl: Object,
      focusStartEl: {
        type: [Object, String],
        default: "first"
      }
    },
    emits: [
      ON_TRAP_FOCUS_EVT,
      ON_RELEASE_FOCUS_EVT,
      "focusin",
      "focusout",
      "focusout-prevented",
      "release-requested"
    ],
    setup(props, { emit }) {
      const forwardRef = vue.ref();
      let lastFocusBeforeTrapped;
      let lastFocusAfterTrapped;
      const { focusReason: focusReason2 } = useFocusReason();
      useEscapeKeydown((event) => {
        if (props.trapped && !focusLayer.paused) {
          emit("release-requested", event);
        }
      });
      const focusLayer = {
        paused: false,
        pause() {
          this.paused = true;
        },
        resume() {
          this.paused = false;
        }
      };
      const onKeydown = (e) => {
        if (!props.loop && !props.trapped)
          return;
        if (focusLayer.paused)
          return;
        const { key, altKey, ctrlKey, metaKey, currentTarget, shiftKey } = e;
        const { loop } = props;
        const isTabbing = key === EVENT_CODE.tab && !altKey && !ctrlKey && !metaKey;
        const currentFocusingEl = document.activeElement;
        if (isTabbing && currentFocusingEl) {
          const container = currentTarget;
          const [first, last] = getEdges(container);
          const isTabbable = first && last;
          if (!isTabbable) {
            if (currentFocusingEl === container) {
              const focusoutPreventedEvent = createFocusOutPreventedEvent({
                focusReason: focusReason2.value
              });
              emit("focusout-prevented", focusoutPreventedEvent);
              if (!focusoutPreventedEvent.defaultPrevented) {
                e.preventDefault();
              }
            }
          } else {
            if (!shiftKey && currentFocusingEl === last) {
              const focusoutPreventedEvent = createFocusOutPreventedEvent({
                focusReason: focusReason2.value
              });
              emit("focusout-prevented", focusoutPreventedEvent);
              if (!focusoutPreventedEvent.defaultPrevented) {
                e.preventDefault();
                if (loop)
                  tryFocus(first, true);
              }
            } else if (shiftKey && [first, container].includes(currentFocusingEl)) {
              const focusoutPreventedEvent = createFocusOutPreventedEvent({
                focusReason: focusReason2.value
              });
              emit("focusout-prevented", focusoutPreventedEvent);
              if (!focusoutPreventedEvent.defaultPrevented) {
                e.preventDefault();
                if (loop)
                  tryFocus(last, true);
              }
            }
          }
        }
      };
      vue.provide(FOCUS_TRAP_INJECTION_KEY, {
        focusTrapRef: forwardRef,
        onKeydown
      });
      vue.watch(() => props.focusTrapEl, (focusTrapEl) => {
        if (focusTrapEl) {
          forwardRef.value = focusTrapEl;
        }
      }, { immediate: true });
      vue.watch([forwardRef], ([forwardRef2], [oldForwardRef]) => {
        if (forwardRef2) {
          forwardRef2.addEventListener("keydown", onKeydown);
          forwardRef2.addEventListener("focusin", onFocusIn);
          forwardRef2.addEventListener("focusout", onFocusOut);
        }
        if (oldForwardRef) {
          oldForwardRef.removeEventListener("keydown", onKeydown);
          oldForwardRef.removeEventListener("focusin", onFocusIn);
          oldForwardRef.removeEventListener("focusout", onFocusOut);
        }
      });
      const trapOnFocus = (e) => {
        emit(ON_TRAP_FOCUS_EVT, e);
      };
      const releaseOnFocus = (e) => emit(ON_RELEASE_FOCUS_EVT, e);
      const onFocusIn = (e) => {
        const trapContainer = vue.unref(forwardRef);
        if (!trapContainer)
          return;
        const target = e.target;
        const relatedTarget = e.relatedTarget;
        const isFocusedInTrap = target && trapContainer.contains(target);
        if (!props.trapped) {
          const isPrevFocusedInTrap = relatedTarget && trapContainer.contains(relatedTarget);
          if (!isPrevFocusedInTrap) {
            lastFocusBeforeTrapped = relatedTarget;
          }
        }
        if (isFocusedInTrap)
          emit("focusin", e);
        if (focusLayer.paused)
          return;
        if (props.trapped) {
          if (isFocusedInTrap) {
            lastFocusAfterTrapped = target;
          } else {
            tryFocus(lastFocusAfterTrapped, true);
          }
        }
      };
      const onFocusOut = (e) => {
        const trapContainer = vue.unref(forwardRef);
        if (focusLayer.paused || !trapContainer)
          return;
        if (props.trapped) {
          const relatedTarget = e.relatedTarget;
          if (!isNil(relatedTarget) && !trapContainer.contains(relatedTarget)) {
            setTimeout(() => {
              if (!focusLayer.paused && props.trapped) {
                const focusoutPreventedEvent = createFocusOutPreventedEvent({
                  focusReason: focusReason2.value
                });
                emit("focusout-prevented", focusoutPreventedEvent);
                if (!focusoutPreventedEvent.defaultPrevented) {
                  tryFocus(lastFocusAfterTrapped, true);
                }
              }
            }, 0);
          }
        } else {
          const target = e.target;
          const isFocusedInTrap = target && trapContainer.contains(target);
          if (!isFocusedInTrap)
            emit("focusout", e);
        }
      };
      async function startTrap() {
        await vue.nextTick();
        const trapContainer = vue.unref(forwardRef);
        if (trapContainer) {
          focusableStack.push(focusLayer);
          const prevFocusedElement = trapContainer.contains(document.activeElement) ? lastFocusBeforeTrapped : document.activeElement;
          lastFocusBeforeTrapped = prevFocusedElement;
          const isPrevFocusContained = trapContainer.contains(prevFocusedElement);
          if (!isPrevFocusContained) {
            const focusEvent = new Event(FOCUS_AFTER_TRAPPED, FOCUS_AFTER_TRAPPED_OPTS);
            trapContainer.addEventListener(FOCUS_AFTER_TRAPPED, trapOnFocus);
            trapContainer.dispatchEvent(focusEvent);
            if (!focusEvent.defaultPrevented) {
              vue.nextTick(() => {
                let focusStartEl = props.focusStartEl;
                if (!isString(focusStartEl)) {
                  tryFocus(focusStartEl);
                  if (document.activeElement !== focusStartEl) {
                    focusStartEl = "first";
                  }
                }
                if (focusStartEl === "first") {
                  focusFirstDescendant(obtainAllFocusableElements(trapContainer), true);
                }
                if (document.activeElement === prevFocusedElement || focusStartEl === "container") {
                  tryFocus(trapContainer);
                }
              });
            }
          }
        }
      }
      function stopTrap() {
        const trapContainer = vue.unref(forwardRef);
        if (trapContainer) {
          trapContainer.removeEventListener(FOCUS_AFTER_TRAPPED, trapOnFocus);
          const releasedEvent = new CustomEvent(FOCUS_AFTER_RELEASED, {
            ...FOCUS_AFTER_TRAPPED_OPTS,
            detail: {
              focusReason: focusReason2.value
            }
          });
          trapContainer.addEventListener(FOCUS_AFTER_RELEASED, releaseOnFocus);
          trapContainer.dispatchEvent(releasedEvent);
          if (!releasedEvent.defaultPrevented && (focusReason2.value == "keyboard" || !isFocusCausedByUserEvent() || trapContainer.contains(document.activeElement))) {
            tryFocus(lastFocusBeforeTrapped != null ? lastFocusBeforeTrapped : document.body);
          }
          trapContainer.removeEventListener(FOCUS_AFTER_RELEASED, releaseOnFocus);
          focusableStack.remove(focusLayer);
        }
      }
      vue.onMounted(() => {
        if (props.trapped) {
          startTrap();
        }
        vue.watch(() => props.trapped, (trapped) => {
          if (trapped) {
            startTrap();
          } else {
            stopTrap();
          }
        });
      });
      vue.onBeforeUnmount(() => {
        if (props.trapped) {
          stopTrap();
        }
      });
      return {
        onKeydown
      };
    }
  });
  function _sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
    return vue.renderSlot(_ctx.$slots, "default", { handleKeydown: _ctx.onKeydown });
  }
  var ElFocusTrap = /* @__PURE__ */ _export_sfc$1(_sfc_main$8, [["render", _sfc_render], ["__file", "focus-trap.vue"]]);
  const badgeProps = buildProps({
    value: {
      type: [String, Number],
      default: ""
    },
    max: {
      type: Number,
      default: 99
    },
    isDot: Boolean,
    hidden: Boolean,
    type: {
      type: String,
      values: ["primary", "success", "warning", "info", "danger"],
      default: "danger"
    }
  });
  const _hoisted_1$5 = ["textContent"];
  const __default__$5 = vue.defineComponent({
    name: "ElBadge"
  });
  const _sfc_main$7 = /* @__PURE__ */ vue.defineComponent({
    ...__default__$5,
    props: badgeProps,
    setup(__props, { expose }) {
      const props = __props;
      const ns = useNamespace("badge");
      const content = vue.computed(() => {
        if (props.isDot)
          return "";
        if (isNumber(props.value) && isNumber(props.max)) {
          return props.max < props.value ? `${props.max}+` : `${props.value}`;
        }
        return `${props.value}`;
      });
      expose({
        content
      });
      return (_ctx, _cache) => {
        return vue.openBlock(), vue.createElementBlock("div", {
          class: vue.normalizeClass(vue.unref(ns).b())
        }, [
          vue.renderSlot(_ctx.$slots, "default"),
          vue.createVNode(vue.Transition, {
            name: `${vue.unref(ns).namespace.value}-zoom-in-center`,
            persisted: ""
          }, {
            default: vue.withCtx(() => [
              vue.withDirectives(vue.createElementVNode("sup", {
                class: vue.normalizeClass([
                  vue.unref(ns).e("content"),
                  vue.unref(ns).em("content", _ctx.type),
                  vue.unref(ns).is("fixed", !!_ctx.$slots.default),
                  vue.unref(ns).is("dot", _ctx.isDot)
                ]),
                textContent: vue.toDisplayString(vue.unref(content))
              }, null, 10, _hoisted_1$5), [
                [vue.vShow, !_ctx.hidden && (vue.unref(content) || _ctx.isDot)]
              ])
            ]),
            _: 1
          }, 8, ["name"])
        ], 2);
      };
    }
  });
  var Badge = /* @__PURE__ */ _export_sfc$1(_sfc_main$7, [["__file", "badge.vue"]]);
  const ElBadge = withInstall(Badge);
  const buttonGroupContextKey = Symbol("buttonGroupContextKey");
  const useButton = (props, emit) => {
    useDeprecated({
      from: "type.text",
      replacement: "link",
      version: "3.0.0",
      scope: "props",
      ref: "https://element-plus.org/en-US/component/button.html#button-attributes"
    }, vue.computed(() => props.type === "text"));
    const buttonGroupContext = vue.inject(buttonGroupContextKey, void 0);
    const globalConfig2 = useGlobalConfig("button");
    const { form } = useFormItem();
    const _size = useFormSize(vue.computed(() => buttonGroupContext == null ? void 0 : buttonGroupContext.size));
    const _disabled = useFormDisabled();
    const _ref = vue.ref();
    const slots = vue.useSlots();
    const _type = vue.computed(() => props.type || (buttonGroupContext == null ? void 0 : buttonGroupContext.type) || "");
    const autoInsertSpace = vue.computed(() => {
      var _a2, _b, _c;
      return (_c = (_b = props.autoInsertSpace) != null ? _b : (_a2 = globalConfig2.value) == null ? void 0 : _a2.autoInsertSpace) != null ? _c : false;
    });
    const _props = vue.computed(() => {
      if (props.tag === "button") {
        return {
          ariaDisabled: _disabled.value || props.loading,
          disabled: _disabled.value || props.loading,
          autofocus: props.autofocus,
          type: props.nativeType
        };
      }
      return {};
    });
    const shouldAddSpace = vue.computed(() => {
      var _a2;
      const defaultSlot = (_a2 = slots.default) == null ? void 0 : _a2.call(slots);
      if (autoInsertSpace.value && (defaultSlot == null ? void 0 : defaultSlot.length) === 1) {
        const slot = defaultSlot[0];
        if ((slot == null ? void 0 : slot.type) === vue.Text) {
          const text = slot.children;
          return /^\p{Unified_Ideograph}{2}$/u.test(text.trim());
        }
      }
      return false;
    });
    const handleClick = (evt) => {
      if (props.nativeType === "reset") {
        form == null ? void 0 : form.resetFields();
      }
      emit("click", evt);
    };
    return {
      _disabled,
      _size,
      _type,
      _ref,
      _props,
      shouldAddSpace,
      handleClick
    };
  };
  const buttonTypes = [
    "default",
    "primary",
    "success",
    "warning",
    "info",
    "danger",
    "text",
    ""
  ];
  const buttonNativeTypes = ["button", "submit", "reset"];
  const buttonProps = buildProps({
    size: useSizeProp,
    disabled: Boolean,
    type: {
      type: String,
      values: buttonTypes,
      default: ""
    },
    icon: {
      type: iconPropType
    },
    nativeType: {
      type: String,
      values: buttonNativeTypes,
      default: "button"
    },
    loading: Boolean,
    loadingIcon: {
      type: iconPropType,
      default: () => loading_default
    },
    plain: Boolean,
    text: Boolean,
    link: Boolean,
    bg: Boolean,
    autofocus: Boolean,
    round: Boolean,
    circle: Boolean,
    color: String,
    dark: Boolean,
    autoInsertSpace: {
      type: Boolean,
      default: void 0
    },
    tag: {
      type: definePropType([String, Object]),
      default: "button"
    }
  });
  const buttonEmits = {
    click: (evt) => evt instanceof MouseEvent
  };
  function bound01(n, max) {
    if (isOnePointZero(n)) {
      n = "100%";
    }
    var isPercent = isPercentage(n);
    n = max === 360 ? n : Math.min(max, Math.max(0, parseFloat(n)));
    if (isPercent) {
      n = parseInt(String(n * max), 10) / 100;
    }
    if (Math.abs(n - max) < 1e-6) {
      return 1;
    }
    if (max === 360) {
      n = (n < 0 ? n % max + max : n % max) / parseFloat(String(max));
    } else {
      n = n % max / parseFloat(String(max));
    }
    return n;
  }
  function clamp01(val) {
    return Math.min(1, Math.max(0, val));
  }
  function isOnePointZero(n) {
    return typeof n === "string" && n.indexOf(".") !== -1 && parseFloat(n) === 1;
  }
  function isPercentage(n) {
    return typeof n === "string" && n.indexOf("%") !== -1;
  }
  function boundAlpha(a) {
    a = parseFloat(a);
    if (isNaN(a) || a < 0 || a > 1) {
      a = 1;
    }
    return a;
  }
  function convertToPercentage(n) {
    if (n <= 1) {
      return "".concat(Number(n) * 100, "%");
    }
    return n;
  }
  function pad2(c) {
    return c.length === 1 ? "0" + c : String(c);
  }
  function rgbToRgb(r, g, b) {
    return {
      r: bound01(r, 255) * 255,
      g: bound01(g, 255) * 255,
      b: bound01(b, 255) * 255
    };
  }
  function rgbToHsl(r, g, b) {
    r = bound01(r, 255);
    g = bound01(g, 255);
    b = bound01(b, 255);
    var max = Math.max(r, g, b);
    var min = Math.min(r, g, b);
    var h2 = 0;
    var s = 0;
    var l = (max + min) / 2;
    if (max === min) {
      s = 0;
      h2 = 0;
    } else {
      var d = max - min;
      s = l > 0.5 ? d / (2 - max - min) : d / (max + min);
      switch (max) {
        case r:
          h2 = (g - b) / d + (g < b ? 6 : 0);
          break;
        case g:
          h2 = (b - r) / d + 2;
          break;
        case b:
          h2 = (r - g) / d + 4;
          break;
      }
      h2 /= 6;
    }
    return { h: h2, s, l };
  }
  function hue2rgb(p, q, t) {
    if (t < 0) {
      t += 1;
    }
    if (t > 1) {
      t -= 1;
    }
    if (t < 1 / 6) {
      return p + (q - p) * (6 * t);
    }
    if (t < 1 / 2) {
      return q;
    }
    if (t < 2 / 3) {
      return p + (q - p) * (2 / 3 - t) * 6;
    }
    return p;
  }
  function hslToRgb(h2, s, l) {
    var r;
    var g;
    var b;
    h2 = bound01(h2, 360);
    s = bound01(s, 100);
    l = bound01(l, 100);
    if (s === 0) {
      g = l;
      b = l;
      r = l;
    } else {
      var q = l < 0.5 ? l * (1 + s) : l + s - l * s;
      var p = 2 * l - q;
      r = hue2rgb(p, q, h2 + 1 / 3);
      g = hue2rgb(p, q, h2);
      b = hue2rgb(p, q, h2 - 1 / 3);
    }
    return { r: r * 255, g: g * 255, b: b * 255 };
  }
  function rgbToHsv(r, g, b) {
    r = bound01(r, 255);
    g = bound01(g, 255);
    b = bound01(b, 255);
    var max = Math.max(r, g, b);
    var min = Math.min(r, g, b);
    var h2 = 0;
    var v = max;
    var d = max - min;
    var s = max === 0 ? 0 : d / max;
    if (max === min) {
      h2 = 0;
    } else {
      switch (max) {
        case r:
          h2 = (g - b) / d + (g < b ? 6 : 0);
          break;
        case g:
          h2 = (b - r) / d + 2;
          break;
        case b:
          h2 = (r - g) / d + 4;
          break;
      }
      h2 /= 6;
    }
    return { h: h2, s, v };
  }
  function hsvToRgb(h2, s, v) {
    h2 = bound01(h2, 360) * 6;
    s = bound01(s, 100);
    v = bound01(v, 100);
    var i = Math.floor(h2);
