Enhanced Scroll Position Cycler

Cycle through recent scroll positions with enhanced functionality

ही स्क्रिप्ट इंस्टॉल करण्यासाठी तुम्हाला Tampermonkey, Greasemonkey किंवा Violentmonkey यासारखे एक्स्टेंशन इंस्टॉल करावे लागेल.

ही स्क्रिप्ट इंस्टॉल करण्यासाठी तुम्हाला Tampermonkey किंवा Violentmonkey यासारखे एक्स्टेंशन इंस्टॉल करावे लागेल..

ही स्क्रिप्ट इंस्टॉल करण्यासाठी तुम्हाला Tampermonkey किंवा Violentmonkey यासारखे एक्स्टेंशन इंस्टॉल करावे लागेल..

You will need to install an extension such as Tampermonkey or Userscripts to install this script.

ही स्क्रिप्ट इंस्टॉल करण्यासाठी तुम्हाला Tampermonkey यासारखे एक्स्टेंशन इंस्टॉल करावे लागेल..

ही स्क्रिप्ट इंस्टॉल करण्यासाठी तुम्हाला एक युझर स्क्रिप्ट व्यवस्थापक एक्स्टेंशन इंस्टॉल करावे लागेल.

(माझ्याकडे आधीच युझर स्क्रिप्ट व्यवस्थापक आहे, मला इंस्टॉल करू द्या!)

ही स्टाईल इंस्टॉल करण्यासाठी तुम्हाला Stylus सारखे एक्स्टेंशन इंस्टॉल करावे लागेल.

ही स्टाईल इंस्टॉल करण्यासाठी तुम्हाला Stylus सारखे एक्स्टेंशन इंस्टॉल करावे लागेल.

ही स्टाईल इंस्टॉल करण्यासाठी तुम्हाला Stylus सारखे एक्स्टेंशन इंस्टॉल करावे लागेल.

ही स्टाईल इंस्टॉल करण्यासाठी तुम्हाला एक युझर स्टाईल व्यवस्थापक इंस्टॉल करावे लागेल.

ही स्टाईल इंस्टॉल करण्यासाठी तुम्हाला एक युझर स्टाईल व्यवस्थापक इंस्टॉल करावे लागेल.

ही स्टाईल इंस्टॉल करण्यासाठी तुम्हाला एक युझर स्टाईल व्यवस्थापक इंस्टॉल करावे लागेल.

(माझ्याकडे आधीच युझर स्टाईल व्यवस्थापक आहे, मला इंस्टॉल करू द्या!)

// ==UserScript==
// @name         Enhanced Scroll Position Cycler
// @namespace    http://tampermonkey.net/
// @license      MIT
// @version      1.0
// @author       Rekt
// @description  Cycle through recent scroll positions with enhanced functionality
// @match        *://*/*
// @grant        none
// ==/UserScript==
(function() {
    'use strict';

    let scrollPositions = [];
    let currentIndex = -1;
    let isSwitching = false;
    let switchStartTime = 0;
    let lastSwitchTime = 0;

    // Timing constants based on human reaction research
    const FAST_SWITCH_THRESHOLD = 180; // Visual reaction threshold[6]
    const POSITION_THRESHOLD = 250;    // Average reaction time[2][7]
    let positionTimer = null;

    function addPositionToList(position) {
        let index = scrollPositions.findIndex(p => Math.abs(p.y - position.y) < 50);
        if (index !== -1) {
            scrollPositions.splice(index, 1);
        }
        scrollPositions.unshift(position);
        if (scrollPositions.length > 10) {
            scrollPositions.pop();
        }
    }

    function recordScrollPosition() {
        clearTimeout(positionTimer);
        positionTimer = setTimeout(() => {
            let position = { y: window.pageYOffset };
            addPositionToList(position);
        }, POSITION_THRESHOLD);
    }

    function scrollToPosition(position) {
        window.scrollTo({
            top: position.y,
            behavior: 'smooth'
        });
    }

    function cycleScrollPositions(event) {
        if (event.altKey && event.key === 'c') {
            event.preventDefault();

            let now = Date.now();
            if (!isSwitching) {
                isSwitching = true;
                switchStartTime = now;
                currentIndex = 0;
            } else {
                currentIndex = (currentIndex + 1) % scrollPositions.length;
            }

            if (now - lastSwitchTime > FAST_SWITCH_THRESHOLD) {
                // Slow switch: only use the last two positions
                let lastTwo = scrollPositions.slice(0, 2);
                currentIndex = currentIndex % 2;
                scrollToPosition(lastTwo[currentIndex]);
            } else {
                // Fast switch: use all positions
                scrollToPosition(scrollPositions[currentIndex]);
            }

            lastSwitchTime = now;
        }
    }

    function endSwitching() {
        if (isSwitching) {
            isSwitching = false;
            let currentPosition = scrollPositions[currentIndex];
            scrollPositions = [currentPosition, ...scrollPositions.filter(p => p !== currentPosition)];
        }
    }

    function registerTopPosition() {
        let topPosition = { y: 0 };
        addPositionToList(topPosition);
    }

    // Register top position on page load
    registerTopPosition();

    window.addEventListener('scroll', recordScrollPosition);
    window.addEventListener('keydown', cycleScrollPositions);
    window.addEventListener('keyup', event => {
        if (event.key === 'Alt') {
            endSwitching();
        }
    });
})();