    var f = h2 - i;
    var p = v * (1 - s);
    var q = v * (1 - f * s);
    var t = v * (1 - (1 - f) * s);
    var mod = i % 6;
    var r = [v, q, p, p, t, v][mod];
    var g = [t, v, v, q, p, p][mod];
    var b = [p, p, t, v, v, q][mod];
    return { r: r * 255, g: g * 255, b: b * 255 };
  }
  function rgbToHex(r, g, b, allow3Char) {
    var hex = [
      pad2(Math.round(r).toString(16)),
      pad2(Math.round(g).toString(16)),
      pad2(Math.round(b).toString(16))
    ];
    if (allow3Char && hex[0].startsWith(hex[0].charAt(1)) && hex[1].startsWith(hex[1].charAt(1)) && hex[2].startsWith(hex[2].charAt(1))) {
      return hex[0].charAt(0) + hex[1].charAt(0) + hex[2].charAt(0);
    }
    return hex.join("");
  }
  function rgbaToHex(r, g, b, a, allow4Char) {
    var hex = [
      pad2(Math.round(r).toString(16)),
      pad2(Math.round(g).toString(16)),
      pad2(Math.round(b).toString(16)),
      pad2(convertDecimalToHex(a))
    ];
    if (allow4Char && hex[0].startsWith(hex[0].charAt(1)) && hex[1].startsWith(hex[1].charAt(1)) && hex[2].startsWith(hex[2].charAt(1)) && hex[3].startsWith(hex[3].charAt(1))) {
      return hex[0].charAt(0) + hex[1].charAt(0) + hex[2].charAt(0) + hex[3].charAt(0);
    }
    return hex.join("");
  }
  function convertDecimalToHex(d) {
    return Math.round(parseFloat(d) * 255).toString(16);
  }
  function convertHexToDecimal(h2) {
    return parseIntFromHex(h2) / 255;
  }
  function parseIntFromHex(val) {
    return parseInt(val, 16);
  }
  function numberInputToObject(color) {
    return {
      r: color >> 16,
      g: (color & 65280) >> 8,
      b: color & 255
    };
  }
  var names = {
    aliceblue: "#f0f8ff",
    antiquewhite: "#faebd7",
    aqua: "#00ffff",
    aquamarine: "#7fffd4",
    azure: "#f0ffff",
    beige: "#f5f5dc",
    bisque: "#ffe4c4",
    black: "#000000",
    blanchedalmond: "#ffebcd",
    blue: "#0000ff",
    blueviolet: "#8a2be2",
    brown: "#a52a2a",
    burlywood: "#deb887",
    cadetblue: "#5f9ea0",
    chartreuse: "#7fff00",
    chocolate: "#d2691e",
    coral: "#ff7f50",
    cornflowerblue: "#6495ed",
    cornsilk: "#fff8dc",
    crimson: "#dc143c",
    cyan: "#00ffff",
    darkblue: "#00008b",
    darkcyan: "#008b8b",
    darkgoldenrod: "#b8860b",
    darkgray: "#a9a9a9",
    darkgreen: "#006400",
    darkgrey: "#a9a9a9",
    darkkhaki: "#bdb76b",
    darkmagenta: "#8b008b",
    darkolivegreen: "#556b2f",
    darkorange: "#ff8c00",
    darkorchid: "#9932cc",
    darkred: "#8b0000",
    darksalmon: "#e9967a",
    darkseagreen: "#8fbc8f",
    darkslateblue: "#483d8b",
    darkslategray: "#2f4f4f",
    darkslategrey: "#2f4f4f",
    darkturquoise: "#00ced1",
    darkviolet: "#9400d3",
    deeppink: "#ff1493",
    deepskyblue: "#00bfff",
    dimgray: "#696969",
    dimgrey: "#696969",
    dodgerblue: "#1e90ff",
    firebrick: "#b22222",
    floralwhite: "#fffaf0",
    forestgreen: "#228b22",
    fuchsia: "#ff00ff",
    gainsboro: "#dcdcdc",
    ghostwhite: "#f8f8ff",
    goldenrod: "#daa520",
    gold: "#ffd700",
    gray: "#808080",
    green: "#008000",
    greenyellow: "#adff2f",
    grey: "#808080",
    honeydew: "#f0fff0",
    hotpink: "#ff69b4",
    indianred: "#cd5c5c",
    indigo: "#4b0082",
    ivory: "#fffff0",
    khaki: "#f0e68c",
    lavenderblush: "#fff0f5",
    lavender: "#e6e6fa",
    lawngreen: "#7cfc00",
    lemonchiffon: "#fffacd",
    lightblue: "#add8e6",
    lightcoral: "#f08080",
    lightcyan: "#e0ffff",
    lightgoldenrodyellow: "#fafad2",
    lightgray: "#d3d3d3",
    lightgreen: "#90ee90",
    lightgrey: "#d3d3d3",
    lightpink: "#ffb6c1",
    lightsalmon: "#ffa07a",
    lightseagreen: "#20b2aa",
    lightskyblue: "#87cefa",
    lightslategray: "#778899",
    lightslategrey: "#778899",
    lightsteelblue: "#b0c4de",
    lightyellow: "#ffffe0",
    lime: "#00ff00",
    limegreen: "#32cd32",
    linen: "#faf0e6",
    magenta: "#ff00ff",
    maroon: "#800000",
    mediumaquamarine: "#66cdaa",
    mediumblue: "#0000cd",
    mediumorchid: "#ba55d3",
    mediumpurple: "#9370db",
    mediumseagreen: "#3cb371",
    mediumslateblue: "#7b68ee",
    mediumspringgreen: "#00fa9a",
    mediumturquoise: "#48d1cc",
    mediumvioletred: "#c71585",
    midnightblue: "#191970",
    mintcream: "#f5fffa",
    mistyrose: "#ffe4e1",
    moccasin: "#ffe4b5",
    navajowhite: "#ffdead",
    navy: "#000080",
    oldlace: "#fdf5e6",
    olive: "#808000",
    olivedrab: "#6b8e23",
    orange: "#ffa500",
    orangered: "#ff4500",
    orchid: "#da70d6",
    palegoldenrod: "#eee8aa",
    palegreen: "#98fb98",
    paleturquoise: "#afeeee",
    palevioletred: "#db7093",
    papayawhip: "#ffefd5",
    peachpuff: "#ffdab9",
    peru: "#cd853f",
    pink: "#ffc0cb",
    plum: "#dda0dd",
    powderblue: "#b0e0e6",
    purple: "#800080",
    rebeccapurple: "#663399",
    red: "#ff0000",
    rosybrown: "#bc8f8f",
    royalblue: "#4169e1",
    saddlebrown: "#8b4513",
    salmon: "#fa8072",
    sandybrown: "#f4a460",
    seagreen: "#2e8b57",
    seashell: "#fff5ee",
    sienna: "#a0522d",
    silver: "#c0c0c0",
    skyblue: "#87ceeb",
    slateblue: "#6a5acd",
    slategray: "#708090",
    slategrey: "#708090",
    snow: "#fffafa",
    springgreen: "#00ff7f",
    steelblue: "#4682b4",
    tan: "#d2b48c",
    teal: "#008080",
    thistle: "#d8bfd8",
    tomato: "#ff6347",
    turquoise: "#40e0d0",
    violet: "#ee82ee",
    wheat: "#f5deb3",
    white: "#ffffff",
    whitesmoke: "#f5f5f5",
    yellow: "#ffff00",
    yellowgreen: "#9acd32"
  };
  function inputToRGB(color) {
    var rgb = { r: 0, g: 0, b: 0 };
    var a = 1;
    var s = null;
    var v = null;
    var l = null;
    var ok = false;
    var format = false;
    if (typeof color === "string") {
      color = stringInputToObject(color);
    }
    if (typeof color === "object") {
      if (isValidCSSUnit(color.r) && isValidCSSUnit(color.g) && isValidCSSUnit(color.b)) {
        rgb = rgbToRgb(color.r, color.g, color.b);
        ok = true;
        format = String(color.r).substr(-1) === "%" ? "prgb" : "rgb";
      } else if (isValidCSSUnit(color.h) && isValidCSSUnit(color.s) && isValidCSSUnit(color.v)) {
        s = convertToPercentage(color.s);
        v = convertToPercentage(color.v);
        rgb = hsvToRgb(color.h, s, v);
        ok = true;
        format = "hsv";
      } else if (isValidCSSUnit(color.h) && isValidCSSUnit(color.s) && isValidCSSUnit(color.l)) {
        s = convertToPercentage(color.s);
        l = convertToPercentage(color.l);
        rgb = hslToRgb(color.h, s, l);
        ok = true;
        format = "hsl";
      }
      if (Object.prototype.hasOwnProperty.call(color, "a")) {
        a = color.a;
      }
    }
    a = boundAlpha(a);
    return {
      ok,
      format: color.format || format,
      r: Math.min(255, Math.max(rgb.r, 0)),
      g: Math.min(255, Math.max(rgb.g, 0)),
      b: Math.min(255, Math.max(rgb.b, 0)),
      a
    };
  }
  var CSS_INTEGER = "[-\\+]?\\d+%?";
  var CSS_NUMBER = "[-\\+]?\\d*\\.\\d+%?";
  var CSS_UNIT = "(?:".concat(CSS_NUMBER, ")|(?:").concat(CSS_INTEGER, ")");
  var PERMISSIVE_MATCH3 = "[\\s|\\(]+(".concat(CSS_UNIT, ")[,|\\s]+(").concat(CSS_UNIT, ")[,|\\s]+(").concat(CSS_UNIT, ")\\s*\\)?");
  var PERMISSIVE_MATCH4 = "[\\s|\\(]+(".concat(CSS_UNIT, ")[,|\\s]+(").concat(CSS_UNIT, ")[,|\\s]+(").concat(CSS_UNIT, ")[,|\\s]+(").concat(CSS_UNIT, ")\\s*\\)?");
  var matchers = {
    CSS_UNIT: new RegExp(CSS_UNIT),
    rgb: new RegExp("rgb" + PERMISSIVE_MATCH3),
    rgba: new RegExp("rgba" + PERMISSIVE_MATCH4),
    hsl: new RegExp("hsl" + PERMISSIVE_MATCH3),
    hsla: new RegExp("hsla" + PERMISSIVE_MATCH4),
    hsv: new RegExp("hsv" + PERMISSIVE_MATCH3),
    hsva: new RegExp("hsva" + PERMISSIVE_MATCH4),
    hex3: /^#?([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/,
    hex6: /^#?([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})$/,
    hex4: /^#?([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/,
    hex8: /^#?([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})$/
  };
  function stringInputToObject(color) {
    color = color.trim().toLowerCase();
    if (color.length === 0) {
      return false;
    }
    var named = false;
    if (names[color]) {
      color = names[color];
      named = true;
    } else if (color === "transparent") {
      return { r: 0, g: 0, b: 0, a: 0, format: "name" };
    }
    var match = matchers.rgb.exec(color);
    if (match) {
      return { r: match[1], g: match[2], b: match[3] };
    }
    match = matchers.rgba.exec(color);
    if (match) {
      return { r: match[1], g: match[2], b: match[3], a: match[4] };
    }
    match = matchers.hsl.exec(color);
    if (match) {
      return { h: match[1], s: match[2], l: match[3] };
    }
    match = matchers.hsla.exec(color);
    if (match) {
      return { h: match[1], s: match[2], l: match[3], a: match[4] };
    }
    match = matchers.hsv.exec(color);
    if (match) {
      return { h: match[1], s: match[2], v: match[3] };
    }
    match = matchers.hsva.exec(color);
    if (match) {
      return { h: match[1], s: match[2], v: match[3], a: match[4] };
    }
    match = matchers.hex8.exec(color);
    if (match) {
      return {
        r: parseIntFromHex(match[1]),
        g: parseIntFromHex(match[2]),
        b: parseIntFromHex(match[3]),
        a: convertHexToDecimal(match[4]),
        format: named ? "name" : "hex8"
      };
    }
    match = matchers.hex6.exec(color);
    if (match) {
      return {
        r: parseIntFromHex(match[1]),
        g: parseIntFromHex(match[2]),
        b: parseIntFromHex(match[3]),
        format: named ? "name" : "hex"
      };
    }
    match = matchers.hex4.exec(color);
    if (match) {
      return {
        r: parseIntFromHex(match[1] + match[1]),
        g: parseIntFromHex(match[2] + match[2]),
        b: parseIntFromHex(match[3] + match[3]),
        a: convertHexToDecimal(match[4] + match[4]),
        format: named ? "name" : "hex8"
      };
    }
    match = matchers.hex3.exec(color);
    if (match) {
      return {
        r: parseIntFromHex(match[1] + match[1]),
        g: parseIntFromHex(match[2] + match[2]),
        b: parseIntFromHex(match[3] + match[3]),
        format: named ? "name" : "hex"
      };
    }
    return false;
  }
  function isValidCSSUnit(color) {
    return Boolean(matchers.CSS_UNIT.exec(String(color)));
  }
  var TinyColor = (
    /** @class */
    function() {
      function TinyColor2(color, opts) {
        if (color === void 0) {
          color = "";
        }
        if (opts === void 0) {
          opts = {};
        }
        var _a2;
        if (color instanceof TinyColor2) {
          return color;
        }
        if (typeof color === "number") {
          color = numberInputToObject(color);
        }
        this.originalInput = color;
        var rgb = inputToRGB(color);
        this.originalInput = color;
        this.r = rgb.r;
        this.g = rgb.g;
        this.b = rgb.b;
        this.a = rgb.a;
        this.roundA = Math.round(100 * this.a) / 100;
        this.format = (_a2 = opts.format) !== null && _a2 !== void 0 ? _a2 : rgb.format;
        this.gradientType = opts.gradientType;
        if (this.r < 1) {
          this.r = Math.round(this.r);
        }
        if (this.g < 1) {
          this.g = Math.round(this.g);
        }
        if (this.b < 1) {
          this.b = Math.round(this.b);
        }
        this.isValid = rgb.ok;
      }
      TinyColor2.prototype.isDark = function() {
        return this.getBrightness() < 128;
      };
      TinyColor2.prototype.isLight = function() {
        return !this.isDark();
      };
      TinyColor2.prototype.getBrightness = function() {
        var rgb = this.toRgb();
        return (rgb.r * 299 + rgb.g * 587 + rgb.b * 114) / 1e3;
      };
      TinyColor2.prototype.getLuminance = function() {
        var rgb = this.toRgb();
        var R;
        var G;
        var B;
        var RsRGB = rgb.r / 255;
        var GsRGB = rgb.g / 255;
        var BsRGB = rgb.b / 255;
        if (RsRGB <= 0.03928) {
          R = RsRGB / 12.92;
        } else {
          R = Math.pow((RsRGB + 0.055) / 1.055, 2.4);
        }
        if (GsRGB <= 0.03928) {
          G = GsRGB / 12.92;
        } else {
          G = Math.pow((GsRGB + 0.055) / 1.055, 2.4);
        }
        if (BsRGB <= 0.03928) {
          B = BsRGB / 12.92;
        } else {
          B = Math.pow((BsRGB + 0.055) / 1.055, 2.4);
        }
        return 0.2126 * R + 0.7152 * G + 0.0722 * B;
      };
      TinyColor2.prototype.getAlpha = function() {
        return this.a;
      };
      TinyColor2.prototype.setAlpha = function(alpha) {
        this.a = boundAlpha(alpha);
        this.roundA = Math.round(100 * this.a) / 100;
        return this;
      };
      TinyColor2.prototype.isMonochrome = function() {
        var s = this.toHsl().s;
        return s === 0;
      };
      TinyColor2.prototype.toHsv = function() {
        var hsv = rgbToHsv(this.r, this.g, this.b);
        return { h: hsv.h * 360, s: hsv.s, v: hsv.v, a: this.a };
      };
      TinyColor2.prototype.toHsvString = function() {
        var hsv = rgbToHsv(this.r, this.g, this.b);
        var h2 = Math.round(hsv.h * 360);
        var s = Math.round(hsv.s * 100);
        var v = Math.round(hsv.v * 100);
        return this.a === 1 ? "hsv(".concat(h2, ", ").concat(s, "%, ").concat(v, "%)") : "hsva(".concat(h2, ", ").concat(s, "%, ").concat(v, "%, ").concat(this.roundA, ")");
      };
      TinyColor2.prototype.toHsl = function() {
        var hsl = rgbToHsl(this.r, this.g, this.b);
        return { h: hsl.h * 360, s: hsl.s, l: hsl.l, a: this.a };
      };
      TinyColor2.prototype.toHslString = function() {
        var hsl = rgbToHsl(this.r, this.g, this.b);
        var h2 = Math.round(hsl.h * 360);
        var s = Math.round(hsl.s * 100);
        var l = Math.round(hsl.l * 100);
        return this.a === 1 ? "hsl(".concat(h2, ", ").concat(s, "%, ").concat(l, "%)") : "hsla(".concat(h2, ", ").concat(s, "%, ").concat(l, "%, ").concat(this.roundA, ")");
      };
      TinyColor2.prototype.toHex = function(allow3Char) {
        if (allow3Char === void 0) {
          allow3Char = false;
        }
        return rgbToHex(this.r, this.g, this.b, allow3Char);
      };
      TinyColor2.prototype.toHexString = function(allow3Char) {
        if (allow3Char === void 0) {
          allow3Char = false;
        }
        return "#" + this.toHex(allow3Char);
      };
      TinyColor2.prototype.toHex8 = function(allow4Char) {
        if (allow4Char === void 0) {
          allow4Char = false;
        }
        return rgbaToHex(this.r, this.g, this.b, this.a, allow4Char);
      };
      TinyColor2.prototype.toHex8String = function(allow4Char) {
        if (allow4Char === void 0) {
          allow4Char = false;
        }
        return "#" + this.toHex8(allow4Char);
      };
      TinyColor2.prototype.toHexShortString = function(allowShortChar) {
        if (allowShortChar === void 0) {
          allowShortChar = false;
        }
        return this.a === 1 ? this.toHexString(allowShortChar) : this.toHex8String(allowShortChar);
      };
      TinyColor2.prototype.toRgb = function() {
        return {
          r: Math.round(this.r),
          g: Math.round(this.g),
          b: Math.round(this.b),
          a: this.a
        };
      };
      TinyColor2.prototype.toRgbString = function() {
        var r = Math.round(this.r);
        var g = Math.round(this.g);
        var b = Math.round(this.b);
        return this.a === 1 ? "rgb(".concat(r, ", ").concat(g, ", ").concat(b, ")") : "rgba(".concat(r, ", ").concat(g, ", ").concat(b, ", ").concat(this.roundA, ")");
      };
      TinyColor2.prototype.toPercentageRgb = function() {
        var fmt = function(x) {
          return "".concat(Math.round(bound01(x, 255) * 100), "%");
        };
        return {
          r: fmt(this.r),
          g: fmt(this.g),
          b: fmt(this.b),
          a: this.a
        };
      };
      TinyColor2.prototype.toPercentageRgbString = function() {
        var rnd = function(x) {
          return Math.round(bound01(x, 255) * 100);
        };
        return this.a === 1 ? "rgb(".concat(rnd(this.r), "%, ").concat(rnd(this.g), "%, ").concat(rnd(this.b), "%)") : "rgba(".concat(rnd(this.r), "%, ").concat(rnd(this.g), "%, ").concat(rnd(this.b), "%, ").concat(this.roundA, ")");
      };
      TinyColor2.prototype.toName = function() {
        if (this.a === 0) {
          return "transparent";
        }
        if (this.a < 1) {
          return false;
        }
        var hex = "#" + rgbToHex(this.r, this.g, this.b, false);
        for (var _i = 0, _a2 = Object.entries(names); _i < _a2.length; _i++) {
          var _b = _a2[_i], key = _b[0], value = _b[1];
          if (hex === value) {
            return key;
          }
        }
        return false;
      };
      TinyColor2.prototype.toString = function(format) {
        var formatSet = Boolean(format);
        format = format !== null && format !== void 0 ? format : this.format;
        var formattedString = false;
        var hasAlpha = this.a < 1 && this.a >= 0;
        var needsAlphaFormat = !formatSet && hasAlpha && (format.startsWith("hex") || format === "name");
        if (needsAlphaFormat) {
          if (format === "name" && this.a === 0) {
            return this.toName();
          }
          return this.toRgbString();
        }
        if (format === "rgb") {
          formattedString = this.toRgbString();
        }
        if (format === "prgb") {
          formattedString = this.toPercentageRgbString();
        }
        if (format === "hex" || format === "hex6") {
          formattedString = this.toHexString();
        }
        if (format === "hex3") {
          formattedString = this.toHexString(true);
        }
        if (format === "hex4") {
          formattedString = this.toHex8String(true);
        }
        if (format === "hex8") {
          formattedString = this.toHex8String();
        }
        if (format === "name") {
          formattedString = this.toName();
        }
        if (format === "hsl") {
          formattedString = this.toHslString();
        }
        if (format === "hsv") {
          formattedString = this.toHsvString();
        }
        return formattedString || this.toHexString();
      };
      TinyColor2.prototype.toNumber = function() {
        return (Math.round(this.r) << 16) + (Math.round(this.g) << 8) + Math.round(this.b);
      };
      TinyColor2.prototype.clone = function() {
        return new TinyColor2(this.toString());
      };
      TinyColor2.prototype.lighten = function(amount) {
        if (amount === void 0) {
          amount = 10;
        }
        var hsl = this.toHsl();
        hsl.l += amount / 100;
        hsl.l = clamp01(hsl.l);
        return new TinyColor2(hsl);
      };
      TinyColor2.prototype.brighten = function(amount) {
        if (amount === void 0) {
          amount = 10;
        }
        var rgb = this.toRgb();
        rgb.r = Math.max(0, Math.min(255, rgb.r - Math.round(255 * -(amount / 100))));
        rgb.g = Math.max(0, Math.min(255, rgb.g - Math.round(255 * -(amount / 100))));
        rgb.b = Math.max(0, Math.min(255, rgb.b - Math.round(255 * -(amount / 100))));
        return new TinyColor2(rgb);
      };
      TinyColor2.prototype.darken = function(amount) {
        if (amount === void 0) {
          amount = 10;
        }
        var hsl = this.toHsl();
        hsl.l -= amount / 100;
        hsl.l = clamp01(hsl.l);
        return new TinyColor2(hsl);
      };
      TinyColor2.prototype.tint = function(amount) {
        if (amount === void 0) {
          amount = 10;
        }
        return this.mix("white", amount);
      };
      TinyColor2.prototype.shade = function(amount) {
        if (amount === void 0) {
          amount = 10;
        }
        return this.mix("black", amount);
      };
      TinyColor2.prototype.desaturate = function(amount) {
        if (amount === void 0) {
          amount = 10;
        }
        var hsl = this.toHsl();
        hsl.s -= amount / 100;
        hsl.s = clamp01(hsl.s);
        return new TinyColor2(hsl);
      };
      TinyColor2.prototype.saturate = function(amount) {
        if (amount === void 0) {
          amount = 10;
        }
        var hsl = this.toHsl();
        hsl.s += amount / 100;
        hsl.s = clamp01(hsl.s);
        return new TinyColor2(hsl);
      };
      TinyColor2.prototype.greyscale = function() {
        return this.desaturate(100);
      };
      TinyColor2.prototype.spin = function(amount) {
        var hsl = this.toHsl();
        var hue = (hsl.h + amount) % 360;
        hsl.h = hue < 0 ? 360 + hue : hue;
        return new TinyColor2(hsl);
      };
      TinyColor2.prototype.mix = function(color, amount) {
        if (amount === void 0) {
          amount = 50;
        }
        var rgb1 = this.toRgb();
        var rgb2 = new TinyColor2(color).toRgb();
        var p = amount / 100;
        var rgba = {
          r: (rgb2.r - rgb1.r) * p + rgb1.r,
          g: (rgb2.g - rgb1.g) * p + rgb1.g,
          b: (rgb2.b - rgb1.b) * p + rgb1.b,
          a: (rgb2.a - rgb1.a) * p + rgb1.a
        };
        return new TinyColor2(rgba);
      };
      TinyColor2.prototype.analogous = function(results, slices) {
        if (results === void 0) {
          results = 6;
        }
        if (slices === void 0) {
          slices = 30;
        }
        var hsl = this.toHsl();
        var part = 360 / slices;
        var ret = [this];
        for (hsl.h = (hsl.h - (part * results >> 1) + 720) % 360; --results; ) {
          hsl.h = (hsl.h + part) % 360;
          ret.push(new TinyColor2(hsl));
        }
        return ret;
      };
      TinyColor2.prototype.complement = function() {
        var hsl = this.toHsl();
        hsl.h = (hsl.h + 180) % 360;
        return new TinyColor2(hsl);
      };
      TinyColor2.prototype.monochromatic = function(results) {
        if (results === void 0) {
          results = 6;
        }
        var hsv = this.toHsv();
        var h2 = hsv.h;
        var s = hsv.s;
        var v = hsv.v;
        var res = [];
        var modification = 1 / results;
        while (results--) {
          res.push(new TinyColor2({ h: h2, s, v }));
          v = (v + modification) % 1;
        }
        return res;
      };
      TinyColor2.prototype.splitcomplement = function() {
        var hsl = this.toHsl();
        var h2 = hsl.h;
        return [
          this,
          new TinyColor2({ h: (h2 + 72) % 360, s: hsl.s, l: hsl.l }),
          new TinyColor2({ h: (h2 + 216) % 360, s: hsl.s, l: hsl.l })
        ];
      };
      TinyColor2.prototype.onBackground = function(background) {
        var fg = this.toRgb();
        var bg = new TinyColor2(background).toRgb();
        var alpha = fg.a + bg.a * (1 - fg.a);
        return new TinyColor2({
          r: (fg.r * fg.a + bg.r * bg.a * (1 - fg.a)) / alpha,
          g: (fg.g * fg.a + bg.g * bg.a * (1 - fg.a)) / alpha,
          b: (fg.b * fg.a + bg.b * bg.a * (1 - fg.a)) / alpha,
          a: alpha
        });
      };
      TinyColor2.prototype.triad = function() {
        return this.polyad(3);
      };
      TinyColor2.prototype.tetrad = function() {
        return this.polyad(4);
      };
      TinyColor2.prototype.polyad = function(n) {
        var hsl = this.toHsl();
        var h2 = hsl.h;
        var result = [this];
        var increment = 360 / n;
        for (var i = 1; i < n; i++) {
          result.push(new TinyColor2({ h: (h2 + i * increment) % 360, s: hsl.s, l: hsl.l }));
        }
        return result;
      };
      TinyColor2.prototype.equals = function(color) {
        return this.toRgbString() === new TinyColor2(color).toRgbString();
      };
      return TinyColor2;
    }()
  );
  function darken(color, amount = 20) {
    return color.mix("#141414", amount).toString();
  }
  function useButtonCustomStyle(props) {
    const _disabled = useFormDisabled();
    const ns = useNamespace("button");
    return vue.computed(() => {
      let styles = {};
      const buttonColor = props.color;
      if (buttonColor) {
        const color = new TinyColor(buttonColor);
        const activeBgColor = props.dark ? color.tint(20).toString() : darken(color, 20);
        if (props.plain) {
          styles = ns.cssVarBlock({
            "bg-color": props.dark ? darken(color, 90) : color.tint(90).toString(),
            "text-color": buttonColor,
            "border-color": props.dark ? darken(color, 50) : color.tint(50).toString(),
            "hover-text-color": `var(${ns.cssVarName("color-white")})`,
            "hover-bg-color": buttonColor,
            "hover-border-color": buttonColor,
            "active-bg-color": activeBgColor,
            "active-text-color": `var(${ns.cssVarName("color-white")})`,
            "active-border-color": activeBgColor
          });
          if (_disabled.value) {
            styles[ns.cssVarBlockName("disabled-bg-color")] = props.dark ? darken(color, 90) : color.tint(90).toString();
            styles[ns.cssVarBlockName("disabled-text-color")] = props.dark ? darken(color, 50) : color.tint(50).toString();
            styles[ns.cssVarBlockName("disabled-border-color")] = props.dark ? darken(color, 80) : color.tint(80).toString();
          }
        } else {
          const hoverBgColor = props.dark ? darken(color, 30) : color.tint(30).toString();
          const textColor = color.isDark() ? `var(${ns.cssVarName("color-white")})` : `var(${ns.cssVarName("color-black")})`;
          styles = ns.cssVarBlock({
            "bg-color": buttonColor,
            "text-color": textColor,
            "border-color": buttonColor,
            "hover-bg-color": hoverBgColor,
            "hover-text-color": textColor,
            "hover-border-color": hoverBgColor,
            "active-bg-color": activeBgColor,
            "active-border-color": activeBgColor
          });
          if (_disabled.value) {
            const disabledButtonColor = props.dark ? darken(color, 50) : color.tint(50).toString();
            styles[ns.cssVarBlockName("disabled-bg-color")] = disabledButtonColor;
            styles[ns.cssVarBlockName("disabled-text-color")] = props.dark ? "rgba(255, 255, 255, 0.5)" : `var(${ns.cssVarName("color-white")})`;
            styles[ns.cssVarBlockName("disabled-border-color")] = disabledButtonColor;
          }
        }
      }
      return styles;
    });
  }
  const __default__$4 = vue.defineComponent({
    name: "ElButton"
  });
  const _sfc_main$6 = /* @__PURE__ */ vue.defineComponent({
    ...__default__$4,
    props: buttonProps,
    emits: buttonEmits,
    setup(__props, { expose, emit }) {
      const props = __props;
      const buttonStyle = useButtonCustomStyle(props);
      const ns = useNamespace("button");
      const { _ref, _size, _type, _disabled, _props, shouldAddSpace, handleClick } = useButton(props, emit);
      expose({
        ref: _ref,
        size: _size,
        type: _type,
        disabled: _disabled,
        shouldAddSpace
      });
      return (_ctx, _cache) => {
        return vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(_ctx.tag), vue.mergeProps({
          ref_key: "_ref",
          ref: _ref
        }, vue.unref(_props), {
          class: [
            vue.unref(ns).b(),
            vue.unref(ns).m(vue.unref(_type)),
            vue.unref(ns).m(vue.unref(_size)),
            vue.unref(ns).is("disabled", vue.unref(_disabled)),
            vue.unref(ns).is("loading", _ctx.loading),
            vue.unref(ns).is("plain", _ctx.plain),
            vue.unref(ns).is("round", _ctx.round),
            vue.unref(ns).is("circle", _ctx.circle),
            vue.unref(ns).is("text", _ctx.text),
            vue.unref(ns).is("link", _ctx.link),
            vue.unref(ns).is("has-bg", _ctx.bg)
          ],
          style: vue.unref(buttonStyle),
          onClick: vue.unref(handleClick)
        }), {
          default: vue.withCtx(() => [
            _ctx.loading ? (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 0 }, [
              _ctx.$slots.loading ? vue.renderSlot(_ctx.$slots, "loading", { key: 0 }) : (vue.openBlock(), vue.createBlock(vue.unref(ElIcon), {
                key: 1,
                class: vue.normalizeClass(vue.unref(ns).is("loading"))
              }, {
                default: vue.withCtx(() => [
                  (vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(_ctx.loadingIcon)))
                ]),
                _: 1
              }, 8, ["class"]))
            ], 64)) : _ctx.icon || _ctx.$slots.icon ? (vue.openBlock(), vue.createBlock(vue.unref(ElIcon), { key: 1 }, {
              default: vue.withCtx(() => [
                _ctx.icon ? (vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(_ctx.icon), { key: 0 })) : vue.renderSlot(_ctx.$slots, "icon", { key: 1 })
              ]),
              _: 3
            })) : vue.createCommentVNode("v-if", true),
            _ctx.$slots.default ? (vue.openBlock(), vue.createElementBlock("span", {
              key: 2,
              class: vue.normalizeClass({ [vue.unref(ns).em("text", "expand")]: vue.unref(shouldAddSpace) })
            }, [
              vue.renderSlot(_ctx.$slots, "default")
            ], 2)) : vue.createCommentVNode("v-if", true)
          ]),
          _: 3
        }, 16, ["class", "style", "onClick"]);
      };
    }
  });
  var Button = /* @__PURE__ */ _export_sfc$1(_sfc_main$6, [["__file", "button.vue"]]);
  const buttonGroupProps = {
    size: buttonProps.size,
    type: buttonProps.type
  };
  const __default__$3 = vue.defineComponent({
    name: "ElButtonGroup"
  });
  const _sfc_main$5 = /* @__PURE__ */ vue.defineComponent({
    ...__default__$3,
    props: buttonGroupProps,
    setup(__props) {
      const props = __props;
      vue.provide(buttonGroupContextKey, vue.reactive({
        size: vue.toRef(props, "size"),
        type: vue.toRef(props, "type")
      }));
      const ns = useNamespace("button");
      return (_ctx, _cache) => {
        return vue.openBlock(), vue.createElementBlock("div", {
          class: vue.normalizeClass(`${vue.unref(ns).b("group")}`)
        }, [
          vue.renderSlot(_ctx.$slots, "default")
        ], 2);
      };
    }
  });
  var ButtonGroup = /* @__PURE__ */ _export_sfc$1(_sfc_main$5, [["__file", "button-group.vue"]]);
  const ElButton = withInstall(Button, {
    ButtonGroup
  });
  withNoopInstall(ButtonGroup);
  var commonjsGlobal = typeof globalThis !== "undefined" ? globalThis : typeof window !== "undefined" ? window : typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : {};
  function getDefaultExportFromCjs(x) {
    return x && x.__esModule && Object.prototype.hasOwnProperty.call(x, "default") ? x["default"] : x;
  }
  function getAugmentedNamespace(n) {
    if (n.__esModule)
      return n;
    var f = n.default;
    if (typeof f == "function") {
      var a = function a2() {
        if (this instanceof a2) {
          return Reflect.construct(f, arguments, this.constructor);
        }
        return f.apply(this, arguments);
      };
      a.prototype = f.prototype;
    } else
      a = {};
    Object.defineProperty(a, "__esModule", { value: true });
    Object.keys(n).forEach(function(k) {
      var d = Object.getOwnPropertyDescriptor(n, k);
      Object.defineProperty(a, k, d.get ? d : {
        enumerable: true,
        get: function() {
          return n[k];
        }
      });
    });
    return a;
  }
  const overlayProps = buildProps({
    mask: {
      type: Boolean,
      default: true
    },
    customMaskEvent: {
      type: Boolean,
      default: false
    },
    overlayClass: {
      type: definePropType([
        String,
        Array,
        Object
      ])
    },
    zIndex: {
      type: definePropType([String, Number])
    }
  });
  const overlayEmits = {
    click: (evt) => evt instanceof MouseEvent
  };
  const BLOCK = "overlay";
  var Overlay = vue.defineComponent({
    name: "ElOverlay",
    props: overlayProps,
    emits: overlayEmits,
    setup(props, { slots, emit }) {
      const ns = useNamespace(BLOCK);
      const onMaskClick = (e) => {
        emit("click", e);
      };
      const { onClick, onMousedown, onMouseup } = useSameTarget(props.customMaskEvent ? void 0 : onMaskClick);
      return () => {
        return props.mask ? vue.createVNode("div", {
          class: [ns.b(), props.overlayClass],
          style: {
            zIndex: props.zIndex
          },
          onClick,
          onMousedown,
          onMouseup
        }, [vue.renderSlot(slots, "default")], PatchFlags.STYLE | PatchFlags.CLASS | PatchFlags.PROPS, ["onClick", "onMouseup", "onMousedown"]) : vue.h("div", {
          class: props.overlayClass,
          style: {
            zIndex: props.zIndex,
            position: "fixed",
            top: "0px",
            right: "0px",
            bottom: "0px",
            left: "0px"
          }
        }, [vue.renderSlot(slots, "default")]);
      };
    }
  });
  const ElOverlay = Overlay;
  const dialogInjectionKey = Symbol("dialogInjectionKey");
  const dialogContentProps = buildProps({
    center: Boolean,
    alignCenter: Boolean,
    closeIcon: {
      type: iconPropType
    },
    draggable: Boolean,
    overflow: Boolean,
    fullscreen: Boolean,
    showClose: {
      type: Boolean,
      default: true
    },
    title: {
      type: String,
      default: ""
    },
    ariaLevel: {
      type: String,
      default: "2"
    }
  });
  const dialogContentEmits = {
    close: () => true
  };
  const _hoisted_1$4 = ["aria-level"];
  const _hoisted_2$3 = ["aria-label"];
  const _hoisted_3$2 = ["id"];
  const __default__$2 = vue.defineComponent({ name: "ElDialogContent" });
  const _sfc_main$4 = /* @__PURE__ */ vue.defineComponent({
    ...__default__$2,
    props: dialogContentProps,
    emits: dialogContentEmits,
    setup(__props) {
      const props = __props;
      const { t } = useLocale();
      const { Close } = CloseComponents;
      const { dialogRef, headerRef, bodyId, ns, style: style2 } = vue.inject(dialogInjectionKey);
      const { focusTrapRef } = vue.inject(FOCUS_TRAP_INJECTION_KEY);
      const dialogKls = vue.computed(() => [
        ns.b(),
        ns.is("fullscreen", props.fullscreen),
        ns.is("draggable", props.draggable),
        ns.is("align-center", props.alignCenter),
        { [ns.m("center")]: props.center }
      ]);
      const composedDialogRef = composeRefs(focusTrapRef, dialogRef);
      const draggable = vue.computed(() => props.draggable);
      const overflow = vue.computed(() => props.overflow);
      useDraggable(dialogRef, headerRef, draggable, overflow);
      return (_ctx, _cache) => {
        return vue.openBlock(), vue.createElementBlock("div", {
          ref: vue.unref(composedDialogRef),
          class: vue.normalizeClass(vue.unref(dialogKls)),
          style: vue.normalizeStyle(vue.unref(style2)),
          tabindex: "-1"
        }, [
          vue.createElementVNode("header", {
            ref_key: "headerRef",
            ref: headerRef,
            class: vue.normalizeClass([vue.unref(ns).e("header"), { "show-close": _ctx.showClose }])
          }, [
            vue.renderSlot(_ctx.$slots, "header", {}, () => [
              vue.createElementVNode("span", {
                role: "heading",
                "aria-level": _ctx.ariaLevel,
                class: vue.normalizeClass(vue.unref(ns).e("title"))
              }, vue.toDisplayString(_ctx.title), 11, _hoisted_1$4)
            ]),
            _ctx.showClose ? (vue.openBlock(), vue.createElementBlock("button", {
              key: 0,
              "aria-label": vue.unref(t)("el.dialog.close"),
              class: vue.normalizeClass(vue.unref(ns).e("headerbtn")),
              type: "button",
              onClick: _cache[0] || (_cache[0] = ($event) => _ctx.$emit("close"))
            }, [
              vue.createVNode(vue.unref(ElIcon), {
                class: vue.normalizeClass(vue.unref(ns).e("close"))
              }, {
                default: vue.withCtx(() => [
                  (vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(_ctx.closeIcon || vue.unref(Close))))
                ]),
                _: 1
              }, 8, ["class"])
            ], 10, _hoisted_2$3)) : vue.createCommentVNode("v-if", true)
          ], 2),
          vue.createElementVNode("div", {
            id: vue.unref(bodyId),
            class: vue.normalizeClass(vue.unref(ns).e("body"))
          }, [
            vue.renderSlot(_ctx.$slots, "default")
          ], 10, _hoisted_3$2),
          _ctx.$slots.footer ? (vue.openBlock(), vue.createElementBlock("footer", {
            key: 0,
            class: vue.normalizeClass(vue.unref(ns).e("footer"))
          }, [
            vue.renderSlot(_ctx.$slots, "footer")
          ], 2)) : vue.createCommentVNode("v-if", true)
        ], 6);
      };
    }
  });
  var ElDialogContent = /* @__PURE__ */ _export_sfc$1(_sfc_main$4, [["__file", "dialog-content.vue"]]);
  const dialogProps = buildProps({
    ...dialogContentProps,
    appendToBody: Boolean,
    appendTo: {
      type: definePropType(String),
      default: "body"
    },
    beforeClose: {
      type: definePropType(Function)
    },
    destroyOnClose: Boolean,
    closeOnClickModal: {
      type: Boolean,
      default: true
    },
    closeOnPressEscape: {
      type: Boolean,
      default: true
    },
    lockScroll: {
      type: Boolean,
      default: true
    },
    modal: {
      type: Boolean,
      default: true
    },
    openDelay: {
      type: Number,
      default: 0
    },
    closeDelay: {
      type: Number,
      default: 0
    },
    top: {
      type: String
    },
    modelValue: Boolean,
    modalClass: String,
    width: {
      type: [String, Number]
    },
    zIndex: {
      type: Number
    },
    trapFocus: {
      type: Boolean,
      default: false
    },
    headerAriaLevel: {
      type: String,
      default: "2"
    }
  });
  const dialogEmits = {
    open: () => true,
    opened: () => true,
    close: () => true,
    closed: () => true,
    [UPDATE_MODEL_EVENT]: (value) => isBoolean(value),
    openAutoFocus: () => true,
    closeAutoFocus: () => true
  };
  const useDialog = (props, targetRef) => {
    var _a2;
    const instance = vue.getCurrentInstance();
    const emit = instance.emit;
    const { nextZIndex } = useZIndex();
    let lastPosition = "";
    const titleId = useId();
    const bodyId = useId();
    const visible = vue.ref(false);
    const closed = vue.ref(false);
    const rendered = vue.ref(false);
    const zIndex2 = vue.ref((_a2 = props.zIndex) != null ? _a2 : nextZIndex());
    let openTimer = void 0;
    let closeTimer = void 0;
    const namespace = useGlobalConfig("namespace", defaultNamespace);
    const style2 = vue.computed(() => {
      const style22 = {};
      const varPrefix = `--${namespace.value}-dialog`;
      if (!props.fullscreen) {
        if (props.top) {
          style22[`${varPrefix}-margin-top`] = props.top;
        }
        if (props.width) {
          style22[`${varPrefix}-width`] = addUnit(props.width);
        }
      }
      return style22;
    });
    const overlayDialogStyle = vue.computed(() => {
      if (props.alignCenter) {
        return { display: "flex" };
      }
      return {};
    });
    function afterEnter() {
      emit("opened");
    }
    function afterLeave() {
      emit("closed");
      emit(UPDATE_MODEL_EVENT, false);
      if (props.destroyOnClose) {
        rendered.value = false;
      }
    }
    function beforeLeave() {
      emit("close");
    }
    function open() {
      closeTimer == null ? void 0 : closeTimer();
      openTimer == null ? void 0 : openTimer();
      if (props.openDelay && props.openDelay > 0) {
        ({ stop: openTimer } = useTimeoutFn(() => doOpen(), props.openDelay));
      } else {
        doOpen();
      }
    }
    function close() {
      openTimer == null ? void 0 : openTimer();
      closeTimer == null ? void 0 : closeTimer();
      if (props.closeDelay && props.closeDelay > 0) {
        ({ stop: closeTimer } = useTimeoutFn(() => doClose(), props.closeDelay));
      } else {
        doClose();
      }
    }
    function handleClose() {
      function hide(shouldCancel) {
        if (shouldCancel)
          return;
        closed.value = true;
        visible.value = false;
      }
      if (props.beforeClose) {
        props.beforeClose(hide);
      } else {
        close();
      }
    }
    function onModalClick() {
      if (props.closeOnClickModal) {
        handleClose();
      }
    }
    function doOpen() {
      if (!isClient)
        return;
      visible.value = true;
    }
    function doClose() {
      visible.value = false;
    }
    function onOpenAutoFocus() {
      emit("openAutoFocus");
    }
    function onCloseAutoFocus() {
      emit("closeAutoFocus");
    }
    function onFocusoutPrevented(event) {
      var _a22;
      if (((_a22 = event.detail) == null ? void 0 : _a22.focusReason) === "pointer") {
        event.preventDefault();
      }
    }
    if (props.lockScroll) {
      useLockscreen(visible);
    }
    function onCloseRequested() {
      if (props.closeOnPressEscape) {
        handleClose();
      }
    }
    vue.watch(() => props.modelValue, (val) => {
      if (val) {
        closed.value = false;
        open();
        rendered.value = true;
        zIndex2.value = isUndefined$1(props.zIndex) ? nextZIndex() : zIndex2.value++;
        vue.nextTick(() => {
          emit("open");
          if (targetRef.value) {
            targetRef.value.scrollTop = 0;
          }
        });
      } else {
        if (visible.value) {
          close();
        }
      }
    });
    vue.watch(() => props.fullscreen, (val) => {
      if (!targetRef.value)
        return;
      if (val) {
        lastPosition = targetRef.value.style.transform;
        targetRef.value.style.transform = "";
      } else {
        targetRef.value.style.transform = lastPosition;
      }
    });
    vue.onMounted(() => {
      if (props.modelValue) {
        visible.value = true;
        rendered.value = true;
        open();
      }
    });
    return {
      afterEnter,
      afterLeave,
      beforeLeave,
      handleClose,
      onModalClick,
      close,
      doClose,
      onOpenAutoFocus,
      onCloseAutoFocus,
      onCloseRequested,
      onFocusoutPrevented,
      titleId,
      bodyId,
      closed,
      style: style2,
      overlayDialogStyle,
      rendered,
      visible,
      zIndex: zIndex2
    };
  };
  const _hoisted_1$3 = ["aria-label", "aria-labelledby", "aria-describedby"];
  const __default__$1 = vue.defineComponent({
    name: "ElDialog",
    inheritAttrs: false
  });
  const _sfc_main$3 = /* @__PURE__ */ vue.defineComponent({
    ...__default__$1,
    props: dialogProps,
    emits: dialogEmits,
    setup(__props, { expose }) {
      const props = __props;
      const slots = vue.useSlots();
      useDeprecated({
        scope: "el-dialog",
        from: "the title slot",
        replacement: "the header slot",
        version: "3.0.0",
        ref: "https://element-plus.org/en-US/component/dialog.html#slots"
      }, vue.computed(() => !!slots.title));
      const ns = useNamespace("dialog");
      const dialogRef = vue.ref();
      const headerRef = vue.ref();
      const dialogContentRef = vue.ref();
      const {
        visible,
        titleId,
        bodyId,
        style: style2,
        overlayDialogStyle,
        rendered,
        zIndex: zIndex2,
        afterEnter,
        afterLeave,
        beforeLeave,
        handleClose,
        onModalClick,
        onOpenAutoFocus,
        onCloseAutoFocus,
        onCloseRequested,
        onFocusoutPrevented
      } = useDialog(props, dialogRef);
      vue.provide(dialogInjectionKey, {
        dialogRef,
        headerRef,
        bodyId,
        ns,
        rendered,
        style: style2
      });
      const overlayEvent = useSameTarget(onModalClick);
      const draggable = vue.computed(() => props.draggable && !props.fullscreen);
      expose({
        visible,
        dialogContentRef
      });
      return (_ctx, _cache) => {
        return vue.openBlock(), vue.createBlock(vue.Teleport, {
          to: _ctx.appendTo,
          disabled: _ctx.appendTo !== "body" ? false : !_ctx.appendToBody
        }, [
          vue.createVNode(vue.Transition, {
            name: "dialog-fade",
            onAfterEnter: vue.unref(afterEnter),
            onAfterLeave: vue.unref(afterLeave),
            onBeforeLeave: vue.unref(beforeLeave),
            persisted: ""
          }, {
            default: vue.withCtx(() => [
              vue.withDirectives(vue.createVNode(vue.unref(ElOverlay), {
                "custom-mask-event": "",
                mask: _ctx.modal,
                "overlay-class": _ctx.modalClass,
                "z-index": vue.unref(zIndex2)
              }, {
                default: vue.withCtx(() => [
                  vue.createElementVNode("div", {
                    role: "dialog",
                    "aria-modal": "true",
                    "aria-label": _ctx.title || void 0,
                    "aria-labelledby": !_ctx.title ? vue.unref(titleId) : void 0,
                    "aria-describedby": vue.unref(bodyId),
                    class: vue.normalizeClass(`${vue.unref(ns).namespace.value}-overlay-dialog`),
                    style: vue.normalizeStyle(vue.unref(overlayDialogStyle)),
                    onClick: _cache[0] || (_cache[0] = (...args) => vue.unref(overlayEvent).onClick && vue.unref(overlayEvent).onClick(...args)),
                    onMousedown: _cache[1] || (_cache[1] = (...args) => vue.unref(overlayEvent).onMousedown && vue.unref(overlayEvent).onMousedown(...args)),
                    onMouseup: _cache[2] || (_cache[2] = (...args) => vue.unref(overlayEvent).onMouseup && vue.unref(overlayEvent).onMouseup(...args))
                  }, [
                    vue.createVNode(vue.unref(ElFocusTrap), {
                      loop: "",
                      trapped: vue.unref(visible),
                      "focus-start-el": "container",
                      onFocusAfterTrapped: vue.unref(onOpenAutoFocus),
                      onFocusAfterReleased: vue.unref(onCloseAutoFocus),
                      onFocusoutPrevented: vue.unref(onFocusoutPrevented),
                      onReleaseRequested: vue.unref(onCloseRequested)
                    }, {
                      default: vue.withCtx(() => [
                        vue.unref(rendered) ? (vue.openBlock(), vue.createBlock(ElDialogContent, vue.mergeProps({
                          key: 0,
                          ref_key: "dialogContentRef",
                          ref: dialogContentRef
                        }, _ctx.$attrs, {
                          center: _ctx.center,
                          "align-center": _ctx.alignCenter,
                          "close-icon": _ctx.closeIcon,
                          draggable: vue.unref(draggable),
                          overflow: _ctx.overflow,
                          fullscreen: _ctx.fullscreen,
                          "show-close": _ctx.showClose,
                          title: _ctx.title,
                          "aria-level": _ctx.headerAriaLevel,
                          onClose: vue.unref(handleClose)
                        }), vue.createSlots({
                          header: vue.withCtx(() => [
                            !_ctx.$slots.title ? vue.renderSlot(_ctx.$slots, "header", {
                              key: 0,
                              close: vue.unref(handleClose),
                              titleId: vue.unref(titleId),
                              titleClass: vue.unref(ns).e("title")
                            }) : vue.renderSlot(_ctx.$slots, "title", { key: 1 })
                          ]),
                          default: vue.withCtx(() => [
                            vue.renderSlot(_ctx.$slots, "default")
                          ]),
                          _: 2
                        }, [
                          _ctx.$slots.footer ? {
                            name: "footer",
                            fn: vue.withCtx(() => [
                              vue.renderSlot(_ctx.$slots, "footer")
                            ])
                          } : void 0
                        ]), 1040, ["center", "align-center", "close-icon", "draggable", "overflow", "fullscreen", "show-close", "title", "aria-level", "onClose"])) : vue.createCommentVNode("v-if", true)
                      ]),
                      _: 3
                    }, 8, ["trapped", "onFocusAfterTrapped", "onFocusAfterReleased", "onFocusoutPrevented", "onReleaseRequested"])
                  ], 46, _hoisted_1$3)
                ]),
                _: 3
              }, 8, ["mask", "overlay-class", "z-index"]), [
                [vue.vShow, vue.unref(visible)]
              ])
            ]),
            _: 3
          }, 8, ["onAfterEnter", "onAfterLeave", "onBeforeLeave"])
        ], 8, ["to", "disabled"]);
      };
    }
  });
  var Dialog = /* @__PURE__ */ _export_sfc$1(_sfc_main$3, [["__file", "dialog.vue"]]);
  const ElDialog = withInstall(Dialog);
  const messageTypes = ["success", "info", "warning", "error"];
  const messageDefaults = mutable({
    customClass: "",
    center: false,
    dangerouslyUseHTMLString: false,
    duration: 3e3,
    icon: void 0,
    id: "",
    message: "",
    onClose: void 0,
    showClose: false,
    type: "info",
    offset: 16,
    zIndex: 0,
    grouping: false,
    repeatNum: 1,
    appendTo: isClient ? document.body : void 0
  });
  const messageProps = buildProps({
    customClass: {
      type: String,
      default: messageDefaults.customClass
    },
    center: {
      type: Boolean,
      default: messageDefaults.center
    },
    dangerouslyUseHTMLString: {
      type: Boolean,
      default: messageDefaults.dangerouslyUseHTMLString
    },
    duration: {
      type: Number,
      default: messageDefaults.duration
    },
    icon: {
      type: iconPropType,
      default: messageDefaults.icon
    },
    id: {
      type: String,
      default: messageDefaults.id
    },
    message: {
      type: definePropType([
        String,
        Object,
        Function
      ]),
      default: messageDefaults.message
    },
    onClose: {
      type: definePropType(Function),
      required: false
    },
    showClose: {
      type: Boolean,
      default: messageDefaults.showClose
    },
    type: {
      type: String,
      values: messageTypes,
      default: messageDefaults.type
    },
    offset: {
      type: Number,
      default: messageDefaults.offset
    },
    zIndex: {
      type: Number,
      default: messageDefaults.zIndex
    },
    grouping: {
      type: Boolean,
      default: messageDefaults.grouping
    },
    repeatNum: {
      type: Number,
      default: messageDefaults.repeatNum
    }
  });
  const messageEmits = {
    destroy: () => true
  };
  const instances = vue.shallowReactive([]);
  const getInstance = (id) => {
    const idx = instances.findIndex((instance) => instance.id === id);
    const current = instances[idx];
    let prev;
    if (idx > 0) {
      prev = instances[idx - 1];
    }
    return { current, prev };
  };
  const getLastOffset = (id) => {
    const { prev } = getInstance(id);
    if (!prev)
      return 0;
    return prev.vm.exposed.bottom.value;
  };
  const getOffsetOrSpace = (id, offset) => {
    const idx = instances.findIndex((instance) => instance.id === id);
    return idx > 0 ? 20 : offset;
  };
  const _hoisted_1$2 = ["id"];
  const _hoisted_2$2 = ["innerHTML"];
  const __default__ = vue.defineComponent({
    name: "ElMessage"
  });
  const _sfc_main$2 = /* @__PURE__ */ vue.defineComponent({
    ...__default__,
    props: messageProps,
    emits: messageEmits,
    setup(__props, { expose }) {
      const props = __props;
      const { Close } = TypeComponents;
      const { ns, zIndex: zIndex2 } = useGlobalComponentSettings("message");
      const { currentZIndex, nextZIndex } = zIndex2;
      const messageRef = vue.ref();
      const visible = vue.ref(false);
      const height = vue.ref(0);
      let stopTimer = void 0;
      const badgeType = vue.computed(() => props.type ? props.type === "error" ? "danger" : props.type : "info");
      const typeClass = vue.computed(() => {
        const type = props.type;
        return { [ns.bm("icon", type)]: type && TypeComponentsMap[type] };
      });
      const iconComponent = vue.computed(() => props.icon || TypeComponentsMap[props.type] || "");
      const lastOffset = vue.computed(() => getLastOffset(props.id));
      const offset = vue.computed(() => getOffsetOrSpace(props.id, props.offset) + lastOffset.value);
      const bottom = vue.computed(() => height.value + offset.value);
      const customStyle = vue.computed(() => ({
        top: `${offset.value}px`,
        zIndex: currentZIndex.value
      }));
      function startTimer() {
        if (props.duration === 0)
          return;
        ({ stop: stopTimer } = useTimeoutFn(() => {
          close();
        }, props.duration));
      }
      function clearTimer() {
        stopTimer == null ? void 0 : stopTimer();
      }
      function close() {
        visible.value = false;
      }
      function keydown({ code }) {
        if (code === EVENT_CODE.esc) {
          close();
        }
      }
      vue.onMounted(() => {
        startTimer();
        nextZIndex();
        visible.value = true;
      });
      vue.watch(() => props.repeatNum, () => {
        clearTimer();
        startTimer();
      });
      useEventListener(document, "keydown", keydown);
      useResizeObserver(messageRef, () => {
        height.value = messageRef.value.getBoundingClientRect().height;
      });
      expose({
        visible,
        bottom,
        close
      });
      return (_ctx, _cache) => {
        return vue.openBlock(), vue.createBlock(vue.Transition, {
          name: vue.unref(ns).b("fade"),
          onBeforeLeave: _ctx.onClose,
          onAfterLeave: _cache[0] || (_cache[0] = ($event) => _ctx.$emit("destroy")),
          persisted: ""
        }, {
          default: vue.withCtx(() => [
            vue.withDirectives(vue.createElementVNode("div", {
              id: _ctx.id,
              ref_key: "messageRef",
              ref: messageRef,
              class: vue.normalizeClass([
                vue.unref(ns).b(),
                { [vue.unref(ns).m(_ctx.type)]: _ctx.type },
                vue.unref(ns).is("center", _ctx.center),
                vue.unref(ns).is("closable", _ctx.showClose),
                _ctx.customClass
              ]),
              style: vue.normalizeStyle(vue.unref(customStyle)),
              role: "alert",
              onMouseenter: clearTimer,
              onMouseleave: startTimer
            }, [
              _ctx.repeatNum > 1 ? (vue.openBlock(), vue.createBlock(vue.unref(ElBadge), {
                key: 0,
                value: _ctx.repeatNum,
                type: vue.unref(badgeType),
                class: vue.normalizeClass(vue.unref(ns).e("badge"))
              }, null, 8, ["value", "type", "class"])) : vue.createCommentVNode("v-if", true),
              vue.unref(iconComponent) ? (vue.openBlock(), vue.createBlock(vue.unref(ElIcon), {
                key: 1,
                class: vue.normalizeClass([vue.unref(ns).e("icon"), vue.unref(typeClass)])
              }, {
                default: vue.withCtx(() => [
                  (vue.openBlock(), vue.createBlock(vue.resolveDynamicComponent(vue.unref(iconComponent))))
                ]),
                _: 1
              }, 8, ["class"])) : vue.createCommentVNode("v-if", true),
              vue.renderSlot(_ctx.$slots, "default", {}, () => [
                !_ctx.dangerouslyUseHTMLString ? (vue.openBlock(), vue.createElementBlock("p", {
                  key: 0,
                  class: vue.normalizeClass(vue.unref(ns).e("content"))
                }, vue.toDisplayString(_ctx.message), 3)) : (vue.openBlock(), vue.createElementBlock(vue.Fragment, { key: 1 }, [
                  vue.createCommentVNode(" Caution here, message could've been compromised, never use user's input as message "),
                  vue.createElementVNode("p", {
                    class: vue.normalizeClass(vue.unref(ns).e("content")),
                    innerHTML: _ctx.message
                  }, null, 10, _hoisted_2$2)
                ], 2112))
              ]),
              _ctx.showClose ? (vue.openBlock(), vue.createBlock(vue.unref(ElIcon), {
                key: 2,
                class: vue.normalizeClass(vue.unref(ns).e("closeBtn")),
                onClick: vue.withModifiers(close, ["stop"])
              }, {
                default: vue.withCtx(() => [
                  vue.createVNode(vue.unref(Close))
                ]),
                _: 1
              }, 8, ["class", "onClick"])) : vue.createCommentVNode("v-if", true)
            ], 46, _hoisted_1$2), [
              [vue.vShow, visible.value]
            ])
          ]),
          _: 3
        }, 8, ["name", "onBeforeLeave"]);
      };
    }
  });
  var MessageConstructor = /* @__PURE__ */ _export_sfc$1(_sfc_main$2, [["__file", "message.vue"]]);
  let seed = 1;
  const normalizeOptions = (params) => {
    const options = !params || isString(params) || vue.isVNode(params) || isFunction$1(params) ? { message: params } : params;
    const normalized = {
      ...messageDefaults,
      ...options
    };
    if (!normalized.appendTo) {
      normalized.appendTo = document.body;
    } else if (isString(normalized.appendTo)) {
      let appendTo = document.querySelector(normalized.appendTo);
      if (!isElement(appendTo)) {
        appendTo = document.body;
      }
      normalized.appendTo = appendTo;
    }
    return normalized;
  };
  const closeMessage = (instance) => {
    const idx = instances.indexOf(instance);
    if (idx === -1)
      return;
    instances.splice(idx, 1);
    const { handler } = instance;
    handler.close();
  };
  const createMessage = ({ appendTo, ...options }, context) => {
    const id = `message_${seed++}`;
    const userOnClose = options.onClose;
    const container = document.createElement("div");
    const props = {
      ...options,
      id,
      onClose: () => {
        userOnClose == null ? void 0 : userOnClose();
        closeMessage(instance);
      },
      onDestroy: () => {
        vue.render(null, container);
      }
    };
    const vnode = vue.createVNode(MessageConstructor, props, isFunction$1(props.message) || vue.isVNode(props.message) ? {
      default: isFunction$1(props.message) ? props.message : () => props.message
    } : null);
    vnode.appContext = context || message._context;
    vue.render(vnode, container);
    appendTo.appendChild(container.firstElementChild);
    const vm = vnode.component;
    const handler = {
      close: () => {
        vm.exposed.visible.value = false;
      }
    };
    const instance = {
      id,
      vnode,
      vm,
      handler,
      props: vnode.component.props
    };
    return instance;
  };
  const message = (options = {}, context) => {
    if (!isClient)
      return { close: () => void 0 };
    if (isNumber(messageConfig.max) && instances.length >= messageConfig.max) {
      return { close: () => void 0 };
    }
    const normalized = normalizeOptions(options);
    if (normalized.grouping && instances.length) {
      const instance2 = instances.find(({ vnode: vm }) => {
        var _a2;
        return ((_a2 = vm.props) == null ? void 0 : _a2.message) === normalized.message;
      });
      if (instance2) {
        instance2.props.repeatNum += 1;
        instance2.props.type = normalized.type;
        return instance2.handler;
      }
    }
    const instance = createMessage(normalized, context);
    instances.push(instance);
    return instance.handler;
  };
  messageTypes.forEach((type) => {
    message[type] = (options = {}, appContext) => {
      const normalized = normalizeOptions(options);
      return message({ ...normalized, type }, appContext);
    };
  });
  function closeAll(type) {
    for (const instance of instances) {
      if (!type || type === instance.props.type) {
        instance.handler.close();
      }
    }
  }
  message.closeAll = closeAll;
  message._context = null;
  const ElMessage = withInstallFunction(message, "$message");
  const _export_sfc = (sfc, props) => {
    const target = sfc.__vccOpts || sfc;
    for (const [key, val] of props) {
      target[key] = val;
    }
    return target;
  };
  const _withScopeId = (n) => (vue.pushScopeId("data-v-2d09cfa9"), n = n(), vue.popScopeId(), n);
  const _hoisted_1$1 = { class: "modal" };
  const _hoisted_2$1 = { class: "header" };
  const _hoisted_3$1 = { class: "contentBox" };
  const _hoisted_4$1 = { class: "produce" };
  const _hoisted_5$1 = /* @__PURE__ */ _withScopeId(() => /* @__PURE__ */ vue.createElementVNode("p", null, "1、扫描右侧公众号,点击关注!", -1));
  const _hoisted_6 = /* @__PURE__ */ _withScopeId(() => /* @__PURE__ */ vue.createElementVNode("p", null, "2、在软件爬取者后台回复:验证码", -1));
  const _hoisted_7 = /* @__PURE__ */ _withScopeId(() => /* @__PURE__ */ vue.createElementVNode("p", null, "3、在下方输入框输入获取的验证码后回车", -1));
  const _hoisted_8 = /* @__PURE__ */ _withScopeId(() => /* @__PURE__ */ vue.createElementVNode("div", { class: "img" }, [
    /* @__PURE__ */ vue.createElementVNode("img", {
      src: "data:image/jpeg;base64,/9j/4AAQSkZJRgABAQAAAQABAAD/4AAQSkZJRgABAQAAAQABAAD/2wEEEAANAA0ADQANAA4ADQAOABAAEAAOABQAFgATABYAFAAeABsAGQAZABsAHgAtACAAIgAgACIAIAAtAEQAKgAyACoAKgAyACoARAA8AEkAOwA3ADsASQA8AGwAVQBLAEsAVQBsAH0AaQBjAGkAfQCXAIcAhwCXAL4AtQC+APkA+QFOEQANAA0ADQANAA4ADQAOABAAEAAOABQAFgATABYAFAAeABsAGQAZABsAHgAtACAAIgAgACIAIAAtAEQAKgAyACoAKgAyACoARAA8AEkAOwA3ADsASQA8AGwAVQBLAEsAVQBsAH0AaQBjAGkAfQCXAIcAhwCXAL4AtQC+APkA+QFO/8IAEQgBAgECAwEiAAIRAQMRAf/EADQAAAMBAQADAQAAAAAAAAAAAAAGBwUEAQMIAgEBAAMBAQEAAAAAAAAAAAAAAAQFBgMBAv/aAAwDAQACEAMQAAAApwAAAAAAAAAAAAAAAAAAAAAAAAAAAAASnC/VnIsVEJc96yqcwBuItgmZ1VVGDCq2LOivkgfRiFxWKZiybTMysTphGSTVNVFYrXMS4sUgLiAAAAEOpsyqBAwC+KbYpmo8w78FQWFbBN+5/NtZPLROgwafpzEVrF2YA8x/MVTz4Avim2KYsKzYplQW2RbLiAAAAEOp2VnDMK3sPfx+1iJppM+oaUg/OUX6fM8wHudcjQajkmLJqU3NmBWY5yXgg/La8410GnoI1i1+Bokjh+ylgAAAAGLgBvYOGPWFq6JpejMkxpoVk3yN7tHiJ1YF8l4zOWBJT6LwpeHL1VpDMGs7eKbSM3+gju9VZAMyKzTo+kgAAAAheXrqZeMvNciIPk56g+iPmL6dBHeJSUNGzKYI+kj7hVUd4lJQ0dqgZUtONNhS1nymltyeySj3m6SOUqZXSHFxAAAACHXGF2E08VQQBpfFUGpD18c09XKWD90RlnMmDQM9N73HMdl7O+fqjT70M3T2Hb7nLYljUdTKWBznD/8Agcp1rPAhzqjeSlgAAABjRqyRswD6LkA8iwFfQJDXDjc4jUBonzinT6fo3sbozN/7sNlyolhwtaq07bDp7mm4NXobB6V9HPyzy6oDVL96blSoMqwC/AAAABC9XN0TMacnCLaiOMlMs5bwceb43hF8uiTZU3fp5H6z11s5vD7eUv17WMwaXMYNMW+quu9pHQw1cupQMqWWg/SxEst90h5AAAACVYbwDP1zrNF+tRvVLZMOevBi8a0P80qivMr1f9d+j2iqHu19HlJXXLC3XkrruBL4Vl9EYvJMDVfPEvKjgzh/PWt0uYl0AAAACHbj3tEz6+kDLoU+Ey/I+CUX3qEmPpKZJ1aMFdruKILskvhgTlp0hZVeu4kYp+ZzDpGKeiGD9JI8aLIZa2XEAAAAEcwUMta2hWc0URxTRDf2bDNuX5fKOiD9KyYfEN/gZ5fPIU/J7JKGom28WKVmTwTX2WhUhM6ymzHy9DyAAAAGLzS5sGUWgZdKY6hyoX0lNDRxPf8AsWWTU1DFZFKkEzouFokfGoFWsdXgjuDbZgWr0GUTSzxWniIhNLSUsAAAAIdV5RUCWCsF8VmlUKZ6JjSyUoX0ZzCJuPIQwrKGYQ9hqkkcjMKLKCvSGv5xLjeqx82uebUBUcYlyn0kAAAAEOsEe8DQK4U9WT3MpUfsHzEVDVyqaTdkkriLDTpTocP3lP4qssxC6Q6rSkZJf9FxMvyzMmc8mXRTizvCKXMAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAP/xAAtEAACAQMCBAcAAwADAQAAAAAEBQYAAQIDFhEUFTYHEBITFyAxISUmMDRgRf/aAAgBAQABCAD/AMJJpM7XPDhBd6SWt6SWt6SWt6SWoS7ZtbM+ek0mdrnhwgsZlDs94EKVNXLNT0y4W9JLUZlDs94EKVUmkztc8OEF+0mJKXojSx96yao2YSeiBJJkxJS9EaWPvSS1vSS1vSS1vSS1vSS/ab90MqMNGAG1CSbTKLW/d4RiplhbazK9eG1+HWak0XdnvDShYzGXa54CWUxcrFXs886SsnzMlmrcuVj1YQsWQpOzUdSsaXJUQBOoKWlTM0DMZmzmzlW1ss5GG522sttW8IxUjtuuwnRNlyWkqZmgZjM2c2crWtlvIxiTol6MEYqZYW2syvXhpe1ruKLkqIAnUFL3hGKXOFjX3uRm/dDL7TfuhlUy7XY385lhbazK9eG/45pxNukMyQr1I45i+sHW5bxK/RKhXcy3ydQmzVkSdTlZZqrIDqSxqyDk+EN7XXUlW9VZDhVHI5ZDznCnM2s1WEA+cywttZlevDf8c1NO5mXl4b/jmpv3Qy+037oZVMsLbWZX85lhbazK9eG/45qb90Mq3pJa3pJaNNJPJ1CSgjSQCtMoWEumbWzOx0mkztc8OEFjModnvAhSmKZW0x0eedOWaBmSsWCRpEATplCTZwzUdN5Lekl+kywttZlevDf8c1N+6GXl4b/jmpv3Qy+037oZVvCMVvCMVvCMVJpMiPRGjC+G/wCOam/dDKkqZmgZjM2a1wsa+9cKb90MqMNGAG1CSZLa0q5PoaZyuQrR1TQ2MPABcyivDb/7FFyVEATqClpUzNAzGZs1rlY1964RclRAE6gpZsYeAC5lFLUrNr73ImhEgFagpUywttZleoQ5VqrM+e3hGK3hGK3lGKk5gp7wwkX6uoTZqyJOr4xzrPw29H78Y518Y51HI5ZDznB1CbNWRJ1TLDjGGWVRqS9A5zi6ZdVZEG1Mu12N6jUl6BznF0y6qyINpzNrNVhANeG/45qa9zMqmWHGMMsqjUlshsbxdMuqsiDadLLNFhIVRyOWQ83wdQmzVmSbTlZZorJDr44r4xzr41r44r41/wCCauGamy24UbMJPRAkkyYkpeiNLHhLtm1sy52iwRjhNUcubplqrpvI0bJ3h4uYpUJTLWvUuek4QoDwwUWvDX8c0bGkR5GoUSWCMcJqjl3h0ZqThCgPDBRd6SWt6SWo2YSeiBJJqbOGanplwt6SWozKHZ7wIUqauWanplwt6SX7FyVEATqCluXKx6sIWLIUmZqep2Nk0XdnvDShd4RilrlY09+4RclRAE6gpey5LUJTs1HUudLkqIAnUFLkgZJ6I4YZklZKvZubDc7bWW2qEd0LamyVm1ssuEaESAVqClbLktbLktRkYpeiCEIjMZdrngJZVFyVEATqClmGjADahJK1ysae9cKkqZmgZjM2ck/1Vg+iGhEgFagpX1mnczKkrPpLMc6o3JMH3OU4mvSGRIN0q3qrIcKuwqdMuqsiDfN1CbNWRJ1OWPSlhB1d+VaTbT4JKTwnpDMY21OoTZqyJOpyx6UsJOr5Kr5KpLNrNWQwNSOR9BsHx23aV/3dOVlmqsgOo5HLIec4OJt0hkSFfctpX/R1HI50HnKmvczL7Tfuhl5eGv45o2NIjyNQokI0kArTKFZOmTX2bG+cmkztc8OEFSumT5mMsaLkyxV73IzfuhlUZlDs94EKVUmkztc8OEFmWFtrMr+cI7oW14lenimoKTvABcBRZMSUvRGlj7zktJkyx6sHZs4R3Qt8pv3Qy+037oZeZclRAE6gpaVMzQMxmbPeEYreEYpKmZoGYzNnI7bqsH0RM5XIVo6pphCpHfPG10KgaN4E+51NfTbJW0W64WezktKclatfoBYaZ4Op/GHiNhe+ko1cajBooDwMoqR23XYKyRM5XIVo6ppJpMiPRGjCrUrJt73IxkYpeiCEISpmaBmMzZyT/VWD6IaESAVqClfWadzMqcselLCTq+S/49N3TLqrIg2ty2lXBJb44r4xzpzNrNVhANeG/wCOamnDczGitX2R9bUrW1tTX1MtTO1qHAz1cbZ5kAX0sMs8eFsrcbfzje17YaHXUhQerbw3t5eG/wCOamnDczGvjHOuwq+Ts6crOqqyQ67DrbVpX/eW+psaRHkahRJsneHi5ileTlMuQrSGquEu2bWzOx1SeMIl6M4kXw3/ABzRsaRHkahRLP8A6BdY2rHHjqaOFD6+nr6ds8Ne+tnYnTtjlw/m1+F7WvaO/wDWJqSyZ2vdmiibPjFLkyxV73ImxpEeRqFE70ktRy+67F9b2fGK3pJajl912Mu7DCGAG0xhvqXJUQBOoKXGDRQHgZRS1ysa+/cKb90MqSpmaBmMzZzdyra2WWBqTSZEeiNGFWpWTX3uSTOVyFaOqaZtl7RafmFjnbjQuHvF42ux0tK1tP16GpbO3po0X287Z4en0Y8Lx3+Riak0YeHuzShdlyWoSnZqLM7Gzfuhl5eG/wCOak0XdnvDShahDpcp6lzsnMFPeGEi/WadzMqdQiylYQdUaktkHOcbxvdvF7TlZZqrIDq3htb0+q7pZ0lmQDSVb1VkOFUcjlkPOcHUJs1ZEm1D+PQ3lY2te9aPDSx9eOeto6uGPu217WtnfDPPVy1NT3tS9LjenpmRdfJNvN1CbNWRJ1OoR0laSdUaktkFzK+SqdQfpC0g6o3G7Puc4ulvSWRAP2m/dDKkrpk+ZjLGk2TLFVlnIhSd4ALgKLJiSl6I0sfeklo00k8nUJKEjSIAnTKEmzhkpst5KNmEnogSSc1ICtWxxCxvWl68vV6Oc1tDhnWoz0NHSyvoX18ycLZVradsNPSypINoFrTh9fZkY9Fr1JiSl6I0sfeklreklqZYW2syv5lgjHCao5cl/wAncPoiZMserB2bP6yaLuz3hpQsI7oW0wcrFfs88IcMcJpECRg0UB4GUVaYxmhDhjhNIgSMxl2ueAllUXJUQBOoKWfp5aoZOGN7Xte9r6epnp5Wywy1fXle9E6GWeVs9PSxzwx431NTPVytfKPaWWAWrleZdyMKCkqI8jTFGouSogCdQUtKmZoGYzNnvCMVvCMVJpMiPRGjC+G/45qb90Mvs4m3SGZIV08J6QzGNt4kfiaks4soWDg0lW9VZDhVJY10Dk6SzjpCwcHykcjsh5Pjtq0r/vLZ34fzTbSRaeeGZX+WrXVKRtLLW1r3i9aClSTpY62hp6sU08rZZKXITTWK0QXUIs1ZEnUlZdJZDnVHJJi+sZU04bmY1Mu12NRuN2fc5xdLeksyQa+Mc6jkc6DznCadzMvtN+6GVRmUOz3gQpXiTa1ujVGYyiPRBElOUy5CtIaq45fddjbu5OEKA8MFFpkmWNPZsaGEMANpjDV4kYei6eo1GUR6IMopI0OetBlrKbpVinpvIw/R0rxtde8mjCMBGYWItdMlXu8lvSS+S10yU+9yKZMserB2bOZYW2syvS10yVe9YI00k8nUJKqauWSnptwkyZY9WDs2f1LkqIAnUFLqbJGbWyy4KZyuQrR1TQw0YAbUJJktrSrk+hpnK5CtHVNIzGXa54CWVNkrNrZZcE0IkArUFKjBooDwMoq0xjNCHDHCaRAkywttZleoQ5VqrM+e3hGKSpmaBmMzZyT/AFVg+iGhEgFagpUywttZlevDa/DrNSaLuz3hpQrlyserCFizZUnpM5XIVo6ppXhv+Oam/dDL7OoTZqyJOpLNrNWQwV5HI7IeT47atK/7ynKyzVWQHXYN6dMuqsiDa+Ts6jkkwfWMqa9zMqdQfpCwg7yhva661OZtZqtIC8k0Js1WDnU5WWaqyA6jkcsh5zhNe5mVOZtZqsIBrw0z9F3HklZ9JZjnV8k29HprbVpXbrlvjWo5HLIec4TTuZl9pNJna54cIKEaSAVplCsnTJr7NjYbnbay21SYkpeiNLHjd91WM63s+MVJ4wiXoziRVrpkq96wRppJ5OoSUWCMcJqjlzdMsVdN5GG522stt5QhMra2Z3OdOWaBmSsWSYkpeiNLH3pJaNNJPJ1CStnxilyZYq97kZNJna54cIL5BSd4ALgKLvSS1vSS0mTLHqwdmz+pclRAE6gpe8IxW8IxW8IxW8IxS5yraW1uRk0XdnvDShQgiTydMYWFJmamzLnZNF3Z7w0oWEd0La8SPxNUYk6JejBGKkgZJ6I4YaNcIrzfWxDhjhNIgTZclrZclrZclqSBknojhhtlyWjQiQCtQUow0YAbUJJXOFjT3+Sm/dDKjDRgBtQkmbOVjXpvI/aadzMq+Mc6+NcK+Mc6dQfpCwg6vDT9ceV41tK93dvkevkqk8J6QzGNtI43Z9ydfGOflJI3i+sFSZd0pYMDXydnXyVhSZn1VWMZTlj0pYQdUckeL6xfCa9zMqcrOqqyQ6jkcsh5zhNe5mVTLtljUbjdn3OcfjX7TfuhlUmJKXojSx96SWt6SWplhbazK9eGd7Wu48iwRjhNUcubplqrpvI1GZQ7PeBClTVyzU9MuFvSS1vSS1vSS1vSS1s+MVs+MU6cs0DMlYsSumT5mMsaLky1V73JTfuhlW9JLW9JLRppJ5OoSUldMnzMZY0kn+UsFdJGzCT0QJJP1m/dDKplhbazK/nMsLbWZXrw2vw6zUmi7s94aUKYaMANqEkrnKtp71wS5KiAJ1BS/IuSogCdQUuMxl2ueAllTZIza2WcimcrkK0dU0jBooDwMoqS8JVYPokZGKXoghCIR3Qtpg5WK/ZsdvCMVGYy7XPASyqm/dDKplhbazK9LUrJr71wjQiQCtQUr6zfuhlTlZ1VWSHXxrXxrUyx4xdjevDf8c+TmbWarCAa8N/xzTqE2asiTq+Ts6jkkwfWMqacNzMa+Sq+R621aV/3lfGtRyOWQ85wqEd0La8SPxN5yOR9BsHW2rSv+8rctpX/AEd45HOg85wdQizVkSd9pv3Qyreklreklreklo2TvDxcxSvDS9rXcefhv+OfKMBinvAxipHfanJ3SJkyx6sHZs4wGKe8DGKmyZaqst5KG522sttW9JLW9JLUbMJPRAkkwjuhbTJMsa+xY2ThCgPDBRd6SWo5fddjOtunLNAzJWLBI0iAJ0yhJs4ZqOm8lvSS/wDp/wD/xAA3EAAABQMDAgUDAwIFBQAAAAAAAQISEwMEEQUiMWOzEDJDk6MUIHMhJFGD4iNCU2BhMEFiseH/2gAIAQEACT8A/wBiXrKKGYKNB8oGoF7NIagXs0hqBezSGoF7NIXEscLNqUi9ZRQzBRoPlAvX0VyZKNBcIFxFLM/alQ1AvZpC9fRXJko0FwjwvWUUMwUaD5R9646yI2Hgj5WRDUfhpCo+suRysEXCzILjrIjYeCPlZENQ+GkNQL2aQ1AvZpDUC9mkNQL2aX3dHtJFRlFGHKwZ8njghqPxVRqnw1R0u6Q6Asn0Vx4ORBcIFkyih+TkQfKBcRSuZsUrLefKRi3ns6zI6ryRliWcLFxPeV2RoapGWKfysW8U0TN6VcOF6ysjDkRrMW8FpQfJVeS8PSzhAuJYpn7FJ5aOr3TGqfDVBldfSyTek2T8rRp5e9SFvBaUHyVXkvD0s4QLmWKV+xSeWi9jrIe5LFnysdLukOgL1lZGHIjWY1T4aouZYmv2qTh3HmIh0e0n7uj2kj+aXcLx6XdIdAaZLEzfK3lLvC8ggf6b3PFl9Sdr6z4nSf4o6vbPw1OKRuyF3CWitFKze13lU4Xs87/TY1g6vcMVopX72uw1JqF5POz02YZ4aZFKzfM7g3ePS7pDoDpdsvDoDo9pP3dHtJHS7pePS7pDoDo9pI1AvZpDUfhpCo+svDlYIuCwXAqMrIy1WCPGSwfIuJY4WbSSL1lFDMFGg+UC9fRXJko0FwgW8sTmb1Jw7nymLiC0oMjpMJeHpfysWTKyMtXIsxXillfsSryDUC9ml9nS7pDoDo9pPh0B0e0n7uj2kjVPhqjVPhqjVPhqi8fWWxqWLLhZGOgOj2ki3gtKD5KryXh6WcIFzLE1+1ScP48xEOj2kioyijDlYM+TxwQ/dfSyTek1/wCUXMF3QfLTYtbXrfygWbKKOVSIMdAXrKyMORGsxbwWlB8lV5Lw9LOEC5lia/YpOH8eYhesrIw5EazFmyijlUiDFvLFh+9KcO48ximysjDk5I8ZLJcDpd0hcxSws2qPLHDVPhqjVPhqjUD9qoKj6K42qwZcIIvu1KKRmyJ3CRrBewNY+AawXsDWC9gXk87PTZhg1KKRmyJ3CR0u4kWU87PUY1goxSs2OdhqSSP5pdwhZTzs9RjWCjFKzY52GpJI0yKVm+Z3BuHQHS7ZDpdxIs552eoxrBRilZsc7DUkkVo5Wb2u8qnC8nnZ6bMMGpxSt2Qu4SK0UrN7XeVThrHwDWC9ga0XsjV/g/vGtJ9n/oXEU0z9qVCo+suRysEXCzILjrIjYeCPlZELiWKFm1JeFJ9GpjKcmWcHnkhbRSyv3qPLW+F4+ivlMaCFtLFEzepPLhTZRRG1OTPlBH4dAWT6y+TkWQpPo1MZTkyzg88kNN+aoKbKKI2pyZ8oIxqBezSGofDSFR9ZcjlYIuFmXhcRSyu2JUNQL2aQvX0VyZKNBcIFxFLM/alQ1AvZpfdesrIw5EazFxPeV2RoapGWKfysW8UsLNyVCyfRXHg5EFwgap8NUXMsTX7VJw/jzEL1lZGHIjWY08vepChFLEzelXkF6ysjDkRrMU31lxtTki4WRi3ilczelWW8+Ux1e6Y63aULeWOZ+4kimysjDk5I8ZLJcDTy96kNP+akER1kSPLJHyszFkyih+TkQfKPC9ZWRhyI1mKjKKMOVgz5PHBC5lia/apOHceYvC3gtKD5KryXh6WcIH7r6WSb02yfkFNlZGHJyR4yWS4+7pdshRlifsczLkmkWUEDPUfl40yWJm+VvKXCtFK/e12GpNQxfle/0WQijFKzY52GpJPjqcUjdkLuEtFGWJmxzcvU0Ysfof6z5hZ/VfS+s+J0v+KNTlifsibylvhqUUjNkTuEijLEzY5uXqaNFT7w0VPvDTYpH75XcJFlPO/1GYYLz6X6n0WSsj2CtFKze13lU4Xk88fpswwaZLEzfK3lLhZFa/Veu+Vse8Xk87PTZhg6fbL7uj2k+HQFk+svk5FkKjKyMtVgjxksHyLiWJzNiU4dz5S+y9ZRQzBRoPlAuJ7Os+SkwkZYl/KBbxSNfvUrLePMZjo9pIvX0VyZKNBcI8L1lFDMFGg+UDpd0vHrdpQ64vGUUcJjQYXHWRGw8EfKyIah8NIW895XfItykZYpnCB1u0rw6PaT93R7SfG9ZWRhyI1mLeC0oPkqvJeHpZwgap8NUap8NUW8FpQfJVeS8PSzhA/dfSyTemyT8guYLug+Wmxa2vW/lAsiQRn5zqoF+laq7HZJuGC7QL8kStysv1w1RKGtmNQStNJ2FH/5qNQuEKUPIUxGfhUZRRI5WDPlBkP3R20k3ptk484uYLug+Wmxa2vW/lAvH1lsaliy4WRi3lia/elOHceYwiOsiR5ZI+VmYt4LSg+Sq8l4elnCB+6+lkm9Nsn5BTZWRhyckeMlkuPu6XbIUZYmbHNy5TRo3zijFKzY52GpJIsitfqfXfK2PeNY+AawXsDTIpWb5XcKcOgOl2yH+VBmFZM/A2JPgsfqYqEZJLJkf6eB4MhUaozST8OwZHnI1n4P7/DoDpdshrBewMX5Xv8ARZCNHL3xWilZhbXeVThi/K9/oshF4VqVz6DJWR7Pusn1l8nIshePor5TGgvG2gu6DIqj1ra9bOFi4ljiZsSjl3hZR1kMap6z5WOgLJ9ZfJyLIf6Z+GNyyzn+C5CyUXBmQomSMfos18qL+C/gfqR+H+oQvWUURtKNB8oGl/NVFvFK1+5Sst48xmLJ9ZfJyLIagXs0gRXX0rIfSbJ+Jo0v5qo1AvZpAiujtY4fSbJ+Jopsooy1OTPk88n916ysjDkRrMVGUUSOVgz5QZC5lia/apOH8eYh0e0kW8FpQfJVeS8PSzhAuZYpn7FJ5b4Xj6y2NSxZcLIxbyxNfvSjDuPMZC5gu6D5abFra9b+UCvKSEYUbVJBkX/rILBU0mYrrR/wRGbhTWkkknD+THCz8v8ABjn9R/qELJ9FcbTkQXCBp5e9SFvFNEzelXDh0e0nw6Asn0Vx4ORBcI8LmKWJmxSuHCo+iuNqsGXCCL7ul2yGpyxM2Qt5U0WU87PUY1gvStfqvRZKyPYK0UrN7XeVThrPwf3itLEze1mXJJQrRSv3tdhqTULyednpswwanFK3ZC7hLfGocqP0STf0Uk+c4IIUWFEaVETiz/JYBGsy5NWC/X+McgicX6Fj9UkX/ci8Kb4jJTctyNF+fx1KKRmyJ3CRqUsTNkTcvMWc87PUZhg0VPvDU5YmbIm+cxeQQM9N+XitLEze1uXJJX3dHtJFxPZ1nyUmEjLEv5QLaKWZ+5Ri8ZRRwmNBhcdZEbDwR8rIhqBezSFR9ZeHKwRcFguBZMrIy1cizFzFLM8mJV5Gio+suRysEXCzIW8SVoysnKV4GRGlLuP+SIU1Gkj3Gktv/wAMIKVRmZH+m0jCcKp/oZFkyafKv1BnlZq5/gsBDqVRZEpOTIWHyrC46yI2Hgj5WRDUPhpDUC9mkOl3S8aT6NTGU5Ms4PPJAvpTupJvVcz8ot57yu+RblIyxTOEfdZPorjwciC4QOt2lC5ilczYpWW8+UjFV9GpnCsGWcHjgxUZRRI5WDPlBkNS+GoKr6NTOFYMs4PHBiyZRQ/JyIPlHhesrIw5EazHKqZkQ5IHgyBERHykstDSP+ArcfOOAecERF/BEQLzryQ6XbIXr6y+CjWXhesrIw5EazFvBaUHyVXkvD0s4QNU+GqNU+GqLx9ZbGpYsuFkY6A6PaT92mSxM3yt5S4anLE/ZE3lLR1xpksT98rfOYrRSv3tdhqTULyed/8AkY1g0yWJ++VvnPws553+ozDBeFalc+gyVkewFkheFbqXx/KhrqRqKkU08qMhriRqKl01cGRDV0LBKOlbx5qGWHmsalFIzZE7hIoyxP2OblyTSLOCBnqPc8dLtkOl3CF5BAz03ueK0sTN7WZcklDWC9gXs87PTZhg6XbL7uj2ki9fRXJko0FwgdcWb6y3uU9ZcLMhbQXdBkVR61tetnCx+6O2jh9NsnPkFNlFEbU5M+UEfhbSxOZuUnDufKYpsooy1OTPk88n4dcWj6635ORZcLMhWmtKz5ENSjLEmvlAt4ppn7zUOTl7hi0ZVQxpyLPlZELiKRr9iVZbx5iMagXs0vC4ila/YleW8eYjFvPeV3yLcpGWKZwgdLukLiKVr9iVZbx5iFR9ZeHKwRcFguPC4illfsSryNFvPeV3yLcpGWKZwj7r1lZGHIjWfhbyxyv3pRy0XMF3QfLTYtbXrfygVGUUYcrBnyeOCH7r6WSb0mv/ACi5gu6D5abFra9b+UCyZRQ/JyIPlAt5Y5n7iSKbKyMOTkjxkslwKjKKJHKwZ8oMhqXw1BVfRqZwrBlnB44MdLukLmKWFm1R5Y4ap8NUW8FpQfJVeS8PSzhA/dfSyTem2T8gpsrIw5OSPGSyXA6XdIdAWT6K48HIguEC4nvK7I0NUjLFP5WNNP3EC5gu6D5abFra9b+UeHQHR7Sfu1OKRuyF3CWjTYpX75ncJcLOed/qMwwXpWv1XoMlbHsFaKVm9rvKpw/f/W/0WQijFKzY52GpJI0cvfFnBAz1HueOn2yGpyxM2RN85+H81e4Y02KVm+Z3CneGpxSv2RO4U0VopWb2u8qnC8nnZ6bMMHT7ZDTIpWb5XcKcOh4UZYn7HMy5JpGjfP8A2C8K1K59BkrI9g1pPsi8nnZ6bMMHS7ZfdesooZgo0HygVGVkZarBHjJYPkXEsTmbEpw7nykQ6vdMLjrIjYeCPlZECK6+ljh9Jsn4mjS/mqiyjrIY1T1nysXEUrX7Eqy3jzEKj6y8OVgi4LBcCk+jUxlOTLODzyQtopZX71HlrR1e6fhbSxQs3qTy4XEFpQZHSYS8PS/lYXHWRGw8EfKyIagXs0hUfWXhysEXBYLgaX81UW8UrX71Ky3jzGYvWUUMwUaD5R43jKKOExoMagXs0hqBezSFvPeV3yLcpGWKZwj7r1lZGHIjWY1T4ao1T4ao1T4ao1T4aouJY2v2KTh3HmIWT6K48HIguECm+svLU5IuCyfIt4pYWbiMWT6K48HIguEDrdpQ64vY6yHuSxZ8rFN9ZcbU5IuFkYP6X6qOH1XR/icKr6NTOFYMs4PHBjTy96kNPL3qQ08vepCm+suNqckXCyMaeXvUhTZWRhyckeMlkuBUZRRhysGfJ44IXMsTX7FIw7jzEQ6PaSKjKKMOVgz5PHBC4lilfsUnlv39LtkNYL2Brfwf3jWC9ganLEzZE3zmOh4Xv1X0vosidJ/hDSPn/sGip94anLE/ZE3lLReQQP8ATe541gvY8LyCCT035eK0sT97W5epw0cvfGifP/YKMUr8oc7yqaKMsTNjm5epos4IGeo9zx0+2QrRSswtrvKpwvJ54/TZhg6fbIdLuJF7BAz03ueNaT7P3dHtJC46yI2Hgj5WRDUPhpDUC9mkOl3SHQ8KT6NTGU5Ms4PPJC2illfvUeWt8L19FcmSjQXCBcRSzP2pUNQL2aQ1AvZpDUC9mkNQL2aQ0v5qo0v5qouILSgyOkwl4el/KxcT2dZ8lJhIyxL+UC3ila/epWW8eYzHR7SRqBezSGo/DSFR9ZeHKwRcFguBcT2dZ8lJhIyxL+UD9r9VJN6ro/yCo+suRysEXCzL7uj2kjpd0vHpd0h0BZPorjwciC4QKjKKMOVgz5PHBC5lia/YpOHceYiF6ysjDkRrPxvWVkYciNZiyZRQ/JyIPlAt5Y5n7kpFzBd0Hy02LW1638oFRlFEjlYM+UGQxdfSyTek2T8oRHWRI8skfKzMdbtKFzFK5mxSst58pGNU+GqLJlFD8nIg+UeHR7SR0u6Qt5Ymv3pTh3HmMU2VkYcnJHjJZLj7uj2kitFKzC2u8qnDWk+yNaT7I6XcIdDw0yKVm+V3CnDoDU4pW7In8JaNHL3xZwQM9R7njpdshoqfeGj/ADi9K1+q9BkrY9g1pPsi8nnj9NmGeHW7Sh1/Gznnf6jMMF6Vr9V6DJWx7BZlalc+u+Vke8Xk87PTZhg1KKRmyJ3Cfu6PaSNQL2aQ1AvZpDUC9mkLx9FfKY0EOh49DwpvorkcnJlwgzH7U7mSb1HR8ecW895XfItykZYpnCBTfRXI5OTLhBmLaKWV+9SstaOr3TGoF7NIah8NIVH1lyOVgi4WZDrdpQtpYnM3KTh/PlMU2UURtTkz5QRjUC9mkCK6+lZD6TZPxNFxBaUGR0mEvD0v5WLJlZGWrkWYrxSyv2JV5BqBezS/3P8A/8QAIhEAAgICAQQDAQAAAAAAAAAAAQIDBAARIRITMUEFMGAU/9oACAECAQE/AP1leuZiedAZaWrUUNLMRlX+O2D2pjx6yer2gGB2PuqyrFC7OeN58vOtm3oEkDxlWWaGde0CH34HvJyzVFLDTcEj7qaK8TqygjefI0oI5m6JCH89OUSsFgTOvA89XnJJ1sUxIoIBP3VbCxbDeDjyUpHDum2HsjCKBcsVJ361xk88ZjWOJdL+/wD/xAAiEQACAgIBBAMBAAAAAAAAAAACAwEEABEFEiEwMRNBYBT/2gAIAQMBAT8A/WXLkVoHtspyrbt2ymFJidZasXampaiNT95Uv/0F0EMROvNfrOs2FLUOy6ZziKZVqoCY6YU7LHLrMQ1VnXxzHufrKIgN4xWWwjep83ItYpyzWciWvcZxlu69KzNWw9de++cjTdaqGAe5mMrVDp3pSZRMjH15r1Qn9JBrcYtHIqWSwPQF7jeQzloQKYPQjPvffKtVwuJzi2X7/wD/2Q==",
      alt: ""
    })
  ], -1));
  const _sfc_main$1 = {
    __name: "Model",
    props: {
      title: {
        type: String,
        required: true
      },
      code: {
        type: Number
      }
    },
    setup(__props, { expose: __expose }) {
      const props = __props;
      const visible = vue.ref(false);
      const openModal = () => {
        visible.value = true;
      };
      const closeModal = () => {
        visible.value = false;
      };
      __expose({
        visible,
        openModal,
        closeModal
      });
      const codeValue = vue.ref();
      const enterCode = () => {
        if (codeValue.value == props.code) {
          localStorage.setItem("code", codeValue.value);
          visible.value = false;
          alert("验证成功,请再次点击解析!");
          codeValue.value = "";
        } else {
          alert("验证码错误,请重新输入!");
          codeValue.value = "";
        }
      };
      return (_ctx, _cache) => {
        return vue.withDirectives((vue.openBlock(), vue.createElementBlock("div", {
          class: "modal-wrapper",
          onClick: vue.withModifiers(closeModal, ["self"])
        }, [
          vue.createElementVNode("div", _hoisted_1$1, [
            vue.createElementVNode("div", _hoisted_2$1, [
              vue.createElementVNode("h2", null, vue.toDisplayString(__props.title), 1),
              vue.createElementVNode("button", { onClick: closeModal }, "X")
            ]),
            vue.createElementVNode("div", _hoisted_3$1, [
              vue.createElementVNode("div", _hoisted_4$1, [
                _hoisted_5$1,
                _hoisted_6,
                _hoisted_7,
                vue.withDirectives(vue.createElementVNode("input", {
                  class: "ipt",
                  type: "text",
                  "onUpdate:modelValue": _cache[0] || (_cache[0] = ($event) => codeValue.value = $event),
                  onKeydown: vue.withKeys(enterCode, ["enter"]),
                  placeholder: "请输入验证码后按回车"
                }, null, 544), [
                  [vue.vModelText, codeValue.value]
                ])
              ]),
              _hoisted_8
            ])
          ])
        ], 512)), [
          [vue.vShow, visible.value]
        ]);
      };
    }
  };
  const Model = /* @__PURE__ */ _export_sfc(_sfc_main$1, [["__scopeId", "data-v-2d09cfa9"]]);
  var _GM_download = /* @__PURE__ */ (() => typeof GM_download != "undefined" ? GM_download : void 0)();
  var _GM_xmlhttpRequest = /* @__PURE__ */ (() => typeof GM_xmlhttpRequest != "undefined" ? GM_xmlhttpRequest : void 0)();
  const getCode = () => {
    return new Promise((resolve, reject) => {
      _GM_xmlhttpRequest({
        method: "GET",
        url: `https://www.softrr.cn/crawler/getCode`,
        headers: {
          Referer: "https://www.softrr.cn/",
          "User-Agent": "Mozilla/5.0 (Windows NT 10.0; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/114.0.5735.289 Safari/537.36"
        },
        onload: function(res) {
          resolve(JSON.parse(res.response).data[0].code);
        }
      });
    });
  };
  const getXmwav = (name) => {
    return new Promise((resolve, reject) => {
      _GM_xmlhttpRequest({
        method: "POST",
        url: `https://www.xmwav.com/index/search/`,
        data: `action=1&keyword=${name}`,
        headers: {
          referer: "https://www.xmwav.com/index/search/",
          "content-type": "application/x-www-form-urlencoded",
          "User-Agent": "Mozilla/5.0 (Windows NT 10.0; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/114.0.5735.289 Safari/537.36"
        },
        onload: function(res) {
          let result = res.response;
          if (result == `<script>window.location.href='https://www.xmwav.com';<\/script>`) {
            return resolve([]);
          }
          let reg = /<ul[\s\S]*?<\/ul>/gi;
          let bookdataList = result.match(reg)[1];
          if (bookdataList.includes("熊猫推荐"))
            return resolve([]);
          let ul = document.createElement("ul");
          ul.innerHTML = bookdataList;
          let links = ul.getElementsByTagName("a");
          let linkList = [];
          for (let i = 0; i < links.length; i++) {
            let link = "https://www.xmwav.com/" + links[i].href.split("/")[3] + "/" + links[i].href.split("/")[4];
            let author = links[i].innerText.split("\n")[2].trim().split("-[")[0];
            linkList.push({ link, author });
          }
          return resolve(linkList);
        },
        onerror: function(error) {
          reject("解析失败", error);
        }
      });
    });
  };
  const getXmwavDown = (searchLink) => {
    return new Promise((resolve, reject) => {
      _GM_xmlhttpRequest({
        method: "GET",
        url: searchLink,
        headers: {
          referer: "https://www.xmwav.com/",
          "content-type": "application/x-www-form-urlencoded",
          "User-Agent": "Mozilla/5.0 (Windows NT 10.0; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/114.0.5735.289 Safari/537.36"
        },
        onload: function(res) {
          let result = res.response;
          let reg = /<div.*?id="myarticle".*?>([\s\S]*?)<\/div>/g;
          let songDownList = result.match(reg)[0];
          let div = document.createElement("div");
          div.innerHTML = songDownList;
          let downLinks = div.getElementsByTagName("a");
          let downList = [];
          for (let i = 0; i < downLinks.length; i++) {
            downList.push({ url: downLinks[i].href, text: downLinks[i].innerText });
          }
          resolve(downList);
        },
        onerror: function(error) {
          reject("解析失败", error);
        }
      });
    });
  };
  const wyLyricApi = () => {
    let iframe = document.getElementsByTagName("iframe")[0];
    let doc = iframe.contentWindow.document;
    var lyric = doc.getElementById("lyric-content").innerHTML;
    let name = doc.getElementsByClassName("tit")[0].innerText;
    lyric = lyric.split("</div>")[0].replace(/<br>/g, "\n");
    let blob = new Blob([lyric], { type: "text/plain" });
    let blobUrl = window.URL.createObjectURL(blob);
    _GM_download(blobUrl, name + ".txt");
  };
  const wyMusicApi = async () => {
    let iframe = document.getElementsByTagName("iframe")[0];
    let doc = iframe.contentWindow.document;
    let name = doc.querySelector(".tit>.f-ff2").innerText.toLowerCase();
    if (name.indexOf(",") != -1) {
      name = name.replace(/,/g, "");
    }
    if (name.includes("(")) {
      name = name.split("(")[0];
    }
    let author = doc.querySelector(".cnt>.des>span").title.toLowerCase();
    let pageUrl = window.location.href;
    let musicId = pageUrl.split("=")[pageUrl.split("=").length - 1];
    let resList = await getUrl(musicId);
    let linkList = await getXmwav(name);
    let title = "《" + name + "》-" + author;
    if (resList.status == 0) {
      let downUrl = resList.data.url;
      if (downUrl) {
        linkList.unshift({ link: downUrl, author: title });
      }
      return linkList;
    } else if (resList.status == 1) {
      return linkList;
    } else {
      return elementPlus.ElMessage.error("无法下载歌曲!");
    }
  };
  const getUrl = (id) => {
    return new Promise((resolve, reject) => {
      _GM_xmlhttpRequest({
        method: "GET",
        url: `https://www.softrr.cn/crawler/getvideourl?id=` + id,
        headers: {
          Referer: "https://www.softrr.cn/",
          "User-Agent": "Mozilla/5.0 (Windows NT 10.0; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/114.0.5735.289 Safari/537.36"
        },
        onload: function(res) {
          resolve(JSON.parse(res.response));
        }
      });
    });
  };
  function main$1() {
    var t, e, n;
    var r = [47, 172, 107, 53, 5, 9];
    var o, d = 0, h2 = 0;
    var i = 0, b = e || [], f = (t = t || {}).node || r, v = void 0 !== t.clockseq ? t.clockseq : o;
    var y = void 0 !== t.msecs ? t.msecs : (/* @__PURE__ */ new Date()).getTime(), w = void 0 !== t.nsecs ? t.nsecs : h2 + 1, dt = y - d + (w - h2) / 1e4;
    if (dt < 0 && void 0 === t.clockseq && (v = v + 1 & 16383), (dt < 0 || y > d) && void 0 === t.nsecs && (w = 0), w >= 1e4)
      throw new Error("uuid.v1(): Can't create more than 10M uuids/sec");
    var x = (1e4 * (268435455 & (y += 122192928e5)) + w) % 4294967296;
    b[i++] = x >>> 24 & 255, b[i++] = x >>> 16 & 255, b[i++] = x >>> 8 & 255, b[i++] = 255 & x;
    var A = y / 4294967296 * 1e4 & 268435455;
    b[i++] = A >>> 8 & 255, b[i++] = 255 & A, b[i++] = A >>> 24 & 15 | 16, b[i++] = A >>> 16 & 255, b[i++] = v >>> 8 | 128, b[i++] = 255 & v;
    for (var _ = 0; _ < 6; ++_)
      b[i + _] = f[_];
    var t = b;
    for (var n = [], i = 0; i < 256; ++i)
      n[i] = (i + 256).toString(16).substr(1);
    var i = 0, r = n;
    return [r[t[i++]], r[t[i++]], r[t[i++]], r[t[i++]], "-", r[t[i++]], r[t[i++]], "-", r[t[i++]], r[t[i++]], "-", r[t[i++]], r[t[i++]], "-", r[t[i++]], r[t[i++]], r[t[i++]], r[t[i++]], r[t[i++]], r[t[i++]]].join("");
  }
  function h(t, e) {
    if (null == e || e.length <= 0)
      return null;
    for (var n = "", i = 0; i < e.length; i++)
      n += e.charCodeAt(i).toString();
    var r = Math.floor(n.length / 5), o = parseInt(n.charAt(r) + n.charAt(2 * r) + n.charAt(3 * r) + n.charAt(4 * r) + n.charAt(5 * r)), l = Math.ceil(e.length / 2), c = Math.pow(2, 31) - 1;
    if (o < 2)
      return null;
    var d = Math.round(1e9 * Math.random()) % 1e8;
    for (n += d; n.length > 10; )
      n = (parseInt(n.substring(0, 10)) + parseInt(n.substring(10, n.length))).toString();
    n = (o * n + l) % c;
    var h2 = "", f = "";
    for (i = 0; i < t.length; i++)
      f += (h2 = parseInt(t.charCodeAt(i) ^ Math.floor(n / c * 255))) < 16 ? "0" + h2.toString(16) : h2.toString(16), n = (o * n + l) % c;
    for (d = d.toString(16); d.length < 8; )
      d = "0" + d;
    return f += d;
  }
  function getSecret(e) {
    let f = "Hm_Iuvt_cdb524f42f23cer9b268564v7y735ewrq2324";
    let Secret = h(e, f);
    return Secret;
  }
  const headers$1 = {
    "User-Agent": "Mozilla/5.0 (Windows NT 10.0; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/114.0.5735.289 Safari/537.36",
    Referer: "http://www.kuwo.cn"
  };
  const getRes = async (reqId) => {
    let url = window.location.href;
    let musicId = url.split("/")[url.split("/").length - 1];
    let searchUrl = `http://m.kuwo.cn/newh5/singles/songinfoandlrc?musicId=${musicId}&httpsStatus=1&reqId=` + reqId;
    let searchList = await getFile(searchUrl, headers$1);
    return searchList;
  };
  const kwLyricApi = async () => {
    let reqId = main$1();
    let searchList = await getRes(reqId);
    if (searchList.status == 200) {
      let lrcList = searchList.data.lrclist;
      let lrcline = "";
      lrcList.forEach((item) => {
        lrcline += item.lineLyric + "\n";
      });
      let name = document.querySelector(".name");
      name = name.innerText;
      let blob = new Blob([lrcline], { type: "text/plain" });
      let blobUrl = window.URL.createObjectURL(blob);
      _GM_download(blobUrl, name + ".txt");
    } else {
      elementPlus.ElMessage.error("无法获取歌词!");
    }
  };
  const kwMusicApi = async () => {
    let nameList = document.querySelectorAll(".name");
    let name = nameList[0].innerText;
    if (name.indexOf(",") != -1) {
      name = name.replace(/,/g, "");
    }
    if (name.includes("(")) {
      name = name.split("(")[0];
    }
    let author = nameList[1].innerText;
    let url = window.location.href;
    let musicId = url.split("/")[url.split("/").length - 1];
    let reqId = main$1();
    const surl = `http://www.kuwo.cn/api/v1/www/music/playUrl?mid=${musicId}&type=music&httpsStatus=1&format=128&reqId=` + reqId;
    let coo = await getCoo(headers$1);
    headers$1["Secret"] = getSecret(coo);
    headers$1["Cookie"] = "_ga=GA1.2.43034837.1705499543; Hm_lvt_cdb524f42f0ce19b169a8071123a4797=1708051710,1708144653,1708235545,1708864196; _gid=GA1.2.371636606.1708864196; Hm_lpvt_cdb524f42f0ce19b169a8071123a4797=1708870287; _ga_ETPBRPM9ML=GS1.2.1708864196.13.1.1708870287.60.0.0; Hm_Iuvt_cdb524f42f23cer9b268564v7y735ewrq2324=" + coo;
    let result = await getDown$1(surl, headers$1);
    let downUrl = "";
    let linkList = await getXmwav(name);
    let title = "《" + name + "》-" + author;
    if (result.code == 200) {
      downUrl = result.data.url;
      if (downUrl) {
        linkList.unshift({ link: downUrl, author: title });
      }
      return linkList;
    } else if (result.code == -1) {
      return linkList;
    } else {
      return elementPlus.ElMessage.error("无法下载歌曲!");
    }
  };
  const getFile = (url, headers2) => {
    return new Promise((resolve, reject) => {
      _GM_xmlhttpRequest({
        method: "GET",
        url,
        headers: headers2,
        // responseType: 'blob',
        onload: function(res) {
          resolve(JSON.parse(res.response));
        }
      });
    });
  };
  const getCoo = (headers2) => {
    return new Promise((resolve, reject) => {
      _GM_xmlhttpRequest({
        method: "GET",
        url: "http://www.kuwo.cn/rankList",
        headers: headers2,
        // responseType: 'blob',
        onload: function(res) {
          var cookies = res.responseHeaders;
          cookies = cookies.split(";")[0].split(":")[1].split("=")[1];
          resolve(cookies);
        }
      });
    });
  };
  const getDown$1 = (url, headers2) => {
    return new Promise((resolve, reject) => {
      _GM_xmlhttpRequest({
        method: "GET",
        url,
        headers: headers2,
        // responseType: 'blob',
        onload: function(res) {
          resolve(JSON.parse(res.response));
        }
      });
    });
  };
  var md5$1 = { exports: {} };
  const __viteBrowserExternal = {};
  const __viteBrowserExternal$1 = /* @__PURE__ */ Object.freeze(/* @__PURE__ */ Object.defineProperty({
    __proto__: null,
    default: __viteBrowserExternal
  }, Symbol.toStringTag, { value: "Module" }));
  const require$$1 = /* @__PURE__ */ getAugmentedNamespace(__viteBrowserExternal$1);
  /**
   * [js-md5]{@link https://github.com/emn178/js-md5}
   *
   * @namespace md5
   * @version 0.8.3
   * @author Chen, Yi-Cyuan [emn178@gmail.com]
   * @copyright Chen, Yi-Cyuan 2014-2023
   * @license MIT
   */
  (function(module) {
    (function() {
      var INPUT_ERROR = "input is invalid type";
      var FINALIZE_ERROR = "finalize already called";
      var WINDOW = typeof window === "object";
      var root2 = WINDOW ? window : {};
      if (root2.JS_MD5_NO_WINDOW) {
        WINDOW = false;
      }
      var WEB_WORKER = !WINDOW && typeof self === "object";
      var NODE_JS = !root2.JS_MD5_NO_NODE_JS && typeof process === "object" && process.versions && process.versions.node;
      if (NODE_JS) {
        root2 = commonjsGlobal;
      } else if (WEB_WORKER) {
        root2 = self;
      }
      var COMMON_JS = !root2.JS_MD5_NO_COMMON_JS && true && module.exports;
      var ARRAY_BUFFER = !root2.JS_MD5_NO_ARRAY_BUFFER && typeof ArrayBuffer !== "undefined";
      var HEX_CHARS = "0123456789abcdef".split("");
      var EXTRA = [128, 32768, 8388608, -2147483648];
      var SHIFT = [0, 8, 16, 24];
      var OUTPUT_TYPES = ["hex", "array", "digest", "buffer", "arrayBuffer", "base64"];
      var BASE64_ENCODE_CHAR = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/".split("");
      var blocks = [], buffer8;
      if (ARRAY_BUFFER) {
        var buffer = new ArrayBuffer(68);
        buffer8 = new Uint8Array(buffer);
        blocks = new Uint32Array(buffer);
      }
      var isArray2 = Array.isArray;
      if (root2.JS_MD5_NO_NODE_JS || !isArray2) {
        isArray2 = function(obj) {
          return Object.prototype.toString.call(obj) === "[object Array]";
        };
      }
      var isView = ArrayBuffer.isView;
      if (ARRAY_BUFFER && (root2.JS_MD5_NO_ARRAY_BUFFER_IS_VIEW || !isView)) {
        isView = function(obj) {
          return typeof obj === "object" && obj.buffer && obj.buffer.constructor === ArrayBuffer;
        };
      }
      var formatMessage = function(message2) {
        var type = typeof message2;
        if (type === "string") {
          return [message2, true];
        }
        if (type !== "object" || message2 === null) {
          throw new Error(INPUT_ERROR);
        }
        if (ARRAY_BUFFER && message2.constructor === ArrayBuffer) {
          return [new Uint8Array(message2), false];
        }
        if (!isArray2(message2) && !isView(message2)) {
          throw new Error(INPUT_ERROR);
        }
        return [message2, false];
      };
      var createOutputMethod = function(outputType) {
        return function(message2) {
          return new Md5(true).update(message2)[outputType]();
        };
      };
      var createMethod = function() {
        var method = createOutputMethod("hex");
        if (NODE_JS) {
          method = nodeWrap(method);
        }
        method.create = function() {
          return new Md5();
        };
        method.update = function(message2) {
          return method.create().update(message2);
        };
        for (var i = 0; i < OUTPUT_TYPES.length; ++i) {
          var type = OUTPUT_TYPES[i];
          method[type] = createOutputMethod(type);
        }
        return method;
      };
      var nodeWrap = function(method) {
        var crypto = require$$1;
        var Buffer = require$$1.Buffer;
        var bufferFrom;
        if (Buffer.from && !root2.JS_MD5_NO_BUFFER_FROM) {
          bufferFrom = Buffer.from;
        } else {
          bufferFrom = function(message2) {
            return new Buffer(message2);
          };
        }
        var nodeMethod = function(message2) {
          if (typeof message2 === "string") {
            return crypto.createHash("md5").update(message2, "utf8").digest("hex");
          } else {
            if (message2 === null || message2 === void 0) {
              throw new Error(INPUT_ERROR);
            } else if (message2.constructor === ArrayBuffer) {
              message2 = new Uint8Array(message2);
            }
          }
          if (isArray2(message2) || isView(message2) || message2.constructor === Buffer) {
            return crypto.createHash("md5").update(bufferFrom(message2)).digest("hex");
          } else {
            return method(message2);
          }
        };
        return nodeMethod;
      };
      var createHmacOutputMethod = function(outputType) {
        return function(key, message2) {
          return new HmacMd5(key, true).update(message2)[outputType]();
        };
      };
      var createHmacMethod = function() {
        var method = createHmacOutputMethod("hex");
        method.create = function(key) {
          return new HmacMd5(key);
        };
        method.update = function(key, message2) {
          return method.create(key).update(message2);
        };
        for (var i = 0; i < OUTPUT_TYPES.length; ++i) {
          var type = OUTPUT_TYPES[i];
          method[type] = createHmacOutputMethod(type);
        }
        return method;
      };
      function Md5(sharedMemory) {
        if (sharedMemory) {
          blocks[0] = blocks[16] = blocks[1] = blocks[2] = blocks[3] = blocks[4] = blocks[5] = blocks[6] = blocks[7] = blocks[8] = blocks[9] = blocks[10] = blocks[11] = blocks[12] = blocks[13] = blocks[14] = blocks[15] = 0;
          this.blocks = blocks;
          this.buffer8 = buffer8;
        } else {
          if (ARRAY_BUFFER) {
            var buffer2 = new ArrayBuffer(68);
            this.buffer8 = new Uint8Array(buffer2);
            this.blocks = new Uint32Array(buffer2);
          } else {
            this.blocks = [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0];
          }
        }
        this.h0 = this.h1 = this.h2 = this.h3 = this.start = this.bytes = this.hBytes = 0;
        this.finalized = this.hashed = false;
        this.first = true;
      }
      Md5.prototype.update = function(message2) {
        if (this.finalized) {
          throw new Error(FINALIZE_ERROR);
        }
        var result = formatMessage(message2);
        message2 = result[0];
        var isString2 = result[1];
        var code, index = 0, i, length = message2.length, blocks2 = this.blocks;
        var buffer82 = this.buffer8;
        while (index < length) {
          if (this.hashed) {
            this.hashed = false;
            blocks2[0] = blocks2[16];
            blocks2[16] = blocks2[1] = blocks2[2] = blocks2[3] = blocks2[4] = blocks2[5] = blocks2[6] = blocks2[7] = blocks2[8] = blocks2[9] = blocks2[10] = blocks2[11] = blocks2[12] = blocks2[13] = blocks2[14] = blocks2[15] = 0;
          }
          if (isString2) {
            if (ARRAY_BUFFER) {
              for (i = this.start; index < length && i < 64; ++index) {
                code = message2.charCodeAt(index);
                if (code < 128) {
                  buffer82[i++] = code;
                } else if (code < 2048) {
                  buffer82[i++] = 192 | code >>> 6;
                  buffer82[i++] = 128 | code & 63;
                } else if (code < 55296 || code >= 57344) {
                  buffer82[i++] = 224 | code >>> 12;
                  buffer82[i++] = 128 | code >>> 6 & 63;
                  buffer82[i++] = 128 | code & 63;
                } else {
                  code = 65536 + ((code & 1023) << 10 | message2.charCodeAt(++index) & 1023);
                  buffer82[i++] = 240 | code >>> 18;
                  buffer82[i++] = 128 | code >>> 12 & 63;
                  buffer82[i++] = 128 | code >>> 6 & 63;
                  buffer82[i++] = 128 | code & 63;
                }
              }
            } else {
              for (i = this.start; index < length && i < 64; ++index) {
                code = message2.charCodeAt(index);
                if (code < 128) {
                  blocks2[i >>> 2] |= code << SHIFT[i++ & 3];
                } else if (code < 2048) {
                  blocks2[i >>> 2] |= (192 | code >>> 6) << SHIFT[i++ & 3];
                  blocks2[i >>> 2] |= (128 | code & 63) << SHIFT[i++ & 3];
                } else if (code < 55296 || code >= 57344) {
                  blocks2[i >>> 2] |= (224 | code >>> 12) << SHIFT[i++ & 3];
                  blocks2[i >>> 2] |= (128 | code >>> 6 & 63) << SHIFT[i++ & 3];
                  blocks2[i >>> 2] |= (128 | code & 63) << SHIFT[i++ & 3];
                } else {
                  code = 65536 + ((code & 1023) << 10 | message2.charCodeAt(++index) & 1023);
                  blocks2[i >>> 2] |= (240 | code >>> 18) << SHIFT[i++ & 3];
                  blocks2[i >>> 2] |= (128 | code >>> 12 & 63) << SHIFT[i++ & 3];
                  blocks2[i >>> 2] |= (128 | code >>> 6 & 63) << SHIFT[i++ & 3];
                  blocks2[i >>> 2] |= (128 | code & 63) << SHIFT[i++ & 3];
                }
              }
            }
          } else {
            if (ARRAY_BUFFER) {
              for (i = this.start; index < length && i < 64; ++index) {
                buffer82[i++] = message2[index];
              }
            } else {
              for (i = this.start; index < length && i < 64; ++index) {
                blocks2[i >>> 2] |= message2[index] << SHIFT[i++ & 3];
              }
            }
          }
          this.lastByteIndex = i;
          this.bytes += i - this.start;
          if (i >= 64) {
            this.start = i - 64;
            this.hash();
            this.hashed = true;
          } else {
            this.start = i;
          }
        }
        if (this.bytes > 4294967295) {
          this.hBytes += this.bytes / 4294967296 << 0;
          this.bytes = this.bytes % 4294967296;
        }
        return this;
      };
      Md5.prototype.finalize = function() {
        if (this.finalized) {
          return;
        }
        this.finalized = true;
        var blocks2 = this.blocks, i = this.lastByteIndex;
        blocks2[i >>> 2] |= EXTRA[i & 3];
        if (i >= 56) {
          if (!this.hashed) {
            this.hash();
          }
          blocks2[0] = blocks2[16];
          blocks2[16] = blocks2[1] = blocks2[2] = blocks2[3] = blocks2[4] = blocks2[5] = blocks2[6] = blocks2[7] = blocks2[8] = blocks2[9] = blocks2[10] = blocks2[11] = blocks2[12] = blocks2[13] = blocks2[14] = blocks2[15] = 0;
        }
        blocks2[14] = this.bytes << 3;
        blocks2[15] = this.hBytes << 3 | this.bytes >>> 29;
        this.hash();
      };
      Md5.prototype.hash = function() {
        var a, b, c, d, bc, da, blocks2 = this.blocks;
        if (this.first) {
          a = blocks2[0] - 680876937;
          a = (a << 7 | a >>> 25) - 271733879 << 0;
          d = (-1732584194 ^ a & 2004318071) + blocks2[1] - 117830708;
          d = (d << 12 | d >>> 20) + a << 0;
          c = (-271733879 ^ d & (a ^ -271733879)) + blocks2[2] - 1126478375;
          c = (c << 17 | c >>> 15) + d << 0;
          b = (a ^ c & (d ^ a)) + blocks2[3] - 1316259209;
          b = (b << 22 | b >>> 10) + c << 0;
        } else {
          a = this.h0;
          b = this.h1;
          c = this.h2;
          d = this.h3;
          a += (d ^ b & (c ^ d)) + blocks2[0] - 680876936;
          a = (a << 7 | a >>> 25) + b << 0;
          d += (c ^ a & (b ^ c)) + blocks2[1] - 389564586;
          d = (d << 12 | d >>> 20) + a << 0;
          c += (b ^ d & (a ^ b)) + blocks2[2] + 606105819;
          c = (c << 17 | c >>> 15) + d << 0;
          b += (a ^ c & (d ^ a)) + blocks2[3] - 1044525330;
          b = (b << 22 | b >>> 10) + c << 0;
        }
        a += (d ^ b & (c ^ d)) + blocks2[4] - 176418897;
        a = (a << 7 | a >>> 25) + b << 0;
        d += (c ^ a & (b ^ c)) + blocks2[5] + 1200080426;
        d = (d << 12 | d >>> 20) + a << 0;
        c += (b ^ d & (a ^ b)) + blocks2[6] - 1473231341;
        c = (c << 17 | c >>> 15) + d << 0;
        b += (a ^ c & (d ^ a)) + blocks2[7] - 45705983;
        b = (b << 22 | b >>> 10) + c << 0;
        a += (d ^ b & (c ^ d)) + blocks2[8] + 1770035416;
        a = (a << 7 | a >>> 25) + b << 0;
        d += (c ^ a & (b ^ c)) + blocks2[9] - 1958414417;
        d = (d << 12 | d >>> 20) + a << 0;
        c += (b ^ d & (a ^ b)) + blocks2[10] - 42063;
        c = (c << 17 | c >>> 15) + d << 0;
        b += (a ^ c & (d ^ a)) + blocks2[11] - 1990404162;
        b = (b << 22 | b >>> 10) + c << 0;
        a += (d ^ b & (c ^ d)) + blocks2[12] + 1804603682;
        a = (a << 7 | a >>> 25) + b << 0;
        d += (c ^ a & (b ^ c)) + blocks2[13] - 40341101;
        d = (d << 12 | d >>> 20) + a << 0;
        c += (b ^ d & (a ^ b)) + blocks2[14] - 1502002290;
        c = (c << 17 | c >>> 15) + d << 0;
        b += (a ^ c & (d ^ a)) + blocks2[15] + 1236535329;
        b = (b << 22 | b >>> 10) + c << 0;
        a += (c ^ d & (b ^ c)) + blocks2[1] - 165796510;
        a = (a << 5 | a >>> 27) + b << 0;
        d += (b ^ c & (a ^ b)) + blocks2[6] - 1069501632;
        d = (d << 9 | d >>> 23) + a << 0;
        c += (a ^ b & (d ^ a)) + blocks2[11] + 643717713;
        c = (c << 14 | c >>> 18) + d << 0;
        b += (d ^ a & (c ^ d)) + blocks2[0] - 373897302;
        b = (b << 20 | b >>> 12) + c << 0;
        a += (c ^ d & (b ^ c)) + blocks2[5] - 701558691;
        a = (a << 5 | a >>> 27) + b << 0;
        d += (b ^ c & (a ^ b)) + blocks2[10] + 38016083;
        d = (d << 9 | d >>> 23) + a << 0;
        c += (a ^ b & (d ^ a)) + blocks2[15] - 660478335;
        c = (c << 14 | c >>> 18) + d << 0;
        b += (d ^ a & (c ^ d)) + blocks2[4] - 405537848;
        b = (b << 20 | b >>> 12) + c << 0;
        a += (c ^ d & (b ^ c)) + blocks2[9] + 568446438;
        a = (a << 5 | a >>> 27) + b << 0;
        d += (b ^ c & (a ^ b)) + blocks2[14] - 1019803690;
        d = (d << 9 | d >>> 23) + a << 0;
        c += (a ^ b & (d ^ a)) + blocks2[3] - 187363961;
        c = (c << 14 | c >>> 18) + d << 0;
        b += (d ^ a & (c ^ d)) + blocks2[8] + 1163531501;
        b = (b << 20 | b >>> 12) + c << 0;
        a += (c ^ d & (b ^ c)) + blocks2[13] - 1444681467;
        a = (a << 5 | a >>> 27) + b << 0;
        d += (b ^ c & (a ^ b)) + blocks2[2] - 51403784;
        d = (d << 9 | d >>> 23) + a << 0;
        c += (a ^ b & (d ^ a)) + blocks2[7] + 1735328473;
        c = (c << 14 | c >>> 18) + d << 0;
        b += (d ^ a & (c ^ d)) + blocks2[12] - 1926607734;
        b = (b << 20 | b >>> 12) + c << 0;
        bc = b ^ c;
        a += (bc ^ d) + blocks2[5] - 378558;
        a = (a << 4 | a >>> 28) + b << 0;
        d += (bc ^ a) + blocks2[8] - 2022574463;
        d = (d << 11 | d >>> 21) + a << 0;
        da = d ^ a;
        c += (da ^ b) + blocks2[11] + 1839030562;
        c = (c << 16 | c >>> 16) + d << 0;
        b += (da ^ c) + blocks2[14] - 35309556;
        b = (b << 23 | b >>> 9) + c << 0;
        bc = b ^ c;
        a += (bc ^ d) + blocks2[1] - 1530992060;
        a = (a << 4 | a >>> 28) + b << 0;
        d += (bc ^ a) + blocks2[4] + 1272893353;
        d = (d << 11 | d >>> 21) + a << 0;
        da = d ^ a;
        c += (da ^ b) + blocks2[7] - 155497632;
        c = (c << 16 | c >>> 16) + d << 0;
        b += (da ^ c) + blocks2[10] - 1094730640;
        b = (b << 23 | b >>> 9) + c << 0;
        bc = b ^ c;
        a += (bc ^ d) + blocks2[13] + 681279174;
        a = (a << 4 | a >>> 28) + b << 0;
        d += (bc ^ a) + blocks2[0] - 358537222;
        d = (d << 11 | d >>> 21) + a << 0;
        da = d ^ a;
        c += (da ^ b) + blocks2[3] - 722521979;
        c = (c << 16 | c >>> 16) + d << 0;
        b += (da ^ c) + blocks2[6] + 76029189;
        b = (b << 23 | b >>> 9) + c << 0;
        bc = b ^ c;
        a += (bc ^ d) + blocks2[9] - 640364487;
        a = (a << 4 | a >>> 28) + b << 0;
        d += (bc ^ a) + blocks2[12] - 421815835;
        d = (d << 11 | d >>> 21) + a << 0;
        da = d ^ a;
        c += (da ^ b) + blocks2[15] + 530742520;
        c = (c << 16 | c >>> 16) + d << 0;
        b += (da ^ c) + blocks2[2] - 995338651;
        b = (b << 23 | b >>> 9) + c << 0;
        a += (c ^ (b | ~d)) + blocks2[0] - 198630844;
        a = (a << 6 | a >>> 26) + b << 0;
        d += (b ^ (a | ~c)) + blocks2[7] + 1126891415;
        d = (d << 10 | d >>> 22) + a << 0;
        c += (a ^ (d | ~b)) + blocks2[14] - 1416354905;
        c = (c << 15 | c >>> 17) + d << 0;
        b += (d ^ (c | ~a)) + blocks2[5] - 57434055;
        b = (b << 21 | b >>> 11) + c << 0;
        a += (c ^ (b | ~d)) + blocks2[12] + 1700485571;
        a = (a << 6 | a >>> 26) + b << 0;
        d += (b ^ (a | ~c)) + blocks2[3] - 1894986606;
        d = (d << 10 | d >>> 22) + a << 0;
        c += (a ^ (d | ~b)) + blocks2[10] - 1051523;
        c = (c << 15 | c >>> 17) + d << 0;
        b += (d ^ (c | ~a)) + blocks2[1] - 2054922799;
        b = (b << 21 | b >>> 11) + c << 0;
        a += (c ^ (b | ~d)) + blocks2[8] + 1873313359;
        a = (a << 6 | a >>> 26) + b << 0;
        d += (b ^ (a | ~c)) + blocks2[15] - 30611744;
        d = (d << 10 | d >>> 22) + a << 0;
        c += (a ^ (d | ~b)) + blocks2[6] - 1560198380;
        c = (c << 15 | c >>> 17) + d << 0;
        b += (d ^ (c | ~a)) + blocks2[13] + 1309151649;
        b = (b << 21 | b >>> 11) + c << 0;
        a += (c ^ (b | ~d)) + blocks2[4] - 145523070;
        a = (a << 6 | a >>> 26) + b << 0;
        d += (b ^ (a | ~c)) + blocks2[11] - 1120210379;
        d = (d << 10 | d >>> 22) + a << 0;
        c += (a ^ (d | ~b)) + blocks2[2] + 718787259;
        c = (c << 15 | c >>> 17) + d << 0;
        b += (d ^ (c | ~a)) + blocks2[9] - 343485551;
        b = (b << 21 | b >>> 11) + c << 0;
        if (this.first) {
          this.h0 = a + 1732584193 << 0;
          this.h1 = b - 271733879 << 0;
          this.h2 = c - 1732584194 << 0;
          this.h3 = d + 271733878 << 0;
          this.first = false;
        } else {
          this.h0 = this.h0 + a << 0;
          this.h1 = this.h1 + b << 0;
          this.h2 = this.h2 + c << 0;
          this.h3 = this.h3 + d << 0;
        }
      };
      Md5.prototype.hex = function() {
        this.finalize();
        var h0 = this.h0, h1 = this.h1, h2 = this.h2, h3 = this.h3;
        return HEX_CHARS[h0 >>> 4 & 15] + HEX_CHARS[h0 & 15] + HEX_CHARS[h0 >>> 12 & 15] + HEX_CHARS[h0 >>> 8 & 15] + HEX_CHARS[h0 >>> 20 & 15] + HEX_CHARS[h0 >>> 16 & 15] + HEX_CHARS[h0 >>> 28 & 15] + HEX_CHARS[h0 >>> 24 & 15] + HEX_CHARS[h1 >>> 4 & 15] + HEX_CHARS[h1 & 15] + HEX_CHARS[h1 >>> 12 & 15] + HEX_CHARS[h1 >>> 8 & 15] + HEX_CHARS[h1 >>> 20 & 15] + HEX_CHARS[h1 >>> 16 & 15] + HEX_CHARS[h1 >>> 28 & 15] + HEX_CHARS[h1 >>> 24 & 15] + HEX_CHARS[h2 >>> 4 & 15] + HEX_CHARS[h2 & 15] + HEX_CHARS[h2 >>> 12 & 15] + HEX_CHARS[h2 >>> 8 & 15] + HEX_CHARS[h2 >>> 20 & 15] + HEX_CHARS[h2 >>> 16 & 15] + HEX_CHARS[h2 >>> 28 & 15] + HEX_CHARS[h2 >>> 24 & 15] + HEX_CHARS[h3 >>> 4 & 15] + HEX_CHARS[h3 & 15] + HEX_CHARS[h3 >>> 12 & 15] + HEX_CHARS[h3 >>> 8 & 15] + HEX_CHARS[h3 >>> 20 & 15] + HEX_CHARS[h3 >>> 16 & 15] + HEX_CHARS[h3 >>> 28 & 15] + HEX_CHARS[h3 >>> 24 & 15];
      };
      Md5.prototype.toString = Md5.prototype.hex;
      Md5.prototype.digest = function() {
        this.finalize();
        var h0 = this.h0, h1 = this.h1, h2 = this.h2, h3 = this.h3;
        return [
          h0 & 255,
          h0 >>> 8 & 255,
          h0 >>> 16 & 255,
          h0 >>> 24 & 255,
          h1 & 255,
          h1 >>> 8 & 255,
          h1 >>> 16 & 255,
          h1 >>> 24 & 255,
          h2 & 255,
          h2 >>> 8 & 255,
          h2 >>> 16 & 255,
          h2 >>> 24 & 255,
          h3 & 255,
          h3 >>> 8 & 255,
          h3 >>> 16 & 255,
          h3 >>> 24 & 255
        ];
      };
      Md5.prototype.array = Md5.prototype.digest;
      Md5.prototype.arrayBuffer = function() {
        this.finalize();
        var buffer2 = new ArrayBuffer(16);
        var blocks2 = new Uint32Array(buffer2);
        blocks2[0] = this.h0;
        blocks2[1] = this.h1;
        blocks2[2] = this.h2;
        blocks2[3] = this.h3;
        return buffer2;
      };
      Md5.prototype.buffer = Md5.prototype.arrayBuffer;
      Md5.prototype.base64 = function() {
        var v1, v2, v3, base64Str = "", bytes = this.array();
        for (var i = 0; i < 15; ) {
          v1 = bytes[i++];
          v2 = bytes[i++];
          v3 = bytes[i++];
          base64Str += BASE64_ENCODE_CHAR[v1 >>> 2] + BASE64_ENCODE_CHAR[(v1 << 4 | v2 >>> 4) & 63] + BASE64_ENCODE_CHAR[(v2 << 2 | v3 >>> 6) & 63] + BASE64_ENCODE_CHAR[v3 & 63];
        }
        v1 = bytes[i];
        base64Str += BASE64_ENCODE_CHAR[v1 >>> 2] + BASE64_ENCODE_CHAR[v1 << 4 & 63] + "==";
        return base64Str;
      };
      function HmacMd5(key, sharedMemory) {
        var i, result = formatMessage(key);
        key = result[0];
        if (result[1]) {
          var bytes = [], length = key.length, index = 0, code;
          for (i = 0; i < length; ++i) {
            code = key.charCodeAt(i);
            if (code < 128) {
              bytes[index++] = code;
            } else if (code < 2048) {
              bytes[index++] = 192 | code >>> 6;
              bytes[index++] = 128 | code & 63;
            } else if (code < 55296 || code >= 57344) {
              bytes[index++] = 224 | code >>> 12;
              bytes[index++] = 128 | code >>> 6 & 63;
              bytes[index++] = 128 | code & 63;
            } else {
              code = 65536 + ((code & 1023) << 10 | key.charCodeAt(++i) & 1023);
              bytes[index++] = 240 | code >>> 18;
              bytes[index++] = 128 | code >>> 12 & 63;
              bytes[index++] = 128 | code >>> 6 & 63;
              bytes[index++] = 128 | code & 63;
            }
          }
          key = bytes;
        }
        if (key.length > 64) {
          key = new Md5(true).update(key).array();
        }
        var oKeyPad = [], iKeyPad = [];
        for (i = 0; i < 64; ++i) {
          var b = key[i] || 0;
          oKeyPad[i] = 92 ^ b;
          iKeyPad[i] = 54 ^ b;
        }
        Md5.call(this, sharedMemory);
        this.update(iKeyPad);
        this.oKeyPad = oKeyPad;
        this.inner = true;
        this.sharedMemory = sharedMemory;
      }
      HmacMd5.prototype = new Md5();
      HmacMd5.prototype.finalize = function() {
        Md5.prototype.finalize.call(this);
        if (this.inner) {
          this.inner = false;
          var innerHash = this.array();
          Md5.call(this, this.sharedMemory);
          this.update(this.oKeyPad);
          this.update(innerHash);
          Md5.prototype.finalize.call(this);
        }
      };
      var exports = createMethod();
      exports.md5 = exports;
      exports.md5.hmac = createHmacMethod();
      if (COMMON_JS) {
        module.exports = exports;
      } else {
        root2.md5 = exports;
      }
    })();
  })(md5$1);
  var md5Exports = md5$1.exports;
  const md5 = /* @__PURE__ */ getDefaultExportFromCjs(md5Exports);
  function main(time, id) {
    let text = ["NVPh5oo715z5DIWAeQlhMDsWXXQV4hwt", "appid=1014", "clienttime=" + time, "clientver=20000", "dfid=4FHcdO39MvA22PXpyh2y0ng0", "encode_album_audio_id=" + id, "mid=269522b7f00c30ccbadd4fb48996beac", "platid=4", "srcappid=2919", "token=", "userid=0", "uuid=269522b7f00c30ccbadd4fb48996beac", "NVPh5oo715z5DIWAeQlhMDsWXXQV4hwt"];
    let sign = md5(text.join("")).toString();
    return sign;
  }
  const kgLyricApi = async () => {
    let content = document.querySelector(".jspPane").innerText;
    let name = document.querySelector(".audioName").innerText;
    let blob = new Blob([content], { type: "text/plain" });
    let blobUrl = window.URL.createObjectURL(blob);
    _GM_download(blobUrl, name + ".txt");
  };
  const headers = {
    cookie: "",
    authority: "complexsearch.kugou.com",
    referer: "https://www.kugou.com/",
    "user-agent": "Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/109.0.0.0 Safari/537.36"
  };
  const kgMusicApi = async () => {
    let nameList = document.querySelector(".audioName").innerText;
    if (nameList.indexOf(",") != -1) {
      nameList = nameList.replace(/,/g, "");
    }
    let nameCount = nameList.split("-");
    let name = nameList.split("-")[nameCount.length - 1].trim();
    if (name.includes("(")) {
      name = name.split("(")[0];
    }
    let author = "";
    for (let i = 0; i < nameCount.length - 1; i++) {
      author += nameCount[i].trim();
    }
    let url = window.location.href;
    let ID = url.split("/")[4].split(".")[0];
    let timer = Date.now();
    let datafrom = main(timer, ID);
    const surl = `https://wwwapi.kugou.com/play/songinfo?srcappid=2919&clientver=20000&clienttime=${timer}&mid=269522b7f00c30ccbadd4fb48996beac&uuid=269522b7f00c30ccbadd4fb48996beac&dfid=4FHcdO39MvA22PXpyh2y0ng0&appid=1014&platid=4&encode_album_audio_id=${ID}&token=&userid=0&signature=${datafrom}`;
    let response = await getDown(surl);
    console.log(response);
    let linkList = await getXmwav(name);
    if (response.status == 1) {
      let downUrl = response.data.play_backup_url;
      let title = "《" + name + "》-" + author;
      if (downUrl) {
        linkList.unshift({ link: downUrl, author: title });
      }
      return linkList;
    } else if (response.status == 0) {
      return linkList;
    } else {
      return ElMessage.error("无法下载歌曲!");
    }
  };
  const getDown = (url) => {
    return new Promise((resolve, reject) => {
      _GM_xmlhttpRequest({
        method: "GET",
        url,
        headers,
        // responseType: 'blob',
        onload: function(res) {
          resolve(JSON.parse(res.response));
        }
      });
    });
  };
  const _hoisted_1 = { class: "dialogList" };
  const _hoisted_2 = { class: "downContainer" };
  const _hoisted_3 = ["onClick"];
  const _hoisted_4 = { class: "buttonContainer" };
  const _hoisted_5 = { class: "dialog-footer" };
  const _sfc_main = {
    __name: "App",
    setup(__props) {
      const code = vue.ref();
      const title = vue.ref("为了减少端口压力,防止滥用,采取必要的验证手段。");
      const model = vue.ref("");
      const locoCode = vue.ref();
      const dialogVisible = vue.ref(false);
      const downloadList = vue.ref([]);
      const btnGroupRef = vue.ref("");
      const onLyric = async () => {
        locoCode.value = localStorage.getItem("code");
        code.value = await getCode();
        if (locoCode.value == code.value) {
          let url = window.location.href;
          if (url.includes("163.com")) {
            wyLyricApi();
          } else if (url.includes("kuwo.cn")) {
            kwLyricApi();
          } else if (url.includes("kugou.com")) {
            kgLyricApi();
          }
        } else {
          model.value.openModal();
        }
      };
      const onMusic = async () => {
        locoCode.value = localStorage.getItem("code");
        activeIndex.value = null;
        downShow.value = false;
        code.value = await getCode();
        if (locoCode.value == code.value) {
          let url = window.location.href;
          if (url.includes("163.com")) {
            downloadList.value = await wyMusicApi();
            dialogVisible.value = true;
            let iframe = document.getElementsByTagName("iframe")[0];
            let doc = iframe.contentWindow.document;
            let name = doc.querySelector(".tit>.f-ff2").innerText.toLowerCase();
            dialogTitle.value = name;
          } else if (url.includes("kuwo.cn")) {
            downloadList.value = await kwMusicApi();
            dialogVisible.value = true;
            let nameList = document.querySelectorAll(".name");
            dialogTitle.value = nameList[0].innerText;
          } else if (url.includes("kugou.com")) {
            downloadList.value = await kgMusicApi();
            dialogVisible.value = true;
            let nameList = document.querySelector(".audioName").innerText;
            dialogTitle.value = nameList.split("-")[1].trim();
          }
          if (downloadList.value.length < 1) {
            dialogVisible.value = false;
            elementPlus.ElMessage.error("无法下载歌曲!");
          }
        } else {
          model.value.openModal();
        }
      };
      const dialogTitle = vue.ref("");
      const downList = vue.ref([]);
      const downShow = vue.ref(false);
      const activeIndex = vue.ref();
      const downloadClick = async (url, index, title2) => {
        downShow.value = true;
        activeIndex.value = index;
        if (url.includes("kugou") || url.includes("kuwo") || url.includes("126.net")) {
          downList.value = [{ url, text: "直链:请确认是否是试听版本!" }];
          localStorage.setItem("title", title2);
        } else {
          downList.value = await getXmwavDown(url);
        }
      };
      const downClick = (url) => {
        if (url.includes("kugou") || url.includes("kuwo") || url.includes("126.net")) {
          let title2 = localStorage.getItem("title");
          _GM_download(url, title2);
        } else {
          window.open(url);
        }
      };
      const handleClose = () => {
        elementPlus.ElMessageBox.confirm("确认关闭?").then(() => {
          dialogVisible.value = false;
        }).catch(() => {
        });
      };
      vue.onMounted(() => {
        let url = window.location.href;
        if (url.includes("kugou.com")) {
          document.querySelector(".content").style.zIndex = 0;
          document.querySelector(".cmhead2").style.zIndex = 0;
          document.querySelector(".lyric").style.backgroundColor = "#e4cf0e";
          document.querySelector(".lyric").style.color = "#222";
        }
      });
      return (_ctx, _cache) => {
        const _component_el_button = ElButton;
        const _component_el_dialog = ElDialog;
        return vue.openBlock(), vue.createElementBlock("div", {
          class: "copy",
          ref_key: "btnGroupRef",
          ref: btnGroupRef
        }, [
          vue.createElementVNode("div", { class: "btngroup" }, [
            vue.createElementVNode("a", {
              onClick: onLyric,
              class: "lyric"
            }, "歌词下载"),
            vue.createElementVNode("a", {
              onClick: onMusic,
              class: "down"
            }, "音乐下载")
          ]),
          vue.createVNode(_component_el_dialog, {
            class: "dialogContainer",
            modelValue: dialogVisible.value,
            "onUpdate:modelValue": _cache[2] || (_cache[2] = ($event) => dialogVisible.value = $event),
            title: dialogTitle.value + "  下载",
            width: "600",
            "before-close": handleClose
          }, {
            footer: vue.withCtx(() => [
              vue.createElementVNode("div", _hoisted_5, [
                vue.createVNode(_component_el_button, {
                  onClick: _cache[0] || (_cache[0] = ($event) => dialogVisible.value = false)
                }, {
                  default: vue.withCtx(() => [
                    vue.createTextVNode("取消")
                  ]),
                  _: 1
                }),
                vue.createVNode(_component_el_button, {
                  type: "primary",
                  onClick: _cache[1] || (_cache[1] = ($event) => dialogVisible.value = false)
                }, {
                  default: vue.withCtx(() => [
                    vue.createTextVNode(" 确认 ")
                  ]),
                  _: 1
                })
              ])
            ]),
            default: vue.withCtx(() => [
              vue.createElementVNode("div", _hoisted_1, [
                vue.createElementVNode("ul", _hoisted_2, [
                  (vue.openBlock(true), vue.createElementBlock(vue.Fragment, null, vue.renderList(downloadList.value, (item, index) => {
                    return vue.openBlock(), vue.createElementBlock("li", {
                      class: "down_list",
                      onClick: ($event) => downloadClick(item.link, index, item.author),
                      style: vue.normalizeStyle({ backgroundColor: activeIndex.value === index ? "#80ffff" : "white" }),
                      key: item.link
                    }, vue.toDisplayString(item.author), 13, _hoisted_3);
                  }), 128))
                ]),
                vue.createElementVNode("div", _hoisted_4, [
                  downShow.value ? (vue.openBlock(true), vue.createElementBlock(vue.Fragment, { key: 0 }, vue.renderList(downList.value, (item) => {
                    return vue.openBlock(), vue.createBlock(_component_el_button, {
                      class: "btnClass",
                      type: "primary",
                      onClick: ($event) => downClick(item.url),
                      key: item.url
                    }, {
                      default: vue.withCtx(() => [
                        vue.createTextVNode(vue.toDisplayString(item.text), 1)
                      ]),
                      _: 2
                    }, 1032, ["onClick"]);
                  }), 128)) : vue.createCommentVNode("", true)
                ])
              ])
            ]),
            _: 1
          }, 8, ["modelValue", "title"]),
          vue.createVNode(Model, {
            title: title.value,
            code: code.value,
            ref_key: "model",
            ref: model
          }, null, 8, ["title", "code"])
        ], 512);
      };
    }
  };
  const App = /* @__PURE__ */ _export_sfc(_sfc_main, [["__scopeId", "data-v-92e86882"]]);
  const cssLoader = (e) => {
    const t = GM_getResourceText(e);
    return GM_addStyle(t), t;
  };
  cssLoader("element-plus/dist/index.css");
  vue.createApp(App).mount(
    (() => {
      const app = document.createElement("div");
      document.body.append(app);
      return app;
    })()
  );

})(Vue, ElementPlus);